Detailed information for compound 53498
Basic information
Technical information
- Name: Unnamed compound
- MW: 337.498 | Formula: C23H31NO
-
H donors: 0
H acceptors: 0
LogP: 4.89
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc2c(c1)C13CCN(C(C2)C3CCC(=C)C1)CC1CCC1
- InChi: 1S/C23H31NO/c1-16-6-9-20-22-12-18-7-8-19(25-2)13-21(18)23(20,14-16)10-11-24(22)15-17-4-3-5-17/h7-8,13,17,20,22H,1,3-6,9-12,14-15H2,2H3
- InChiKey: BTALPKCJJIAODE-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | g protein coupled receptor | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.163 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.163 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.163 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.163 | 1 | 0.5 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.163 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.163 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.163 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.163 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.163 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0098 | 0.0007 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.163 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.163 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.163 | 1 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.163 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Trypanosoma cruzi | CMGC/DYRK protein kinase, putative | 0.0098 | 0.0007 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.163 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.163 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.163 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0848 | 0.49 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.163 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0134 | 0.0241 | 0.0234 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.163 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.163 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.163 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Trypanosoma brucei | CMGC/DYRK protein kinase, putative | 0.0098 | 0.0007 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0848 | 0.49 | 0.5 |
| Schistosoma mansoni | alzheimer's disease beta-amyloid related | 0.0117 | 0.0127 | 0.012 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | cyclin dependent kinase 5 activator 1 | 0.028 | 0.1194 | 0.1188 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.163 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.163 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.163 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.163 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.163 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.163 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.163 | 1 | 1 |
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0848 | 0.49 | 0.5 |
| Loa Loa (eye worm) | CMGC/DYRK/DYRK1 protein kinase | 0.0098 | 0.0007 | 0.0007 |
| Schistosoma mansoni | biogenic amine receptor | 0.163 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.163 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0098 | 0.0007 | 0.5 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.163 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.163 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 0.0241 | 0.0241 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.163 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.163 | 1 | 1 |
| Trypanosoma cruzi | CMGC/DYRK protein kinase, putative | 0.0098 | 0.0007 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.163 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.163 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.163 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0252 | 0.101 | 0.101 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 0.0241 | 0.0241 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | cyclin-dependent kinase 5 activator | 0.028 | 0.1194 | 0.1188 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.163 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.163 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.163 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.163 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.163 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.163 | 1 | 1 |
| Onchocerca volvulus | 0.163 | 1 | 0.5 | |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.163 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.163 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.163 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.163 | 1 | 1 |
| Brugia malayi | RE15519p | 0.163 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.163 | 1 | 1 |
| Brugia malayi | Amyloid A4 extracellular domain containing protein | 0.032 | 0.1452 | 0.1447 |
| Echinococcus multilocularis | neuropeptide receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 0.1194 | 0.1194 |
| Echinococcus granulosus | cyclin dependent kinase 5 activator 1 | 0.028 | 0.1194 | 0.1188 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.163 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.163 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.163 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0098 | 0.0007 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0098 | 0.0007 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0135 | 0.0249 | 0.0249 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.163 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.163 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.163 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.163 | 1 | 1 |
| Leishmania major | serine/threonine-protein kinase, putative,protein kinase, putative | 0.0098 | 0.0007 | 0.5 |
| Echinococcus multilocularis | neuropeptide receptor | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.163 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.163 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.163 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ED50 (functional) | = 3.2 uM kg-1 | Inhibition of acetic acid induced mouse writhing assay following s.c. administration. | ChEMBL. | 6796691 |
| ED50 (functional) | > 20 uM kg-1 | Inhibition of morphine analgesia in modified rat tail flick test. | ChEMBL. | 6796691 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 15573148
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.