Detailed information for compound 589078
Basic information
Technical information
- TDR Targets ID: 589078
- Name: 2-butyl-5-(1H-indol-3-yl)oxazole
- MW: 240.3 | Formula: C15H16N2O
-
H donors: 1
H acceptors: 1
LogP: 3.86
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: CCCCc1ncc(o1)c1c[nH]c2c1cccc2
- InChi: 1S/C15H16N2O/c1-2-3-8-15-17-10-14(18-15)12-9-16-13-7-5-4-6-11(12)13/h4-7,9-10,16H,2-3,8H2,1H3
- InChiKey: KDXRUFFDZPXAHQ-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-butyl-5-(1H-indol-3-yl)-1,3-oxazole
- WS 30581B
- 3-(2-butyl-1,3-oxazol-5-yl)-1H-indole
- 3-(2-butyloxazol-5-yl)-1H-indole
- 3-(2-butyl-5-oxazolyl)-1H-indole
- 93773-63-8
- 1H-Indole, 3-(2-butyl-5-oxazolyl)-
- WS-30581B
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | intermediate filament protein | 0.0026 | 0.3979 | 0.3722 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | cathepsin L | 0.0024 | 0.3352 | 0.3352 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Schistosoma mansoni | intermediate filament proteins | 0.0026 | 0.3979 | 0.344 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0031 | 0.5467 | 0.5061 |
| Brugia malayi | Cathepsin L-like precursor | 0.0046 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Brugia malayi | cathepsin F-like cysteine proteinase | 0.0015 | 0.0822 | 0.0431 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0044 | 0.9332 | 0.9272 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0046 | 1 | 1 |
| Leishmania major | cysteine peptidase A (CPA) | 0.0046 | 1 | 0.5 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0044 | 0.9332 | 0.9272 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0031 | 0.5467 | 0.3182 |
| Leishmania major | cathepsin L-like protease | 0.0046 | 1 | 0.5 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0024 | 0.3352 | 0.2757 |
| Echinococcus granulosus | cathepsin L | 0.0024 | 0.3352 | 0.3352 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 1 | |
| Onchocerca volvulus | 0.0046 | 1 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0015 | 0.0822 | 0.0822 |
| Loa Loa (eye worm) | cytoplasmic intermediate filament protein | 0.0014 | 0.0408 | 0.0408 |
| Echinococcus granulosus | cathepsin l1 | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 1 | |
| Brugia malayi | Cathepsin L-like precursor | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0026 | 0.3979 | 0.3979 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0044 | 0.9332 | 0.9332 |
| Trypanosoma cruzi | cysteine protease, putative | 0.0024 | 0.3352 | 0.2757 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.0046 | 1 | 1 |
| Brugia malayi | cathepsin L-like cysteine proteinase, identical | 0.0015 | 0.0822 | 0.0431 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0024 | 0.3352 | 0.2757 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0046 | 1 | 0.5 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0046 | 1 | 1 |
| Plasmodium vivax | vivapain-2 | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.5467 | 0.5467 |
| Onchocerca volvulus | 0.0046 | 1 | 1 | |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0024 | 0.3352 | 0.3069 |
| Leishmania major | cathepsin L-like protease | 0.0046 | 1 | 0.5 |
| Echinococcus multilocularis | cysteine protease | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | ctsf protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | lamin | 0.0026 | 0.3979 | 0.3979 |
| Entamoeba histolytica | cysteine protease, putative | 0.0046 | 1 | 1 |
| Echinococcus granulosus | cathepsin L cysteine protease | 0.0024 | 0.3352 | 0.3352 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0046 | 1 | 1 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0026 | 0.3979 | 0.3722 |
| Onchocerca volvulus | Cathepsin F homolog | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0046 | 1 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0046 | 1 | 1 |
| Echinococcus granulosus | lamin | 0.0026 | 0.3979 | 0.3979 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0046 | 1 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0046 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0046 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.5467 | 0.5467 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0046 | 1 | 1 |
| Plasmodium vivax | unspecified product | 0.0024 | 0.3352 | 0.2757 |
| Onchocerca volvulus | 0.0046 | 1 | 1 | |
| Echinococcus multilocularis | cysteine protease | 0.0046 | 1 | 1 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0024 | 0.3352 | 0.2757 |
| Echinococcus granulosus | cathepsin l1 | 0.0031 | 0.5467 | 0.5467 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0046 | 1 | 1 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0024 | 0.3352 | 0.2757 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0031 | 0.5467 | 0.5274 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0026 | 0.3979 | 0.3979 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0044 | 0.9332 | 0.9332 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0031 | 0.5467 | 0.3182 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0046 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0046 | 1 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0046 | 1 | 1 |
| Echinococcus granulosus | lamin dm0 | 0.0026 | 0.3979 | 0.3979 |
| Echinococcus multilocularis | musashi | 0.0026 | 0.3979 | 0.3979 |
| Brugia malayi | Cathepsin L-like precursor | 0.0015 | 0.0822 | 0.0431 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0046 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0024 | 0.3352 | 0.3069 |
| Brugia malayi | Cathepsin L-like precursor | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0046 | 1 | 1 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0044 | 0.9332 | 0.9332 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0046 | 1 | 1 |
| Toxoplasma gondii | cathepsin CPL | 0.0046 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0822 | 0.0822 |
| Trypanosoma cruzi | cysteine peptidase (N-terminal), putative | 0.0024 | 0.3352 | 0.2757 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0046 | 1 | 1 |
| Brugia malayi | cathepsin L-like precursor | 0.0031 | 0.5467 | 0.5274 |
| Brugia malayi | Cathepsin L-like precursor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 0.5467 | 0.2472 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0044 | 0.9332 | 0.9272 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0031 | 0.5467 | 0.3182 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0026 | 0.3979 | 0.3979 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0046 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0046 | 1 | 0.5 |
| Loa Loa (eye worm) | fibroinase | 0.0046 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0046 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0822 | 0.0822 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.5467 | 0.5467 |
| Loa Loa (eye worm) | cysteine protease | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0822 | 0.0822 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 1 | |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0046 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0046 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0031 | 0.5467 | 0.5274 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 1 | |
| Echinococcus granulosus | cysteine protease | 0.0024 | 0.3352 | 0.3352 |
| Plasmodium vivax | vivapain-3 | 0.0024 | 0.3352 | 0.2757 |
| Brugia malayi | Cathepsin L-like precursor | 0.0031 | 0.5467 | 0.5274 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0024 | 0.3352 | 0.2757 |
| Plasmodium vivax | vivapain-2 | 0.0046 | 1 | 1 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0044 | 0.9332 | 0.9304 |
| Echinococcus multilocularis | lamin dm0 | 0.0026 | 0.3979 | 0.3979 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0044 | 0.9332 | 0.9332 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0046 | 1 | 1 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0024 | 0.3352 | 0.2757 |
| Schistosoma mansoni | lamin | 0.0026 | 0.3979 | 0.344 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0044 | 0.9332 | 0.9332 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0026 | 0.3838 | 0.3838 |
| Leishmania major | cathepsin L-like protease | 0.0046 | 1 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0046 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0046 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0046 | 1 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0046 | 1 | 1 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0046 | 1 | 1 |
| Echinococcus granulosus | intermediate filament protein | 0.0026 | 0.3979 | 0.3979 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0046 | 1 | 1 |
| Plasmodium vivax | vivapain-1 | 0.0024 | 0.3352 | 0.2757 |
| Schistosoma mansoni | lamin | 0.0026 | 0.3979 | 0.344 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0031 | 0.5467 | 0.5061 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.