Detailed information for compound 448720
Basic information
Technical information
- TDR Targets ID: 448720
- Name: 2,2-difluoro-1-morpholin-4-yl-2-(4-propan-2-y lphenyl)sulfanylethanone
- MW: 315.379 | Formula: C15H19F2NO2S
-
H donors: 0
H acceptors: 1
LogP: 3.45
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: CC(c1ccc(cc1)SC(C(=O)N1CCOCC1)(F)F)C
- InChi: 1S/C15H19F2NO2S/c1-11(2)12-3-5-13(6-4-12)21-15(16,17)14(19)18-7-9-20-10-8-18/h3-6,11H,7-10H2,1-2H3
- InChiKey: ZFUFRDRUDRIRLP-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2,2-difluoro-2-(4-isopropylphenyl)sulfanyl-1-morpholino-ethanone
- 2,2-difluoro-2-[(4-isopropylphenyl)thio]-1-morpholinoethanone
- 2,2-difluoro-1-morpholin-4-yl-2-(4-propan-2-ylphenyl)sulfanyl-ethanone
- 2,2-difluoro-1-morpholino-2-(p-cumenylthio)ethanone
- 2,2-difluoro-2-[(4-isopropylphenyl)thio]-1-morpholino-ethanone
- MLS-0146238.0001
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | FK506 binding protein 1A, 12kDa | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Trypanosoma brucei | macrophage infectivity potentiator, precursor, putative | FK506 binding protein 1A, 12kDa | 108 aa | 107 aa | 48.6 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0072 | 1 | 1 |
| Schistosoma mansoni | immunophilin FK506 binding protein FKBP12 | 0.0065 | 0.7385 | 0.5641 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Schistosoma mansoni | opsin-like receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0072 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0072 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0072 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0072 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0072 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0072 | 1 | 1 |
| Giardia lamblia | 70 kDa peptidylprolyl isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0072 | 1 | 1 |
| Treponema pallidum | peptidyl-prolyl cis-trans isomerase, FKBP-type, 22 kDa (fklB) | 0.0065 | 0.7385 | 0.5 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0072 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0072 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0072 | 1 | 1 |
| Giardia lamblia | FKBP-type peptidyl-prolyl cis-trans isomerase | 0.0065 | 0.7385 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0072 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0072 | 1 | 1 |
| Trypanosoma cruzi | peptidyl-prolyl cis-trans isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0072 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0072 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0072 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0072 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Trypanosoma cruzi | peptidyl-prolyl cis-trans isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Echinococcus granulosus | allatostatin A receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus granulosus | peptidyl prolyl cis trans isomerase FKBP4 | 0.0065 | 0.7385 | 0.5641 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0072 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0072 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0072 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0072 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | FKBP5 protein | 0.0065 | 0.7385 | 0.7385 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0072 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Leishmania major | peptidylprolyl isomerase-like protein | 0.0065 | 0.7385 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0056 | 0.4001 | 0.4001 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Brugia malayi | Dopamine receptor | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0072 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0072 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0072 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0072 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0072 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0072 | 1 | 1 |
| Trichomonas vaginalis | fk506-binding protein, putative | 0.0065 | 0.7385 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Trypanosoma brucei | FK506-binding protein (FKBP)-type peptidyl-prolyl isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Brugia malayi | FKBP-type peptidyl-prolyl cis-trans isomerase-59, BmFKBP59 | 0.0065 | 0.7385 | 0.7385 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0072 | 1 | 1 |
| Trypanosoma cruzi | FK506-binding protein (FKBP)-type peptidyl-prolyl isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0072 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0072 | 1 | 1 |
| Brugia malayi | FKBP-type peptidyl-prolyl cis-trans isomerase-12, BmFKBP-12 | 0.0065 | 0.7385 | 0.7385 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0072 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0072 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Brugia malayi | GnHR receptor homolog | 0.0072 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0072 | 1 | 1 |
| Schistosoma mansoni | immunophilin | 0.0065 | 0.7385 | 0.5641 |
| Plasmodium falciparum | peptidyl-prolyl cis-trans isomerase FKBP35 | 0.0065 | 0.7385 | 0.5 |
| Schistosoma mansoni | histamine h1 receptor | 0.0072 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0072 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Plasmodium vivax | 70 kDa peptidylprolyl isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide s receptor | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0072 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0072 | 1 | 1 |
| Leishmania major | fk506-binding protein 1-like protein | 0.0065 | 0.7385 | 0.5 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0072 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0072 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0072 | 1 | 1 |
| Mycobacterium ulcerans | FK-506 binding protein, peptidyl-prolyl cis-trans isomerase | 0.0065 | 0.7385 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Echinococcus granulosus | hypothetical protein | 0.0072 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0072 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0072 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0072 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0072 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Trichomonas vaginalis | peptidylprolyl isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Schistosoma mansoni | myosin xvIII | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Schistosoma mansoni | immunophilin | 0.0065 | 0.7385 | 0.5641 |
| Trypanosoma cruzi | FK506-binding protein (FKBP)-type peptidyl-prolyl isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0072 | 1 | 1 |
| Trypanosoma brucei | peptidyl-prolyl cis-trans isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | peptidyl prolyl cis trans isomerase FKBP4 | 0.0065 | 0.7385 | 0.5641 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0072 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.0072 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0072 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0072 | 1 | 1 |
| Trichomonas vaginalis | peptidylprolyl isomerase, putative | 0.0065 | 0.7385 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0072 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | fk506 binding protein | 0.0065 | 0.7385 | 0.5641 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Entamoeba histolytica | peptidyl-prolyl cis-trans isomerase, FKBP-type , putative | 0.0065 | 0.7385 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Trichomonas vaginalis | immunophilin, putative | 0.0065 | 0.7385 | 0.5 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0072 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0072 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0072 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0072 | 1 | 1 |
| Entamoeba histolytica | peptidyl-prolyl cis-trans isomerase, FKBP-type, putative | 0.0065 | 0.7385 | 0.5 |
| Loa Loa (eye worm) | FKBP-type peptidyl-prolyl cis-trans isomerase-12 | 0.0065 | 0.7385 | 0.7385 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0072 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0072 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0072 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0072 | 1 | 1 |
| Echinococcus granulosus | peptidyl prolyl cis trans isomerase FKBP1A | 0.0065 | 0.7385 | 0.5641 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Onchocerca volvulus | 0.0072 | 1 | 0.5 | |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0072 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0072 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0072 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0072 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | 0 | Induction of neurite outgrowth in Long-Evans rat E18/19 cortical neurons after 72 hrs | ChEMBL. | 18038971 |
| Kd (binding) | = 2.8 uM | Binding affinity to human FKBP12 expressed in Escherichia coli BL21(DE3) by isothermal titration calorimetry | ChEMBL. | 18038971 |
| Kd (binding) | = 2.8 uM | Binding affinity to human FKBP12 expressed in Escherichia coli BL21(DE3) by isothermal titration calorimetry | ChEMBL. | 18038971 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL237231
- PubChem: 16725067
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.