Detailed information for compound 599643
Basic information
Technical information
- Name: Unnamed compound
- MW: 393.399 | Formula: C21H22F3NO3
-
H donors: 1
H acceptors: 2
LogP: 4.09
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc(c(c1)O)CN1CCCC(C1)C(=O)c1ccc(cc1)C(F)(F)F
- InChi: 1S/C21H22F3NO3/c1-28-18-9-6-15(19(26)11-18)12-25-10-2-3-16(13-25)20(27)14-4-7-17(8-5-14)21(22,23)24/h4-9,11,16,26H,2-3,10,12-13H2,1H3
- InChiKey: FNGPGEHLNKUIHA-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Matrixin family protein | 0.0042 | 0.012 | 0.0261 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0105 | 0.0105 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | hypothetical protein | 0.0155 | 0.0507 | 0.0507 |
| Trypanosoma brucei | Aminopeptidase M1, putative | 0.0155 | 0.0507 | 1 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.0107 | 0.0507 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.0107 | 0.0107 |
| Toxoplasma gondii | aminopeptidase N, putative | 0.0155 | 0.0507 | 0.4141 |
| Leishmania major | aminopeptidase-like protein,metallo-peptidase, Clan MA(E), Family M1 | 0.0155 | 0.0507 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.0409 | 0.0409 |
| Brugia malayi | nuclear hormone receptor family member nhr-6 | 0.0008 | 0.0003 | 0.0006 |
| Brugia malayi | Matrixin family protein | 0.0017 | 0.0034 | 0.0075 |
| Echinococcus granulosus | histone deacetylase 8 | 0.0015 | 0.0027 | 0.0027 |
| Loa Loa (eye worm) | aspartic protease BmAsp-1 | 0.0012 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | metallo-peptidase, Clan MA(E) Family M1 | 0.0155 | 0.0507 | 1 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | histone deacetylase 1 | 0.0054 | 0.0159 | 0.0159 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.0099 | 0.0099 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0035 | 0.0394 |
| Echinococcus granulosus | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Schistosoma mansoni | subfamily A1A unassigned peptidase (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0017 | 0.0034 | 0.0034 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Brugia malayi | Peptidase family M1 containing protein | 0.0155 | 0.0507 | 0.1106 |
| Schistosoma mansoni | cytosol alanyl aminopeptidase (M01 family) | 0.0155 | 0.0507 | 0.0507 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0017 | 0.0034 | 0.0075 |
| Loa Loa (eye worm) | hypothetical protein | 0.0009 | 0.0006 | 0.0006 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.0409 | 0.0409 |
| Loa Loa (eye worm) | nuclear receptor NHR-67 | 0.0008 | 0.0003 | 0.0003 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0009 | 0.0006 | 0.0006 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | hypothetical protein | 0.0009 | 0.0006 | 0.0006 |
| Schistosoma mansoni | enhancer of zeste ezh | 0.0061 | 0.0185 | 0.0185 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0035 | 0.0077 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0054 | 0.0159 | 0.2921 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0109 | 0.1894 |
| Brugia malayi | Histone deacetylase family protein | 0.0015 | 0.0027 | 0.0059 |
| Schistosoma mansoni | nuclear hormone receptor superfamily protein-related | 0.0348 | 0.1172 | 0.1172 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0017 | 0.0034 | 0.0075 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.0071 | 0.416 |
| Brugia malayi | Eukaryotic aspartyl protease family protein | 0.0012 | 0.0016 | 0.0035 |
| Schistosoma mansoni | nuclear receptor | 0.0008 | 0.0003 | 0.0003 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0008 | 0.0003 | 0.0003 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.0107 | 0.0507 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.0409 | 0.0409 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0017 | 0.0034 | 0.0075 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.0409 | 0.2179 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0035 | 0.0077 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus granulosus | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0035 | 0.0035 |
| Trypanosoma cruzi | glucose transporter, putative | 0.0018 | 0.0035 | 0.0172 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0035 | 0.0077 |
| Toxoplasma gondii | aminopeptidase n, putative | 0.0155 | 0.0507 | 0.4141 |
| Brugia malayi | Nuclear hormone receptor E75 | 0.0008 | 0.0003 | 0.0006 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0109 | 0.1894 |
| Loa Loa (eye worm) | hypothetical protein | 0.0054 | 0.0159 | 0.0159 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Schistosoma mansoni | memapsin-2 (A01 family) | 0.0302 | 0.1013 | 0.1013 |
| Loa Loa (eye worm) | matrixin family protein | 0.0042 | 0.012 | 0.012 |
| Loa Loa (eye worm) | hypothetical protein | 0.0009 | 0.0006 | 0.0006 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0009 | 0.0006 | 0.0006 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0017 | 0.0034 | 0.0034 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0047 | 0.0047 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0035 | 0.0077 |
| Echinococcus granulosus | histone deacetylase 7 | 0.0015 | 0.0027 | 0.0027 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0035 | 0.0035 |
| Echinococcus granulosus | nuclear receptor subfamily 1 group D | 0.0009 | 0.0006 | 0.0006 |
| Schistosoma mansoni | histone deacetylase | 0.0054 | 0.0159 | 0.0159 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0017 | 0.0034 | 0.0075 |
| Loa Loa (eye worm) | hypothetical protein | 0.0155 | 0.0507 | 0.0507 |
| Echinococcus granulosus | thyroid hormone receptor alpha | 0.0008 | 0.0003 | 0.0003 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Toxoplasma gondii | sugar transporter ST3 | 0.0018 | 0.0035 | 0.0163 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.0409 | 0.0409 |
| Schistosoma mansoni | ecdysone-induced protein 78c (dr-78) | 0.0009 | 0.0006 | 0.0006 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.0107 | 0.186 |
| Brugia malayi | steroid hormone receptor | 0.0017 | 0.0034 | 0.0075 |
| Brugia malayi | Matrixin family protein | 0.0017 | 0.0034 | 0.0075 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0017 | 0.0034 | 0.0034 |
| Brugia malayi | ecdysteroid receptor | 0.0017 | 0.0034 | 0.0075 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.0071 | 0.0071 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.0107 | 0.0234 |
| Brugia malayi | ecdysone receptor | 0.0008 | 0.0003 | 0.0006 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.0409 | 0.0409 |
| Brugia malayi | Matrixin family protein | 0.0017 | 0.0034 | 0.0075 |
| Loa Loa (eye worm) | histone deacetylase 11 | 0.0015 | 0.0027 | 0.0027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0009 | 0.0006 | 0.0006 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.0071 | 0.0071 |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.0071 | 0.092 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Toxoplasma gondii | histone deacetylase HDAC3 | 0.0054 | 0.0159 | 0.121 |
| Echinococcus multilocularis | histone deacetylase 1 | 0.0054 | 0.0159 | 0.0159 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0017 | 0.0034 | 0.0034 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0107 | 0.0107 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.0126 | 0.093 |
| Schistosoma mansoni | subfamily A1A unassigned peptidase (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus multilocularis | Peptidase M1, membrane alanine aminopeptidase, N terminal | 0.0155 | 0.0507 | 0.0507 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Schistosoma mansoni | Tata binding protein associated factor (M01 family) | 0.0155 | 0.0507 | 0.0507 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0107 | 0.0107 |
| Brugia malayi | Matrix metalloprotease, N-terminal domain containing protein | 0.0021 | 0.0047 | 0.0104 |
| Brugia malayi | nuclear receptor RXR | 0.0009 | 0.0006 | 0.0013 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0017 | 0.0034 | 0.0075 |
| Toxoplasma gondii | histone deacetylase HDAC2 | 0.0054 | 0.0159 | 0.121 |
| Schistosoma mansoni | glucose transporter | 0.0018 | 0.0035 | 0.0035 |
| Trypanosoma cruzi | Aminopeptidase M1, putative | 0.0155 | 0.0507 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0017 | 0.0034 | 0.0629 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0017 | 0.0034 | 0.0034 |
| Trypanosoma cruzi | aminopeptidase, putative | 0.0155 | 0.0507 | 1 |
| Toxoplasma gondii | sugar transporter ST2 | 0.0018 | 0.0035 | 0.0163 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0017 | 0.0034 | 0.0034 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0126 | 0.2065 |
| Echinococcus granulosus | Sugar transporter ERD6 protein | 0.0018 | 0.0035 | 0.0035 |
| Loa Loa (eye worm) | TATA binding protein associated factor | 0.0155 | 0.0507 | 0.0507 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0126 | 0.2065 |
| Loa Loa (eye worm) | nuclear hormone receptor | 0.0008 | 0.0003 | 0.0003 |
| Schistosoma mansoni | subfamily A1A unassigned peptidase (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Echinococcus granulosus | nuclear receptor subfamily 4 group A | 0.0008 | 0.0003 | 0.0003 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0017 | 0.0034 | 0.0034 |
| Trichomonas vaginalis | Clan MA, family M1, aminopeptidase N-like metallopeptidase | 0.0155 | 0.0507 | 1 |
| Schistosoma mansoni | nuclear receptor nhr-48 | 0.0008 | 0.0003 | 0.0003 |
| Echinococcus granulosus | matrix metallopeptidase 7 M10 family | 0.0063 | 0.0193 | 0.0193 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.0348 | 0.0348 |
| Plasmodium falciparum | major facilitator superfamily domain-containing protein, putative | 0.0018 | 0.0035 | 0.0107 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0009 | 0.0006 | 0.0013 |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0109 | 0.1707 |
| Leishmania major | histone deacetylase, putative | 0.0054 | 0.0159 | 0.2758 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.0409 | 0.0409 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0017 | 0.0034 | 0.0075 |
| Trypanosoma cruzi | puromycin-sensitive aminopeptidase-like protein, putative | 0.0155 | 0.0507 | 1 |
| Brugia malayi | hypothetical protein | 0.0155 | 0.0507 | 0.1106 |
| Brugia malayi | Nuclear hormone receptor E75 | 0.0008 | 0.0003 | 0.0006 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.0105 | 1 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.0409 | 0.3312 |
| Mycobacterium tuberculosis | Probable peptidoglycan hydrolase | 0.0021 | 0.0047 | 0.5696 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0109 | 0.1707 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0017 | 0.0034 | 0.0034 |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.0071 | 0.092 |
| Echinococcus multilocularis | nuclear receptor subfamily 4 group A | 0.0008 | 0.0003 | 0.0003 |
| Trypanosoma cruzi | aminopeptidase, putative | 0.0155 | 0.0507 | 1 |
| Mycobacterium leprae | Probable lysyl-tRNA synthase LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0057 | 0.1602 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.0409 | 0.2179 |
| Echinococcus granulosus | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Echinococcus multilocularis | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0105 | 0.0105 |
| Echinococcus multilocularis | aminopeptidase N | 0.0155 | 0.0507 | 0.0507 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0107 | 0.0107 |
| Loa Loa (eye worm) | voltage and ligand gated potassium channel | 0.0026 | 0.0063 | 0.0063 |
| Trichomonas vaginalis | Clan MA, family M1, aminopeptidase N-like metallopeptidase | 0.0155 | 0.0507 | 1 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Mycobacterium ulcerans | aminopeptidase N PepN | 0.0155 | 0.0507 | 1 |
| Trypanosoma brucei | metallo-peptidase, Clan MA(E) Family M1 | 0.0155 | 0.0507 | 1 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0107 | 0.0107 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0107 | 0.0107 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0017 | 0.0034 | 0.0075 |
| Trypanosoma cruzi | metallo-peptidase, clan MA(E), family M1, putative | 0.0155 | 0.0507 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Mycobacterium ulcerans | integral membrane transport protein | 0.0018 | 0.0035 | 0.0309 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus multilocularis | histone deacetylase 3 | 0.0054 | 0.0159 | 0.0159 |
| Mycobacterium ulcerans | aminopeptidase N PepN | 0.0155 | 0.0507 | 1 |
| Onchocerca volvulus | 0.0025 | 0.0059 | 0.1128 | |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0017 | 0.0034 | 0.0075 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0008 | 0.0003 | 0.0003 |
| Schistosoma mansoni | nuclear transcription factor X-box binding 1 (nfx1) | 0.0018 | 0.0035 | 0.0035 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0035 | 0.0035 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0017 | 0.0034 | 0.0034 |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.0409 | 0.0409 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Echinococcus granulosus | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Loa Loa (eye worm) | histone deacetylase 7A | 0.0015 | 0.0027 | 0.0027 |
| Schistosoma mansoni | histone deacetylase hda2 | 0.0015 | 0.0027 | 0.0027 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.0071 | 0.0307 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0107 | 0.0107 |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0109 | 0.1707 |
| Giardia lamblia | Histone deacetylase | 0.0054 | 0.0159 | 1 |
| Echinococcus multilocularis | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.0107 | 0.0507 |
| Mycobacterium ulcerans | sugar transporter | 0.0018 | 0.0035 | 0.0309 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0008 | 0.0003 | 0.0003 |
| Entamoeba histolytica | aminopeptidase, putative | 0.0155 | 0.0507 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.0107 | 0.0107 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0035 | 0.0077 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0017 | 0.0034 | 0.0034 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0107 | 0.0828 |
| Toxoplasma gondii | histone deacetylase HDAC5 | 0.0015 | 0.0027 | 0.0094 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0035 | 0.0077 |
| Brugia malayi | Hemopexin family protein | 0.0025 | 0.0059 | 0.013 |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.0099 | 0.0099 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trypanosoma brucei | sugar transporter, putative | 0.0018 | 0.0035 | 0.0172 |
| Plasmodium falciparum | histone deacetylase 1 | 0.0054 | 0.0159 | 0.0796 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.0409 | 0.0409 |
| Loa Loa (eye worm) | bifunctional aminoacyl-tRNA synthetase | 0.0016 | 0.0028 | 0.0028 |
| Brugia malayi | conserved hypotetical protein | 0.0008 | 0.0003 | 0.0006 |
| Brugia malayi | orphan nuclear receptor NR2E1 | 0.0008 | 0.0003 | 0.0006 |
| Brugia malayi | aspartic protease BmAsp-1, identical | 0.0012 | 0.0016 | 0.0035 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0054 | 0.0159 | 0.2921 |
| Loa Loa (eye worm) | aspartyl protease 6 | 0.0012 | 0.0016 | 0.0016 |
| Echinococcus granulosus | histone lysine N methyltransferase Ez | 0.0061 | 0.0185 | 0.0185 |
| Plasmodium falciparum | M1-family alanyl aminopeptidase, putative | 0.0155 | 0.0507 | 0.2724 |
| Loa Loa (eye worm) | histone deacetylase 3 | 0.0054 | 0.0159 | 0.0159 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.0105 | 0.5582 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.0409 | 0.0409 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0027 | 0.0027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Trichomonas vaginalis | Clan MA, family M1, aminopeptidase N-like metallopeptidase | 0.0155 | 0.0507 | 1 |
| Echinococcus granulosus | aminopeptidase N | 0.0155 | 0.0507 | 0.0507 |
| Toxoplasma gondii | sugar transporter ST1 | 0.0018 | 0.0035 | 0.0163 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0017 | 0.0034 | 0.0075 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.0126 | 0.0612 |
| Onchocerca volvulus | 0.0017 | 0.0034 | 0.0629 | |
| Echinococcus multilocularis | histone deacetylase 7 | 0.0015 | 0.0027 | 0.0027 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0035 | 0.0035 |
| Leishmania major | hypothetical protein, conserved | 0.0018 | 0.0035 | 0.0172 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | leukotriene A4 hydrolase | 0.2913 | 1 | 1 |
| Plasmodium vivax | histone deacetylase, putative | 0.0015 | 0.0027 | 0.0062 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trypanosoma brucei | Aminopeptidase M1, putative | 0.0155 | 0.0507 | 1 |
| Brugia malayi | nuclear receptor subfamily 1, group D, member 1, putative | 0.0008 | 0.0003 | 0.0006 |
| Mycobacterium ulcerans | sugar-transport integral membrane protein SugI | 0.0018 | 0.0035 | 0.0309 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0035 | 0.0394 |
| Echinococcus multilocularis | nuclear receptor nhr 48 | 0.0008 | 0.0003 | 0.0003 |
| Brugia malayi | hypothetical protein | 0.0155 | 0.0507 | 0.1106 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0017 | 0.0034 | 0.0075 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0017 | 0.0034 | 0.0034 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Schistosoma mansoni | histone deacetylase 1 2 3 | 0.0015 | 0.0027 | 0.0027 |
| Brugia malayi | hypothetical protein | 0.0009 | 0.0006 | 0.0013 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0105 | 0.0228 |
| Leishmania major | aminopeptidase, putative,metallo-peptidase, Clan MA(E), Family M1 | 0.0155 | 0.0507 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Plasmodium vivax | sugar transporter, putative | 0.0018 | 0.0035 | 0.0107 |
| Plasmodium falciparum | M1-family alanyl aminopeptidase | 0.0155 | 0.0507 | 0.2724 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | nuclear receptor nhr-7B | 0.0008 | 0.0003 | 0.0003 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0109 | 0.1894 |
| Schistosoma mansoni | histone deacetylase 4 5 | 0.0015 | 0.0027 | 0.0027 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0017 | 0.0034 | 0.0034 |
| Brugia malayi | Peptidase family M1 containing protein | 0.0155 | 0.0507 | 0.1106 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Onchocerca volvulus | 0.0012 | 0.0016 | 0.0265 | |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0008 | 0.0003 | 0.0003 |
| Echinococcus multilocularis | potassium voltage gated channel subfamily H | 0.0026 | 0.0063 | 0.0063 |
| Echinococcus granulosus | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.0071 | 0.0466 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0054 | 0.0159 | 0.2921 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0008 | 0.0003 | 0.0003 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.0105 | 0.0766 |
| Schistosoma mansoni | subfamily A1A unassigned peptidase (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Plasmodium vivax | M1-family alanyl aminopeptidase, putative | 0.0155 | 0.0507 | 0.2724 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0017 | 0.0034 | 0.0034 |
| Schistosoma mansoni | subfamily A1A unassigned peptidase (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0017 | 0.0034 | 0.0034 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.0107 | 0.0771 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0071 | 0.0071 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0017 | 0.0034 | 0.0034 |
| Toxoplasma gondii | histone deacetylase HDAC4 | 0.0015 | 0.0027 | 0.0094 |
| Echinococcus multilocularis | matrix metallopeptidase 7 (M10 family) | 0.0063 | 0.0193 | 0.0193 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0024 | 0.0057 | 0.084 |
| Brugia malayi | Peptidase family M1 containing protein | 0.0155 | 0.0507 | 0.1106 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0054 | 0.0159 | 0.2921 |
| Loa Loa (eye worm) | hypothetical protein | 0.0009 | 0.0006 | 0.0006 |
| Brugia malayi | hypothetical protein | 0.0012 | 0.0016 | 0.0035 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0109 | 0.1894 |
| Trypanosoma brucei | aminopeptidase, putative | 0.0155 | 0.0507 | 1 |
| Loa Loa (eye worm) | DR-78 | 0.0008 | 0.0003 | 0.0003 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Brugia malayi | histone deacetylase 3 (HD3) | 0.0054 | 0.0159 | 0.0348 |
| Leishmania major | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0035 | 0.0172 |
| Toxoplasma gondii | aminopeptidase N protein | 0.0155 | 0.0507 | 0.4141 |
| Schistosoma mansoni | subfamily A1A unassigned peptidase (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0054 | 0.0159 | 0.2921 |
| Brugia malayi | Voltage-gated potassium channel, HERG (KCNH2)-related. C. elegans unc-103 ortholog | 0.0026 | 0.0063 | 0.0138 |
| Loa Loa (eye worm) | matrixin family protein | 0.0039 | 0.0108 | 0.0108 |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.0676 | 0.5569 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0035 | 0.0077 |
| Treponema pallidum | prolyl-tRNA synthetase | 0.0013 | 0.002 | 0.5 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.0126 | 0.0612 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | matrix metalloproteinase | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0035 | 0.0077 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.0105 | 0.1805 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0035 | 0.0394 |
| Echinococcus multilocularis | retinoic acid receptor rxr beta a retinoic acid receptor rxr alpha a retinoic acid receptor rxr alpha | 0.0008 | 0.0003 | 0.0003 |
| Toxoplasma gondii | transporter, major facilitator family protein | 0.0018 | 0.0035 | 0.0163 |
| Trypanosoma cruzi | sugar transporter, putative | 0.0018 | 0.0035 | 0.0172 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0107 | 0.0107 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.0107 | 0.0234 |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0105 | 0.0228 |
| Trypanosoma cruzi | histone deacetylase 1, putative | 0.0054 | 0.0159 | 0.2758 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0017 | 0.0034 | 0.0629 |
| Echinococcus granulosus | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0107 | 0.0107 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.0409 | 0.0409 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0017 | 0.0034 | 0.0034 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.0071 | 0.2892 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0008 | 0.0003 | 0.0003 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.0071 | 0.1125 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0017 | 0.0034 | 0.0629 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Plasmodium vivax | histone deacetylase 1, putative | 0.0054 | 0.0159 | 0.0796 |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0008 | 0.0003 | 0.0003 |
| Echinococcus multilocularis | histone deacetylase 6 | 0.0015 | 0.0027 | 0.0027 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0107 | 0.0107 |
| Brugia malayi | aspartic protease BmAsp-2, identical | 0.0012 | 0.0016 | 0.0035 |
| Onchocerca volvulus | Histone deacetylase 10 homolog | 0.0015 | 0.0027 | 0.0485 |
| Brugia malayi | TATA binding protein associated factor | 0.0155 | 0.0507 | 0.1106 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0008 | 0.0003 | 0.0003 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0057 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0035 | 0.0035 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Entamoeba histolytica | histone deacetylase, putative | 0.0054 | 0.0159 | 0.2024 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Onchocerca volvulus | 0.0155 | 0.0507 | 1 | |
| Echinococcus multilocularis | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Leishmania major | histone deacetylase, putative | 0.0054 | 0.0159 | 0.2758 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.0071 | 0.092 |
| Loa Loa (eye worm) | aminopeptidase N | 0.0155 | 0.0507 | 0.0507 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0017 | 0.0034 | 0.0034 |
| Trichomonas vaginalis | voltage and ligand gated potassium channel, putative | 0.0024 | 0.0057 | 0.084 |
| Echinococcus granulosus | potassium voltage gated channel subfamily H | 0.0026 | 0.0063 | 0.0063 |
| Brugia malayi | nuclear receptor RXR | 0.0008 | 0.0003 | 0.0006 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0105 | 0.0105 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Trypanosoma cruzi | histone deacetylase 1, putative | 0.0054 | 0.0159 | 0.2758 |
| Echinococcus multilocularis | Sugar transporter ERD6 protein | 0.0018 | 0.0035 | 0.0035 |
| Brugia malayi | tailless protein | 0.0008 | 0.0003 | 0.0006 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0035 | 0.0394 |
| Brugia malayi | nuclear hormone receptor family member odr-7 | 0.0008 | 0.0003 | 0.0006 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0107 | 0.0107 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0016 | 0.0016 |
| Trypanosoma brucei | histone deacetylase 1 | 0.0054 | 0.0159 | 0.2758 |
| Loa Loa (eye worm) | hypothetical protein | 0.0022 | 0.0051 | 0.0051 |
| Schistosoma mansoni | nuclear receptor | 0.0008 | 0.0003 | 0.0003 |
| Trichomonas vaginalis | histone deacetylase 1, 2 ,3, putative | 0.0054 | 0.0159 | 0.2921 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0017 | 0.0034 | 0.0034 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0017 | 0.0034 | 0.0034 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.1202 | 0.6579 |
| Echinococcus granulosus | histone deacetylase 1 | 0.0054 | 0.0159 | 0.0159 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.0071 | 1 |
| Schistosoma mansoni | hepatocyte nuclear factor 4-alpha (hnf-4-alpha) | 0.0008 | 0.0003 | 0.0003 |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.0348 | 0.0348 |
| Echinococcus granulosus | histone deacetylase 3 | 0.0054 | 0.0159 | 0.0159 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0017 | 0.0034 | 0.0034 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.0409 | 0.0409 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0016 | 0.0016 |
| Echinococcus multilocularis | synaptic vesicle 2 protein | 0.0018 | 0.0035 | 0.0035 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Brugia malayi | Pepsin A precursor | 0.0012 | 0.0016 | 0.0035 |
| Leishmania major | puromycin-sensitive aminopeptidase-like protein,metallo-peptidase, Clan MA(E), Family M1 | 0.0155 | 0.0507 | 1 |
| Echinococcus multilocularis | leukotriene A 4 hydrolase | 0.2913 | 1 | 1 |
| Trichomonas vaginalis | histone deacetylase 1, 2 ,3, putative | 0.0054 | 0.0159 | 0.2921 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Brugia malayi | hypothetical protein | 0.0012 | 0.0016 | 0.0035 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.0035 | 0.0035 |
| Echinococcus multilocularis | histone deacetylase 6 | 0.0015 | 0.0027 | 0.0027 |
| Schistosoma mansoni | matrix metallopeptidase-7 (M10 family) | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0035 | 0.0035 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0017 | 0.0034 | 0.0034 |
| Trichomonas vaginalis | myo-inositol transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.0107 | 0.0107 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.0107 | 0.0771 |
| Brugia malayi | Histone deacetylase 1 | 0.0054 | 0.0159 | 0.0348 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0016 | 0.0016 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Echinococcus granulosus | FTZ F1 alpha | 0.0017 | 0.0034 | 0.0034 |
| Schistosoma mansoni | leukotriene A4 hydrolase (M01 family) | 0.2913 | 1 | 1 |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0109 | 0.1707 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0017 | 0.0034 | 0.0034 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Echinococcus granulosus | synaptic vesicle 2 protein | 0.0018 | 0.0035 | 0.0035 |
| Brugia malayi | SET domain containing protein | 0.0061 | 0.0185 | 0.0404 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0057 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | peptidase family M1 containing protein | 0.0155 | 0.0507 | 0.0507 |
| Onchocerca volvulus | 0.0017 | 0.0034 | 0.063 | |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0017 | 0.0034 | 0.0075 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0059 | 0.0882 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0039 | 0.0107 | 0.0507 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0017 | 0.0034 | 0.0034 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Schistosoma mansoni | hypothetical protein | 0.0025 | 0.0059 | 0.0059 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Schistosoma mansoni | subfamily A1A unassigned peptidase (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Trichomonas vaginalis | sugar transport protein, putative | 0.0018 | 0.0035 | 0.0394 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0035 | 0.0035 |
| Echinococcus granulosus | histone deacetylase 6 | 0.0015 | 0.0027 | 0.0027 |
| Plasmodium vivax | histone deacetylase, putative | 0.0015 | 0.0027 | 0.0062 |
| Loa Loa (eye worm) | histone deacetylase | 0.0015 | 0.0027 | 0.0027 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0035 | 0.0035 |
| Trypanosoma brucei | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0035 | 0.0172 |
| Echinococcus multilocularis | histone deacetylase 6 | 0.0015 | 0.0027 | 0.0027 |
| Schistosoma mansoni | subfamily A1A unassigned peptidase (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.0071 | 0.0307 |
| Brugia malayi | hypothetical protein | 0.0009 | 0.0006 | 0.0013 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0017 | 0.0034 | 0.0034 |
| Onchocerca volvulus | 0.0155 | 0.0507 | 1 | |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0017 | 0.0034 | 0.0075 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0109 | 0.1707 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0028 | 0.0071 | 0.0071 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Echinococcus granulosus | nuclear receptor nhr 48 | 0.0008 | 0.0003 | 0.0003 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0105 | 0.0105 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0018 | 0.0035 | 0.0172 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0017 | 0.0034 | 0.0075 |
| Onchocerca volvulus | Putative transporter | 0.0018 | 0.0035 | 0.0649 |
| Schistosoma mansoni | cathepsin D (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0017 | 0.0034 | 0.0034 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.0107 | 0.0107 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Schistosoma mansoni | aminopeptidase PILS (M01 family) | 0.0155 | 0.0507 | 0.0507 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.0409 | 0.7998 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.0676 | 0.3664 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0035 | 0.0035 |
| Leishmania major | aminopeptidase, putative,metallo-peptidase, Clan MA(E), Family M1 | 0.0155 | 0.0507 | 1 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.0048 | 0.0434 |
| Schistosoma mansoni | voltage-gated potassium channel | 0.0028 | 0.0071 | 0.0071 |
| Brugia malayi | nuclear hormone receptor | 0.0017 | 0.0034 | 0.0075 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0071 | 0.0071 |
| Brugia malayi | hypothetical protein | 0.0008 | 0.0003 | 0.0006 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.0107 | 0.0507 |
| Loa Loa (eye worm) | hypothetical protein | 0.0155 | 0.0507 | 0.0507 |
| Plasmodium vivax | M1-family alanyl aminopeptidase, putative | 0.0155 | 0.0507 | 0.2724 |
| Echinococcus multilocularis | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Schistosoma mansoni | subfamily A1A unassigned peptidase (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.0071 | 0.0155 |
| Echinococcus multilocularis | histone deacetylase 8 | 0.0015 | 0.0027 | 0.0027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0054 | 0.0159 | 0.2921 |
| Loa Loa (eye worm) | aspartic protease BmAsp-2 | 0.0012 | 0.0016 | 0.0016 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.0409 | 0.0409 |
| Brugia malayi | histone deacetylase 11 | 0.0015 | 0.0027 | 0.0059 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus multilocularis | cathepsin d (lysosomal aspartyl protease) | 0.0012 | 0.0016 | 0.0016 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0034 | 0.0034 |
| Wolbachia endosymbiont of Brugia malayi | major facilitator superfamily permease | 0.0018 | 0.0035 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0035 | 0.0077 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0109 | 0.1894 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0008 | 0.0003 | 0.0006 |
| Mycobacterium ulcerans | hydrolase | 0.0021 | 0.0047 | 0.0558 |
| Brugia malayi | nuclear receptor NHR-67 | 0.0008 | 0.0003 | 0.0006 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0109 | 0.1894 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0071 | 0.1047 |
| Plasmodium falciparum | protein kinase 6 | 0.0536 | 0.1818 | 1 |
| Toxoplasma gondii | histone deacetylase HDAC1 | 0.0015 | 0.0027 | 0.0094 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0035 | 0.0077 |
| Schistosoma mansoni | histone deacetylase | 0.0054 | 0.0159 | 0.0159 |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.0107 | 0.0507 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0017 | 0.0034 | 0.0034 |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.0409 | 0.0892 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.008 | 0.008 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0109 | 0.1707 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0105 | 0.0105 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0035 | 0.0394 |
| Plasmodium falciparum | histone deacetylase, putative | 0.0015 | 0.0027 | 0.0062 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.0107 | 0.0507 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0017 | 0.0034 | 0.0075 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Brugia malayi | Histone deacetylase family protein | 0.0015 | 0.0027 | 0.0059 |
| Brugia malayi | nuclear hormone receptor | 0.0008 | 0.0003 | 0.0006 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.0107 | 0.0507 |
| Trichomonas vaginalis | histone deacetylase 1, 2 ,3, putative | 0.0054 | 0.0159 | 0.2921 |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0109 | 0.1707 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0109 | 0.1707 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.1202 | 1 |
| Schistosoma mansoni | zinc finger protein | 0.0008 | 0.0003 | 0.0003 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.0107 | 0.1671 |
| Echinococcus multilocularis | puromycin sensitive aminopeptidase | 0.0155 | 0.0507 | 0.0507 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0017 | 0.0034 | 0.0075 |
| Onchocerca volvulus | Matrilysin homolog | 0.0039 | 0.0108 | 0.2081 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0109 | 0.1894 |
| Schistosoma mansoni | histone deacetylase hda2 | 0.0015 | 0.0027 | 0.0027 |
| Schistosoma mansoni | aminopeptidase A (M01 family) | 0.0155 | 0.0507 | 0.0507 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0105 | 0.0105 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0035 | 0.0035 |
| Brugia malayi | Matrixin family protein | 0.0017 | 0.0034 | 0.0075 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.0107 | 0.0771 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Brugia malayi | hypothetical protein | 0.1339 | 0.4584 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0035 | 0.0035 |
| Plasmodium falciparum | histone deacetylase 2 | 0.0015 | 0.0027 | 0.0062 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0071 | 0.1047 |
| Mycobacterium ulcerans | fusion protein of transposase for IS2606 and sialic acid-transport integral membrane protein NanT | 0.0018 | 0.0035 | 0.0309 |
| Loa Loa (eye worm) | SET domain-containing protein | 0.0061 | 0.0185 | 0.0185 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.0676 | 0.3664 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0009 | 0.0006 | 0.0013 |
| Onchocerca volvulus | 0.0155 | 0.0507 | 1 | |
| Echinococcus granulosus | histone deacetylase | 0.0015 | 0.0027 | 0.0027 |
| Echinococcus multilocularis | histone lysine N methyltransferase E(z) | 0.0061 | 0.0185 | 0.0185 |
| Onchocerca volvulus | 0.0012 | 0.0016 | 0.0265 | |
| Schistosoma mansoni | cathepsin D (A01 family) | 0.0012 | 0.0016 | 0.0016 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.0107 | 0.1671 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0126 | 0.2065 |
| Echinococcus granulosus | cathepsin d lysosomal aspartyl protease | 0.0012 | 0.0016 | 0.0016 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0126 | 0.2065 |
| Onchocerca volvulus | Matrilysin homolog | 0.0017 | 0.0034 | 0.063 |
| Trypanosoma cruzi | metallo-peptidase, clan MA(E), family M1, putative | 0.0155 | 0.0507 | 1 |
| Onchocerca volvulus | 0.0018 | 0.0035 | 0.0649 | |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0107 | 0.0107 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 0.1818 | 1 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0071 | 0.0071 |
| Onchocerca volvulus | Matrix metalloproteinase homolog | 0.0039 | 0.0108 | 0.2081 |
| Trypanosoma cruzi | puromycin-sensitive aminopeptidase-like protein, putative | 0.0155 | 0.0507 | 1 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0017 | 0.0034 | 0.0034 |
| Echinococcus multilocularis | histone deacetylase | 0.0015 | 0.0027 | 0.0027 |
| Brugia malayi | hypothetical protein | 0.0008 | 0.0003 | 0.0006 |
| Plasmodium vivax | histone deacetylase 2, putative | 0.0015 | 0.0027 | 0.0062 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0035 | 0.0035 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0107 | 0.0828 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0017 | 0.0034 | 0.0075 |
| Echinococcus granulosus | histone deacetylase 6 | 0.0015 | 0.0027 | 0.0027 |
| Echinococcus granulosus | histone deacetylase 6 | 0.0015 | 0.0027 | 0.0027 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0035 | 0.0035 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0003 | 0.0003 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.0107 | 0.0507 |
| Schistosoma mansoni | histone deacetylase 4 5 | 0.0015 | 0.0027 | 0.0027 |
| Echinococcus multilocularis | nuclear receptor subfamily 1 group D | 0.0009 | 0.0006 | 0.0006 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0035 | 0.0035 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.0409 | 0.0409 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0017 | 0.0034 | 0.0075 |
| Brugia malayi | histone deacetylase 1 (HD1) | 0.0054 | 0.0159 | 0.0348 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0035 | 0.0035 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0126 | 0.2065 |
| Schistosoma mansoni | coup transcription factor | 0.0017 | 0.0034 | 0.0034 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0035 | 0.0394 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 728 nM | MMV: Inhibition of Plasmodium falciparum K1 (EC50). | ChEMBL. | No reference |
| Growth Inhibition (functional) | = 43.708 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | = 635.4 nM | MMV: IC50 determined against P. falciparum Dd2-luc strain using a Malaria Sybr Green I Fluorescence assay. Starting conditions were 1% trophozoite synchronised parasites at 2% haematocrit. Fluorescence detection completed after 48hr incubation at 37 degrees C under 1% O2, 3% CO2 and balance N2. | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 | > 32 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| Inhibition (functional) | = -17.4548388332222 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -17.454838833222187 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.73229006096484 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.7322900609648375 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 0 % | GSK_TCMDC: Percent inhibition of human HepG2 cell line. Test compounds present at 10uM. | ChEMBL. | 20485427 |
| Inhibition (functional) | = 0 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 LDH activity, using an LDH reporter assay. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 1.85 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 3.56 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 4.48 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 4.79 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 6.88878867660097 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 35.3 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 36.0864211725026 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 58 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 88 % | GSK_TCMDC: Inhibition of Plasmodium falciparum Dd2 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 97 % | MMV: Inhibition of Plasmodium falciparum 3D7 at 5uM compound concentration. | ChEMBL. | No reference |
| Inhibition (functional) | = 98 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 100 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition frequency index (IFI) (functional) | = 4.65 | Inhibition Frequency Index (IFI) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = -3 % | Percent inhibition of P. falciparum lactate dehydrogenase activity (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = -2 % | Percent inhibition of HepG2 growth (at 10 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 88 % | Percent inhibition of P. falciparum Dd2 growth (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 98 % | Percent inhibition of P. falciparum 3D7 growth (at 2 uM) | GSK. | 20485427 |
| Ratio (functional) | = 0.885245901639344 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.9168 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.4404 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.2476 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| XC50 (functional) | = 6.07 | XC50 determination of P. falciparum 3D7 growth | GSK. | 20485427 |
| XC50 (functional) | = 0.84864 uM | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole erythrocytes, using parasite LDH activity as an index of growth. | ChEMBL. | 20485427 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL529968
- Search by GSK
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.