Detailed information for compound 59952
Basic information
Technical information
- Name: Unnamed compound
- MW: 258.294 | Formula: C10H14N2O4S
-
H donors: 2
H acceptors: 4
LogP: 0.61
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: CN(c1ccc(cc1)S(=O)(=O)NCC(=O)O)C
- InChi: 1S/C10H14N2O4S/c1-12(2)8-3-5-9(6-4-8)17(15,16)11-7-10(13)14/h3-6,11H,7H2,1-2H3,(H,13,14)
- InChiKey: TZBCYTGWIAQDKD-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Rattus norvegicus | Aldose reductase | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Trypanosoma brucei | prostaglandin f synthase | 0.0038 | 0.9171 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.004 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0034 | 0.6339 | 0.6339 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0038 | 0.9171 | 0.5 |
| Entamoeba histolytica | aldose reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Brugia malayi | hypothetical protein | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0038 | 0.9171 | 0.8904 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.004 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0038 | 0.9171 | 0.9171 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Mycobacterium ulcerans | oxidoreductase | 0.0038 | 0.9171 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.004 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.004 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.004 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.9171 | 0.8904 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.004 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.004 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.0038 | 0.9171 | 0.8904 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.9171 | 0.8904 |
| Echinococcus multilocularis | serotonin receptor | 0.004 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.004 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.9171 | 0.8904 |
| Leishmania major | prostaglandin f synthase, putative | 0.0038 | 0.9171 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.004 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.004 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.004 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0038 | 0.9171 | 0.9171 |
| Brugia malayi | Dopamine receptor protein 1 | 0.004 | 1 | 1 |
| Trypanosoma cruzi | aldo/keto reductase, putative | 0.0038 | 0.9171 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0038 | 0.9171 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Brugia malayi | neuropeptide F receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Toxoplasma gondii | aldose reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.004 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.9171 | 0.8904 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.9171 | 0.8904 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.004 | 1 | 1 |
| Mycobacterium leprae | PROBABLE OXIDOREDUCTASE | 0.0038 | 0.9171 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.004 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Brugia malayi | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.0038 | 0.9171 | 0.8904 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Echinococcus multilocularis | aldo keto reductase | 0.0038 | 0.9171 | 0.8904 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.004 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.004 | 1 | 1 |
| Trypanosoma cruzi | aldo-keto reductase | 0.0038 | 0.9171 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.004 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Brugia malayi | G-protein coupled receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase | 0.0038 | 0.9171 | 0.8904 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.004 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.9171 | 0.8904 |
| Echinococcus multilocularis | neuropeptide receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase | 0.0038 | 0.9171 | 0.8904 |
| Leishmania major | aldo-keto reductase-like protein | 0.0038 | 0.9171 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Brugia malayi | Dopamine receptor protein 2 | 0.004 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.004 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.004 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.004 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.004 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.004 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.004 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.004 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.004 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0038 | 0.9171 | 0.5 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.004 | 1 | 1 |
| Leishmania major | prostaglandin f2-alpha synthase/D-arabinose dehydrogenase | 0.0038 | 0.9171 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.004 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Brugia malayi | G protein-coupled receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.004 | 1 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus granulosus | g-protein coupled receptor | 0.004 | 1 | 1 |
| Brugia malayi | Cytochrome P450 family protein | 0.0034 | 0.6339 | 0.6339 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.004 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.004 | 1 | 1 |
| Giardia lamblia | Aldose reductase | 0.0038 | 0.9171 | 0.5 |
| Brugia malayi | follicle stimulating hormone receptor | 0.004 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.004 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0038 | 0.9171 | 0.9171 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.9171 | 0.9171 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.004 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.004 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.9171 | 0.8904 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Brugia malayi | AKH receptor | 0.004 | 1 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Echinococcus multilocularis | sex peptide receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.0038 | 0.9171 | 0.9171 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Giardia lamblia | Aldose reductase | 0.0038 | 0.9171 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.004 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.9171 | 0.9171 |
| Echinococcus granulosus | g protein coupled receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Schistosoma mansoni | neuropeptide receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.9171 | 0.8904 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.004 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.004 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.9171 | 0.9171 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.004 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.004 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.004 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.9171 | 0.9171 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.004 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.004 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus granulosus | neuropeptide s receptor | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Leishmania major | aldehyde reductase, putative,oxidoreductase, putative | 0.0038 | 0.9171 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.004 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.004 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.004 | 1 | 1 |
| Trypanosoma brucei | aldo-keto reductase, putative | 0.0038 | 0.9171 | 1 |
| Onchocerca volvulus | 0.004 | 1 | 1 | |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.004 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase | 0.0038 | 0.9171 | 0.8904 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.004 | 1 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.0038 | 0.9171 | 0.8904 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.9171 | 0.9171 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.004 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.004 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.004 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.004 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.004 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.004 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.0038 | 0.9171 | 0.8904 |
| Echinococcus multilocularis | aldo keto reductase | 0.0038 | 0.9171 | 0.8904 |
| Brugia malayi | ORL1-like opioid receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.004 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.004 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.004 | 1 | 1 |
| Brugia malayi | RE15519p | 0.004 | 1 | 1 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.0038 | 0.9171 | 0.5 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.004 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.004 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.004 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.004 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.004 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.004 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.004 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0038 | 0.9171 | 0.9171 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.004 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 10.9 uM | Inhibition of rat aldose reductase enzyme. | ChEMBL. | 3114491 |
| IC50 (binding) | = 10.9 uM | Inhibition of rat aldose reductase enzyme. | ChEMBL. | 3114491 |
| Inhibition (binding) | = 80 % | Inhibition of rat aldose reductase activity at 100 uM. | ChEMBL. | 3114491 |
| Inhibition (binding) | = 80 % | Inhibition of rat aldose reductase activity at 100 uM. | ChEMBL. | 3114491 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL288054
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.