Detailed information for compound 448719
Basic information
Technical information
- TDR Targets ID: 448719
- Name: 1-morpholin-4-yl-3-(4-propan-2-ylphenyl)propa n-1-one
- MW: 261.359 | Formula: C16H23NO2
-
H donors: 0
H acceptors: 1
LogP: 2.37
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: CC(c1ccc(cc1)CCC(=O)N1CCOCC1)C
- InChi: 1S/C16H23NO2/c1-13(2)15-6-3-14(4-7-15)5-8-16(18)17-9-11-19-12-10-17/h3-4,6-7,13H,5,8-12H2,1-2H3
- InChiKey: JFZJKJXRRUHNON-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 3-(4-isopropylphenyl)-1-morpholino-propan-1-one
- 3-(4-isopropylphenyl)-1-morpholino-1-propanone
- 1-morpholino-3-p-cumenyl-propan-1-one
- 3-(4-isopropylphenyl)-1-morpholinopropan-1-one
- MLS-0146237.0001
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | FK506 binding protein 1A, 12kDa | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Trypanosoma brucei | macrophage infectivity potentiator, precursor, putative | FK506 binding protein 1A, 12kDa | 108 aa | 107 aa | 48.6 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0092 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0092 | 1 | 1 |
| Mycobacterium ulcerans | FK-506 binding protein, peptidyl-prolyl cis-trans isomerase | 0.0065 | 0.4026 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0092 | 1 | 1 |
| Trypanosoma brucei | peptidyl-prolyl cis-trans isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Giardia lamblia | 70 kDa peptidylprolyl isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Brugia malayi | neuropeptide F receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0092 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0092 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0092 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0092 | 1 | 1 |
| Trichomonas vaginalis | immunophilin, putative | 0.0065 | 0.4026 | 0.5 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0092 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0092 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0092 | 1 | 1 |
| Brugia malayi | FKBP-type peptidyl-prolyl cis-trans isomerase-12, BmFKBP-12 | 0.0065 | 0.4026 | 0.4026 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0092 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0092 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Echinococcus granulosus | allatostatin A receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0092 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0092 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0092 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | peptidyl prolyl cis trans isomerase FKBP4 | 0.0065 | 0.4026 | 0.2535 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Echinococcus granulosus | sex peptide receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0092 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0092 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0092 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0056 | 0.1997 | 0.1997 |
| Schistosoma mansoni | amine GPCR | 0.0092 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0092 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0092 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | fk506 binding protein | 0.0065 | 0.4026 | 0.2535 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | immunophilin | 0.0065 | 0.4026 | 0.2535 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0092 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0092 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0092 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0092 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0092 | 1 | 1 |
| Schistosoma mansoni | immunophilin FK506 binding protein FKBP12 | 0.0065 | 0.4026 | 0.2535 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0092 | 1 | 1 |
| Leishmania major | peptidylprolyl isomerase-like protein | 0.0065 | 0.4026 | 0.5 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0092 | 1 | 1 |
| Trypanosoma brucei | FK506-binding protein (FKBP)-type peptidyl-prolyl isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0092 | 1 | 1 |
| Trichomonas vaginalis | peptidylprolyl isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Plasmodium vivax | 70 kDa peptidylprolyl isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Trypanosoma cruzi | FK506-binding protein (FKBP)-type peptidyl-prolyl isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0092 | 1 | 1 |
| Trypanosoma cruzi | peptidyl-prolyl cis-trans isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0092 | 1 | 1 |
| Leishmania major | fk506-binding protein 1-like protein | 0.0065 | 0.4026 | 0.5 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0092 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0092 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Entamoeba histolytica | peptidyl-prolyl cis-trans isomerase, FKBP-type , putative | 0.0065 | 0.4026 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Schistosoma mansoni | myosin xvIII | 0.0092 | 1 | 1 |
| Plasmodium falciparum | peptidyl-prolyl cis-trans isomerase FKBP35 | 0.0065 | 0.4026 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Entamoeba histolytica | peptidyl-prolyl cis-trans isomerase, FKBP-type, putative | 0.0065 | 0.4026 | 0.5 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0092 | 1 | 1 |
| Trichomonas vaginalis | peptidylprolyl isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0092 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0092 | 1 | 1 |
| Trypanosoma cruzi | peptidyl-prolyl cis-trans isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Schistosoma mansoni | immunophilin | 0.0065 | 0.4026 | 0.2535 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | FKBP-type peptidyl-prolyl cis-trans isomerase-12 | 0.0065 | 0.4026 | 0.4026 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0092 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | peptidyl prolyl cis trans isomerase FKBP4 | 0.0065 | 0.4026 | 0.2535 |
| Schistosoma mansoni | opsin-like receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0092 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0092 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0092 | 1 | 1 |
| Brugia malayi | FKBP-type peptidyl-prolyl cis-trans isomerase-59, BmFKBP59 | 0.0065 | 0.4026 | 0.4026 |
| Brugia malayi | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0092 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0092 | 1 | 1 |
| Trypanosoma cruzi | FK506-binding protein (FKBP)-type peptidyl-prolyl isomerase, putative | 0.0065 | 0.4026 | 0.5 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0092 | 1 | 0.5 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0092 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0092 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0092 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0092 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0092 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0092 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0092 | 1 | 1 |
| Trichomonas vaginalis | fk506-binding protein, putative | 0.0065 | 0.4026 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0092 | 1 | 1 |
| Loa Loa (eye worm) | FKBP5 protein | 0.0065 | 0.4026 | 0.4026 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0092 | 1 | 1 |
| Echinococcus granulosus | peptidyl prolyl cis trans isomerase FKBP1A | 0.0065 | 0.4026 | 0.2535 |
| Loa Loa (eye worm) | hypothetical protein | 0.0092 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0092 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0092 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0092 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0092 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0092 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0092 | 1 | 1 |
| Onchocerca volvulus | 0.0092 | 1 | 0.5 | |
| Echinococcus granulosus | orexin receptor type 2 | 0.0092 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0092 | 1 | 1 |
| Treponema pallidum | peptidyl-prolyl cis-trans isomerase, FKBP-type, 22 kDa (fklB) | 0.0065 | 0.4026 | 0.5 |
| Giardia lamblia | FKBP-type peptidyl-prolyl cis-trans isomerase | 0.0065 | 0.4026 | 0.5 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0092 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | 0 | Induction of neurite outgrowth in Long-Evans rat E18/19 cortical neurons after 72 hrs | ChEMBL. | 18038971 |
| Kd (binding) | = 2.3 uM | Binding affinity to human FKBP12 expressed in Escherichia coli BL21(DE3) by isothermal titration calorimetry | ChEMBL. | 18038971 |
| Kd (binding) | = 2.3 uM | Binding affinity to human FKBP12 expressed in Escherichia coli BL21(DE3) by isothermal titration calorimetry | ChEMBL. | 18038971 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL429802
- PubChem: 16725066
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.