Detailed information for compound 442129
Basic information
Technical information
- TDR Targets ID: 442129
- Name: N-[(4-chlorophenyl)methyl]-2-[[[2-hydroxy-2-( 4-hydroxyphenyl)ethyl]-methylamino]methyl]-3, 4-dimethyl-7-oxothieno[3,2-b]pyridine-6-carbo xamide
- MW: 526.047 | Formula: C27H28ClN3O4S
-
H donors: 3
H acceptors: 4
LogP: 4.6
Rotable bonds: 9
Rule of 5 violations (Lipinski): 2 - SMILES: CN(Cc1sc2c(c1C)n(C)cc(c2=O)C(=O)NCc1ccc(cc1)Cl)CC(c1ccc(cc1)O)O
- InChi: 1S/C27H28ClN3O4S/c1-16-23(15-30(2)14-22(33)18-6-10-20(32)11-7-18)36-26-24(16)31(3)13-21(25(26)34)27(35)29-12-17-4-8-19(28)9-5-17/h4-11,13,22,32-33H,12,14-15H2,1-3H3,(H,29,35)
- InChiKey: LJNTWCVADOVPNJ-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[(4-chlorophenyl)methyl]-2-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methyl-amino]methyl]-3,4-dimethyl-7-oxo-thieno[3,2-b]pyridine-6-carboxamide
- N-[(4-chlorophenyl)methyl]-2-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methylamino]methyl]-3,4-dimethyl-7-oxo-6-thieno[3,2-b]pyridinecarboxamide
- N-(4-chlorobenzyl)-2-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methyl-amino]methyl]-7-keto-3,4-dimethyl-thieno[3,2-b]pyridine-6-carboxamide
- N-[(4-chlorophenyl)methyl]-2-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methylamino]methyl]-3,4-dimethyl-7-oxothieno[5,4-e]pyridine-6-carboxamide
- N-[(4-chlorophenyl)methyl]-2-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methyl-amino]methyl]-3,4-dimethyl-7-oxo-thieno[5,4-e]pyridine-6-carboxamide
- N-[(4-chlorophenyl)methyl]-2-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methylamino]methyl]-3,4-dimethyl-7-oxo-6-thieno[5,4-e]pyridinecarboxamide
- N-(4-chlorobenzyl)-2-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methyl-amino]methyl]-7-keto-3,4-dimethyl-thieno[5,4-e]pyridine-6-carboxamide
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0154 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0154 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0154 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0154 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0154 | 1 | 0.5 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0154 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | fructose-1,6-bisphosphatase | 0.0125 | 0.4033 | 0.4033 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0154 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0154 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0154 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0154 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Brugia malayi | follicle stimulating hormone receptor | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0154 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Brugia malayi | fructose-1,6-bisphosphatase | 0.0125 | 0.4033 | 0.4033 |
| Brugia malayi | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0154 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0154 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0154 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0154 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0154 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0154 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0154 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0154 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0154 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0154 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0154 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0154 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Brugia malayi | putative neuropeptide receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0154 | 1 | 1 |
| Leishmania major | 0.0125 | 0.4033 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0154 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Schistosoma mansoni | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0154 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Trypanosoma cruzi | fructose-1,6-bisphosphatase, cytosolic, putative | 0.0125 | 0.4033 | 0.5 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Trypanosoma cruzi | fructose-1,6-bisphosphatase, cytosolic, putative | 0.0125 | 0.4033 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.0154 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0154 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0154 | 1 | 1 |
| Trypanosoma brucei | fructose-1,6-bisphosphatase | 0.0125 | 0.4033 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0154 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0154 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Echinococcus granulosus | fmrfamide receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0154 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0154 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0154 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0154 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0154 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0154 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0154 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0154 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0154 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0154 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0154 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0154 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0154 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0154 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0154 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0154 | 1 | 0.5 |
| Brugia malayi | neuropeptide F receptor | 0.0154 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0154 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Toxoplasma gondii | fructose-bisphospatase II | 0.0125 | 0.4033 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0154 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0154 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0154 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0154 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0154 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0154 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0154 | 1 | 1 |
| Onchocerca volvulus | 0.0154 | 1 | 0.5 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.0154 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0154 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 0.0004 uM | Antiviral activity against HCMV in human foreskin fibroblast assessed as inhibition of virus plaque formation | ChEMBL. | 17513108 |
| IC50 (binding) | = 0.017 uM | Inhibition of human cytomegalovirus DNA polymerase | ChEMBL. | 17513108 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL233612
- PubChem: 10289450
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.