Detailed information for compound 816591
Basic information
Technical information
- TDR Targets ID: 816591
- Name: N-[(5Z)-4-oxo-5-(pyridin-3-ylmethylidene)-1,3 -thiazol-2-yl]benzenesulfonamide
- MW: 345.396 | Formula: C15H11N3O3S2
-
H donors: 1
H acceptors: 4
LogP: 2.33
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: O=C1N=C(SC1=Cc1cccnc1)NS(=O)(=O)c1ccccc1
- InChi: 1S/C15H11N3O3S2/c19-14-13(9-11-5-4-8-16-10-11)22-15(17-14)18-23(20,21)12-6-2-1-3-7-12/h1-10H,(H,17,18,19)/b13-9-
- InChiKey: RSYDPBQSNWRHDG-LCYFTJDESA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[(5Z)-4-oxo-5-(3-pyridylmethylene)thiazol-2-yl]benzenesulfonamide
- N-[(5Z)-4-oxo-5-(3-pyridylmethylene)-2-thiazolyl]benzenesulfonamide
- N-[(5Z)-4-keto-5-(3-pyridylmethylene)thiazol-2-yl]benzenesulfonamide
- STOCK1S-42822
- BAS 01267332
- BIM-0008814.P001
- N-(4-Oxo-5-pyridin-3-ylmethylene-thiazolidin-2-ylidene)-benzenesulfonamide
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0023 | 0.435 | 0.435 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Entamoeba histolytica | deoxycytidyl transferase, putative | 0.0023 | 0.435 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.1078 | 0.1078 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Mycobacterium tuberculosis | Possible DNA-damage-inducible protein P DinP (DNA polymerase V) (pol IV 2) (DNA nucleotidyltransferase (DNA-directed)) | 0.0023 | 0.435 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | DNA polymerase eta | 0.0023 | 0.435 | 0.435 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Schistosoma mansoni | adenoreceptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Echinococcus granulosus | dna polymerase eta | 0.0023 | 0.435 | 0.435 |
| Schistosoma mansoni | biogenic amine receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Brugia malayi | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | DNA polymerase eta, putative | 0.0023 | 0.435 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0031 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0023 | 0.435 | 0.435 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.1078 | 0.1078 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0031 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0023 | 0.435 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | isocitrate dehydrogenase [NADP], mitochondrial precursor, putative | 0.0019 | 0.1078 | 0.2479 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0023 | 0.435 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Plasmodium vivax | isocitrate dehydrogenase [NADP], mitochondrial, putative | 0.0019 | 0.1078 | 1 |
| Schistosoma mansoni | terminal deoxycytidyl transferase | 0.0023 | 0.435 | 0.435 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0023 | 0.435 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0023 | 0.435 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | DNA polymerase IV / kappa, putative | 0.0023 | 0.435 | 0.5 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Brugia malayi | larval opioid receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0031 | 1 | 1 |
| Leishmania major | isocitrate dehydrogenase [NADP], mitochondrial precursor, putative | 0.0019 | 0.1078 | 0.2479 |
| Brugia malayi | ORL1-like opioid receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | isocitrate dehydrogenase | 0.0019 | 0.1078 | 0.1078 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0031 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0031 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Brugia malayi | G protein-coupled receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | dna polymerase kappa | 0.0023 | 0.435 | 0.435 |
| Brugia malayi | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0031 | 1 | 1 |
| Brugia malayi | Isocitrate dehydrogenase | 0.0019 | 0.1078 | 0.1078 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0031 | 1 | 1 |
| Leishmania major | DNA polymerase eta, putative | 0.0023 | 0.435 | 1 |
| Leishmania major | DNA polymerase kappa, putative,DNA polymerase IV, putative | 0.0023 | 0.435 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rab geranylgeranyl transferase alpha subunit | 0.0023 | 0.435 | 0.435 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | terminal deoxycytidyl transferase rev1 | 0.0023 | 0.435 | 0.435 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | isocitrate dehydrogenase, putative | 0.0019 | 0.1078 | 0.2479 |
| Echinococcus multilocularis | isocitrate dehydrogenase 2 (NADP+) | 0.0019 | 0.1078 | 0.1078 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | dna polymerase eta | 0.0023 | 0.435 | 0.435 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.435 | 0.435 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Echinococcus granulosus | g-protein coupled receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.1078 | 0.1078 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0031 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0031 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0031 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Plasmodium falciparum | isocitrate dehydrogenase [NADP], mitochondrial | 0.0019 | 0.1078 | 1 |
| Echinococcus granulosus | terminal deoxycytidyl transferase rev1 | 0.0023 | 0.435 | 0.435 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0023 | 0.435 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.1078 | 0.1078 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase eta, putative | 0.0023 | 0.435 | 1 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0031 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0031 | 1 | 1 |
| Echinococcus granulosus | dna polymerase kappa | 0.0023 | 0.435 | 0.435 |
| Trypanosoma brucei | unspecified product | 0.0023 | 0.435 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | isocitrate dehydrogenase | 0.0019 | 0.1078 | 0.1078 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | isocitrate dehydrogenase | 0.0019 | 0.1078 | 0.1078 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0031 | 1 | 1 |
| Toxoplasma gondii | isocitrate dehydrogenase | 0.0019 | 0.1078 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0031 | 1 | 1 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0023 | 0.435 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0031 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0031 | 1 | 1 |
| Toxoplasma gondii | isocitrate dehydrogenase | 0.0019 | 0.1078 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0031 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0031 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0031 | 1 | 1 |
| Giardia lamblia | DINP protein human, muc B family | 0.0023 | 0.435 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 1 | |
| Schistosoma mansoni | myosin xvIII | 0.0031 | 1 | 1 |
| Leishmania major | DNA polymerase kappa, putative | 0.0023 | 0.435 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | ImpB/MucB/SamB family protein | 0.0023 | 0.435 | 0.435 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0023 | 0.435 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | NADP-specific isocitrate dehydrogenase | 0.0019 | 0.1078 | 0.1078 |
| Brugia malayi | sulfakinin receptor protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.