Detailed information for compound 724656
Basic information
Technical information
- TDR Targets ID: 724656
- Name: N-(1,3-benzodioxol-5-yl)-3-chloro-4-methoxybe nzenesulfonamide
- MW: 341.767 | Formula: C14H12ClNO5S
-
H donors: 1
H acceptors: 2
LogP: 2.86
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc(cc1Cl)S(=O)(=O)Nc1ccc2c(c1)OCO2
- InChi: 1S/C14H12ClNO5S/c1-19-12-5-3-10(7-11(12)15)22(17,18)16-9-2-4-13-14(6-9)21-8-20-13/h2-7,16H,8H2,1H3
- InChiKey: RVFVLNWIWAOPHI-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-(1,3-benzodioxol-5-yl)-3-chloro-4-methoxy-benzenesulfonamide
- N-1,3-benzodioxol-5-yl-3-chloro-4-methoxybenzenesulfonamide
- SMR000078768
- STK183735
- ZINC02865966
- MLS000065194
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Trypanosoma cruzi | cysteine peptidase, putative | Starlite/ChEMBL | No references |
| Homo sapiens | glucagon-like peptide 1 receptor | Starlite/ChEMBL | No references |
| Escherichia coli O157:H7 | Shiga toxin | Starlite/ChEMBL | No references |
| Homo sapiens | TAR DNA binding protein | Starlite/ChEMBL | No references |
| Mus musculus | RAR-related orphan receptor gamma | Starlite/ChEMBL | No references |
| Homo sapiens | K(lysine) acetyltransferase 2A | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Schistosoma japonicum | Katanin p80 WD40-containing subunit B1, putative | Shiga toxin | 89 aa | 72 aa | 23.6 % |
| Schistosoma mansoni | katanin P80 subunit | Shiga toxin | 89 aa | 72 aa | 23.6 % |
| Trichomonas vaginalis | coatomer beta subunit, putative | Shiga toxin | 89 aa | 87 aa | 27.6 % |
| Echinococcus granulosus | imidazolonepropionase | Shiga toxin | 89 aa | 94 aa | 25.5 % |
| Echinococcus multilocularis | imidazolonepropionase | Shiga toxin | 89 aa | 94 aa | 26.6 % |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | glucagon-like peptide 1 receptor | 463 aa | 388 aa | 25.8 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Plasmodium vivax | vivapain-2 | 0.002 | 0.0596 | 0.2388 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0012 | 0.0109 | 0.0109 |
| Toxoplasma gondii | histone lysine acetyltransferase GCN5-A | 0.0051 | 0.2494 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0012 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | tar DNA binding protein | 0.0076 | 0.4014 | 0.4014 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.4014 | 0.4014 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0012 | 0.0109 | 0.0109 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.0596 | 0.2666 |
| Echinococcus granulosus | cathepsin l1 | 0.0014 | 0.019 | 0.0195 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.002 | 0.0596 | 0.2666 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.019 | 0.076 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0524 | 0.0524 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0012 | 0.0109 | 0.0109 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0012 | 0.0109 | 0.0112 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0596 | 0.0596 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.0596 | 0.0596 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0012 | 0.0109 | 0.0109 |
| Onchocerca volvulus | 0.002 | 0.0596 | 1 | |
| Loa Loa (eye worm) | acetyltransferase | 0.0175 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0012 | 0.0109 | 0.0109 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0014 | 0.019 | 0.0848 |
| Loa Loa (eye worm) | hypothetical protein | 0.0014 | 0.019 | 0.0082 |
| Echinococcus granulosus | cadherin EGF LAG seven pass G type receptor | 0.0019 | 0.0524 | 0.054 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0012 | 0.0109 | 0.0112 |
| Onchocerca volvulus | 0.002 | 0.0596 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Schistosoma mansoni | gcn5proteinral control of amino-acid synthesis 5-like 2 gcnl2 | 0.0175 | 1 | 1 |
| Onchocerca volvulus | 0.002 | 0.0596 | 1 | |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0596 | 0.0596 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0596 | 0.0596 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0012 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | gcn5proteinral control of amino acid synthesis | 0.0175 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.019 | 0.019 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.0596 | 0.0596 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0524 | 0.0524 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0012 | 0.0109 | 0.0109 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Plasmodium vivax | vivapain-2 | 0.002 | 0.0596 | 0.2388 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.4047 | 1 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.006 | 0.3024 | 0.3024 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.0596 | 0.0596 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.002 | 0.0596 | 0.2666 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0012 | 0.0109 | 0.0109 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0012 | 0.0109 | 0.0109 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0524 | 0.0524 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0041 | 0.1867 | 0.1867 |
| Entamoeba histolytica | cysteine protease, putative | 0.002 | 0.0596 | 0.2666 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Onchocerca volvulus | 0.002 | 0.0596 | 1 | |
| Loa Loa (eye worm) | ctsf protein | 0.002 | 0.0596 | 0.0492 |
| Echinococcus granulosus | histone acetyltransferase KAT2B | 0.0051 | 0.2494 | 0.2571 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0012 | 0.0109 | 0.0109 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0012 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.0596 | 0.0596 |
| Brugia malayi | ecdysteroid receptor | 0.0012 | 0.0109 | 0.0109 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.4014 | 0.4014 |
| Onchocerca volvulus | 0.002 | 0.0596 | 1 | |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0012 | 0.0109 | 0.0112 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0012 | 0.0109 | 0.0109 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0012 | 0.0109 | 0.0112 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.0596 | 0.0596 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.4014 | 0.4014 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0012 | 0.0109 | 0.0109 |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.019 | 0.019 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.002 | 0.0596 | 0.0492 |
| Loa Loa (eye worm) | hypothetical protein | 0.002 | 0.0596 | 0.0492 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.4047 | 1 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0012 | 0.0109 | 0.0112 |
| Brugia malayi | nuclear hormone receptor | 0.0012 | 0.0109 | 0.0109 |
| Echinococcus granulosus | cathepsin l1 | 0.002 | 0.0596 | 0.0614 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0019 | 0.0524 | 0.0524 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0012 | 0.0109 | 0.0109 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0012 | 0.0109 | 0.0109 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.4047 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0012 | 0.0109 | 0.0109 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Loa Loa (eye worm) | RNA recognition domain-containing protein domain-containing protein | 0.0076 | 0.4014 | 0.3949 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.002 | 0.0596 | 0.0492 |
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.0596 | 1 |
| Trichomonas vaginalis | cat eye syndrome critical region protein 2, cscr2, putative | 0.0051 | 0.2494 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0012 | 0.0109 | 0.0109 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0012 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0019 | 0.0524 | 0.042 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0012 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | fibroinase | 0.002 | 0.0596 | 0.0492 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.019 | 0.076 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0012 | 0.0109 | 0.0109 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.4014 | 0.4014 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.002 | 0.0596 | 0.2666 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0012 | 0.0109 | 0.0109 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0014 | 0.019 | 0.019 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Schistosoma mansoni | coup transcription factor | 0.0012 | 0.0109 | 0.0109 |
| Brugia malayi | RNA recognition motif domain containing protein | 0.0076 | 0.4014 | 0.4014 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0596 | 0.0596 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0076 | 0.4014 | 0.4014 |
| Brugia malayi | RNA binding protein | 0.0076 | 0.4014 | 0.4014 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0012 | 0.0109 | 0.0109 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Echinococcus multilocularis | diuretic hormone 44 receptor GPRdih2 | 0.0019 | 0.0524 | 0.0524 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.4047 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.0596 | 0.0596 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.006 | 0.3024 | 0.2948 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0019 | 0.0524 | 0.0524 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.1867 | 0.1778 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0012 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.0596 | 0.0596 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.4047 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0014 | 0.019 | 0.0082 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0012 | 0.0109 | 0.0112 |
| Trichomonas vaginalis | bromodomain-containing protein, putative | 0.0051 | 0.2494 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 0.3024 | 0.2948 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.002 | 0.0596 | 0.0596 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0012 | 0.0109 | 0.0109 |
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.0596 | 1 |
| Onchocerca volvulus | 0.002 | 0.0596 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0014 | 0.019 | 0.0082 |
| Toxoplasma gondii | histone lysine acetyltransferase GCN5-B | 0.0051 | 0.2494 | 1 |
| Loa Loa (eye worm) | cysteine protease | 0.002 | 0.0596 | 0.0492 |
| Echinococcus granulosus | diuretic hormone 44 receptor GPRdih2 | 0.0019 | 0.0524 | 0.054 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0596 | 0.0596 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.002 | 0.0596 | 0.1472 |
| Brugia malayi | TAR-binding protein | 0.0076 | 0.4014 | 0.4014 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0012 | 0.0109 | 0.0112 |
| Onchocerca volvulus | Cathepsin F homolog | 0.002 | 0.0596 | 1 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0012 | 0.0109 | 0.0112 |
| Schistosoma mansoni | hypothetical protein | 0.0041 | 0.1867 | 0.1867 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Plasmodium falciparum | histone acetyltransferase GCN5 | 0.0047 | 0.2234 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.0596 | 0.2666 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0524 | 0.042 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.006 | 0.3024 | 0.3024 |
| Echinococcus granulosus | GPCR family 2 | 0.0019 | 0.0524 | 0.054 |
| Onchocerca volvulus | 0.002 | 0.0596 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0012 | 0.0109 | 0.0109 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.0596 | 0.0596 |
| Echinococcus granulosus | tar DNA binding protein | 0.0076 | 0.4014 | 0.4138 |
| Echinococcus multilocularis | GPCR, family 2 | 0.0019 | 0.0524 | 0.0524 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.4047 | 1 |
| Entamoeba histolytica | acetyltransferase, GNAT family | 0.0047 | 0.2234 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Onchocerca volvulus | 0.0014 | 0.019 | 0.166 | |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0014 | 0.019 | 0.019 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0012 | 0.0109 | 0.0109 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0061 | 0.3046 | 0.7525 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0012 | 0.0109 | 0.0109 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.002 | 0.0596 | 0.0614 |
| Loa Loa (eye worm) | TAR-binding protein | 0.0076 | 0.4014 | 0.3949 |
| Brugia malayi | steroid hormone receptor | 0.0012 | 0.0109 | 0.0109 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Echinococcus multilocularis | cadherin EGF LAG seven pass G type receptor | 0.0019 | 0.0524 | 0.0524 |
| Loa Loa (eye worm) | RNA binding protein | 0.0076 | 0.4014 | 0.3949 |
| Echinococcus granulosus | histone acetyltransferase KAT2B | 0.017 | 0.9702 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0012 | 0.0109 | 0.0109 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.002 | 0.0596 | 0.0614 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.4047 | 1 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0012 | 0.0109 | 0.0112 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0012 | 0.0109 | 0.0109 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0012 | 0.0109 | 0.0109 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0012 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0012 | 0.0109 | 0.0109 |
| Giardia lamblia | Histone acetyltransferase GCN5 | 0.0047 | 0.2234 | 0.5 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0012 | 0.0109 | 0.0109 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0012 | 0.0109 | 0.0109 |
| Plasmodium vivax | histone acetyltransferase GCN5, putative | 0.0051 | 0.2494 | 1 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0012 | 0.0109 | 0.0109 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.0596 | 0.0596 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0524 | 0.0524 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0012 | 0.0109 | 0.0109 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0077 | 0.4047 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0012 | 0.0109 | 0.0109 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.007 | 0.3641 | 0.8997 |
| Brugia malayi | cathepsin L-like precursor | 0.0014 | 0.019 | 0.019 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.0596 | 0.2388 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | = 4.4878 um | PUBCHEM_BIOASSAY: A qHTS for Small Molecule Inhibitors of Shiga Toxin (Confirmatory). (Class of assay: confirmatory) [Related pubchem assays: 2314, 2318, 2315 ] | ChEMBL. | No reference |
| Potency (functional) | 5.0119 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of GCN5L2. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504398] | ChEMBL. | No reference |
| Potency (functional) | 10 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 12.5893 uM | PubChem BioAssay. qHTS of TDP-43 Inhibitors. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
| Potency (binding) | = 22.3872 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Thioflavin T Binding. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (functional) | 29.0929 uM | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493153, AID493163, AID504648] | ChEMBL. | No reference |
| Potency (functional) | = 35.4813 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase). (Class of assay: confirmatory) [Related pubchem assays: 2429 (Confirmation qHTS Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase)), 2407 (Probe Development Summary for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase)), 2427 (Thermal Shift Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase))] | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PubChem BioAssay. qHTS for Agonist of gsp, the Etiologic Mutation Responsible for Fibrous Dysplasia/McCune-Albright Syndrome: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PubChem BioAssay. qHTS for Antagonist of cAMP-regulated guanine nucleotide exchange factor 2 (EPAC2): primary screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1529493
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.