Detailed information for compound 875215
Basic information
Technical information
- TDR Targets ID: 875215
- Name: 2-[3-(furan-2-ylmethyl)-1-(4-methylphenyl)-2, 5-dioxoimidazolidin-4-yl]-N-(4-propoxyphenyl) acetamide
- MW: 461.51 | Formula: C26H27N3O5
-
H donors: 1
H acceptors: 3
LogP: 3.54
Rotable bonds: 10
Rule of 5 violations (Lipinski): 1 - SMILES: CCCOc1ccc(cc1)NC(=O)CC1C(=O)N(C(=O)N1Cc1ccco1)c1ccc(cc1)C
- InChi: 1S/C26H27N3O5/c1-3-14-33-21-12-8-19(9-13-21)27-24(30)16-23-25(31)29(20-10-6-18(2)7-11-20)26(32)28(23)17-22-5-4-15-34-22/h4-13,15,23H,3,14,16-17H2,1-2H3,(H,27,30)
- InChiKey: ATRKZHDBXAGENS-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-[3-(2-furylmethyl)-1-(4-methylphenyl)-2,5-dioxo-imidazolidin-4-yl]-N-(4-propoxyphenyl)acetamide
- 2-[3-(2-furylmethyl)-1-(4-methylphenyl)-2,5-dioxo-4-imidazolidinyl]-N-(4-propoxyphenyl)acetamide
- 2-[3-(2-furylmethyl)-2,5-diketo-1-(4-methylphenyl)imidazolidin-4-yl]-N-(4-propoxyphenyl)acetamide
- 2-[3-(furan-2-ylmethyl)-1-(4-methylphenyl)-2,5-dioxo-imidazolidin-4-yl]-N-(4-propoxyphenyl)ethanamide
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0202 | 1 | 1 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0202 | 1 | 1 |
| Schistosoma mansoni | glutamate receptor kainate | 0.0109 | 0.3539 | 0.3539 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor subfamily 1 group D | 0.0107 | 0.3377 | 0.3377 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0095 | 0.2583 | 0.2583 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0202 | 1 | 1 |
| Echinococcus granulosus | thyroid hormone receptor alpha | 0.0095 | 0.2583 | 0.2583 |
| Brugia malayi | hypothetical protein | 0.0107 | 0.3377 | 0.1071 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0202 | 1 | 1 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0107 | 0.3377 | 0.1071 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0202 | 1 | 1 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0095 | 0.2583 | 0.2583 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0202 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0202 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor subfamily 1 group D | 0.0107 | 0.3377 | 0.3377 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0202 | 1 | 1 |
| Schistosoma mansoni | nuclear receptor nhr-48 | 0.0095 | 0.2583 | 0.2583 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0202 | 1 | 1 |
| Echinococcus granulosus | glutamate receptor ionotropic kainate | 0.0078 | 0.1399 | 0.1399 |
| Schistosoma mansoni | hepatocyte nuclear factor 4-alpha (hnf-4-alpha) | 0.0095 | 0.2583 | 0.2583 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0202 | 1 | 1 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | Glutamate receptor, ionotropic kainate 2 | 0.0118 | 0.4183 | 0.4183 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | Glutamate receptor, ionotropic kainate 3 | 0.0078 | 0.1399 | 0.1399 |
| Loa Loa (eye worm) | hypothetical protein | 0.0107 | 0.3377 | 0.1071 |
| Schistosoma mansoni | ecdysone-induced protein 78c (dr-78) | 0.0107 | 0.3377 | 0.3377 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0202 | 1 | 1 |
| Brugia malayi | nuclear hormone receptor | 0.0202 | 1 | 1 |
| Schistosoma mansoni | zinc finger protein | 0.0095 | 0.2583 | 0.2583 |
| Echinococcus multilocularis | NMDA receptor | 0.0078 | 0.1399 | 0.1399 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0107 | 0.3377 | 0.3377 |
| Schistosoma mansoni | nuclear receptor | 0.0095 | 0.2583 | 0.2583 |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0095 | 0.2583 | 0.2583 |
| Echinococcus multilocularis | nuclear receptor subfamily 4 group A | 0.0095 | 0.2583 | 0.2583 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0202 | 1 | 1 |
| Onchocerca volvulus | 0.0202 | 1 | 1 | |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0202 | 1 | 1 |
| Echinococcus granulosus | Glutamate receptor ionotropic kainate 2 | 0.0118 | 0.4183 | 0.4183 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0202 | 1 | 1 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0202 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor subfamily 4 group A | 0.0095 | 0.2583 | 0.2583 |
| Loa Loa (eye worm) | hypothetical protein | 0.0202 | 1 | 1 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0095 | 0.2583 | 0.2583 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0202 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor nhr 48 | 0.0095 | 0.2583 | 0.2583 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0202 | 1 | 1 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0107 | 0.3377 | 0.1071 |
| Echinococcus multilocularis | Glutamate receptor, ionotropic kainate 2 | 0.0118 | 0.4183 | 0.4183 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0095 | 0.2583 | 0.2583 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0202 | 1 | 1 |
| Brugia malayi | steroid hormone receptor | 0.0202 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0202 | 1 | 1 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0107 | 0.3377 | 0.1071 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0202 | 1 | 1 |
| Schistosoma mansoni | nuclear receptor | 0.0095 | 0.2583 | 0.2583 |
| Echinococcus multilocularis | nuclear receptor nhr 48 | 0.0095 | 0.2583 | 0.2583 |
| Brugia malayi | hypothetical protein | 0.0107 | 0.3377 | 0.1071 |
| Schistosoma mansoni | glutamate receptor kainate | 0.0109 | 0.3539 | 0.3539 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0107 | 0.3377 | 0.1071 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0107 | 0.3377 | 0.1071 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0202 | 1 | 1 |
| Brugia malayi | nuclear receptor RXR | 0.0107 | 0.3377 | 0.1071 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0202 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0095 | 0.2583 | 0.2583 |
| Echinococcus multilocularis | Glutamate receptor, ionotropic kainate 2 | 0.0118 | 0.4183 | 0.4183 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0095 | 0.2583 | 0.2583 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0202 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor superfamily protein-related | 0.0095 | 0.2583 | 0.2583 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0107 | 0.3377 | 0.1071 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0202 | 1 | 1 |
| Echinococcus granulosus | Glutamate receptor ionotropic kainate 2 | 0.0118 | 0.4183 | 0.4183 |
| Loa Loa (eye worm) | hypothetical protein | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0202 | 1 | 1 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0202 | 1 | 1 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | retinoic acid receptor rxr beta a retinoic acid receptor rxr alpha a retinoic acid receptor rxr alpha | 0.0095 | 0.2583 | 0.2583 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0202 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0202 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0202 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0107 | 0.3377 | 0.1071 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0202 | 1 | 1 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0202 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0202 | 1 | 1 |
| Schistosoma mansoni | coup transcription factor | 0.0202 | 1 | 1 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0202 | 1 | 1 |
| Echinococcus multilocularis | glutamate receptor ionotropic kainate | 0.0078 | 0.1399 | 0.1399 |
| Echinococcus granulosus | glutamate receptor ionotropic kainate 3 | 0.0078 | 0.1399 | 0.1399 |
| Echinococcus granulosus | Glutamate receptor ionotropic kainate 2 | 0.0118 | 0.4183 | 0.4183 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0095 | 0.2583 | 0.2583 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0202 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.