Detailed information for compound 912885
Basic information
Technical information
- TDR Targets ID: 912885
- Name: N-[4-[(4-diethylamino-6-methylpyrimidin-2-yl) amino]phenyl]-3,4-diethoxybenzamide
- MW: 463.572 | Formula: C26H33N5O3
-
H donors: 2
H acceptors: 3
LogP: 5.18
Rotable bonds: 12
Rule of 5 violations (Lipinski): 1 - SMILES: CCOc1cc(ccc1OCC)C(=O)Nc1ccc(cc1)Nc1nc(C)cc(n1)N(CC)CC
- InChi: 1S/C26H33N5O3/c1-6-31(7-2)24-16-18(5)27-26(30-24)29-21-13-11-20(12-14-21)28-25(32)19-10-15-22(33-8-3)23(17-19)34-9-4/h10-17H,6-9H2,1-5H3,(H,28,32)(H,27,29,30)
- InChiKey: GGAAKZXCSBHACI-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[4-[(4-diethylamino-6-methyl-pyrimidin-2-yl)amino]phenyl]-3,4-diethoxy-benzamide
- N-[4-[(4-diethylamino-6-methyl-2-pyrimidinyl)amino]phenyl]-3,4-diethoxybenzamide
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.261 | 0.261 |
| Brugia malayi | Serotonin receptor | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0142 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0142 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0142 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.261 | 0.261 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0142 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0142 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0142 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0036 | 0 | 0.5 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | tar DNA binding protein | 0.0064 | 0.261 | 0.261 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0142 | 1 | 1 |
| Brugia malayi | RNA recognition motif domain containing protein | 0.0064 | 0.261 | 0.261 |
| Schistosoma mansoni | opsin-like receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0142 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0036 | 0 | 0.5 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0142 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Brugia malayi | neuropeptide F receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | TAR-binding protein | 0.0064 | 0.261 | 0.1582 |
| Schistosoma mansoni | opsin-like receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0142 | 1 | 1 |
| Brugia malayi | RNA binding protein | 0.0064 | 0.261 | 0.261 |
| Loa Loa (eye worm) | RNA binding protein | 0.0064 | 0.261 | 0.1582 |
| Schistosoma mansoni | histamine h1 receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0142 | 1 | 1 |
| Brugia malayi | TAR-binding protein | 0.0064 | 0.261 | 0.261 |
| Brugia malayi | Serotonin receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | tar DNA binding protein | 0.0064 | 0.261 | 0.261 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.261 | 0.261 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | RNA recognition domain-containing protein domain-containing protein | 0.0064 | 0.261 | 0.1582 |
| Brugia malayi | G protein-coupled receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0142 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0142 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0142 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0142 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0142 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0142 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0142 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0142 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0142 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0142 | 1 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.261 | 0.261 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0036 | 0 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0142 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0142 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0142 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.261 | 0.261 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus granulosus | hypothetical protein | 0.0142 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0142 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0036 | 0 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0142 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0142 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0142 | 1 | 1 |
| Brugia malayi | Cytochrome P450 family protein | 0.0049 | 0.1221 | 0.1221 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| (functional) | = 3.941 ug/ml | In vitro cytotoxicity evaluation on human fibroblasts measured by fluorescence after 72h | WHO/TDR. | No reference |
| % motility reduction (functional) | = 20 % | Motility reduction assay in Onchocerca lienalis microfilariae | WHO/TDR. | No reference |
| % motility reduction (functional) | = 100 % | Motility reduction assay in Schistosoma mansoni Egyptian sambon adult worms | WHO/TDR. | No reference |
| IC50 (functional) | = 0.427605452 ug/ml | WHO-TDR: Chagas disease | ChEMBL. | No reference |
| IC50 (functional) | = 0.4276054523 ug/ml | In vitro activity against Trypanosoma cruzi in human lung fibroblast measured by colorimetry after 7 days | WHO/TDR. | No reference |
| IC50 (functional) | = 0.51 ug/ml | In vitro activity against Plasmodium falciparum measured by colorimetry after 72h | WHO/TDR. | No reference |
| IC50 (functional) | = 0.51 ug/ml | WHO-TDR: Malaria | ChEMBL. | No reference |
| IC50 | = 3.941 ug/ml | WHO-TDR: Cytotoxicity | ChEMBL. | No reference |
| IC50 (functional) | = 4.3978292118 ug/ml | In vitro activity against Trypanosoma brucei measured by florescence after 24h | WHO/TDR. | No reference |
| IC50 (functional) | = 4.397829212 ug/ml | WHO-TDR: Human African Trypanosomiasis (HAT) | ChEMBL. | No reference |
| IC50 (functional) | = 4.502 ug/ml | In vitro activity against Leishmania infantum in mouse macrophages measured by cell viability after 5 days | WHO/TDR. | No reference |
| IC50 (functional) | = 4.502 ug/ml | WHO-TDR: Leishmaniasis | ChEMBL. | No reference |
| IC50 (functional) | = 8.3 uM | Anti Schistosoma mansoni activity in S. mansoni Egyptian sambon adult worms | WHO/TDR. | No reference |
| IC50 (functional) | = 8.3 uM | WHO-TDR: Schistosomiasis | ChEMBL. | No reference |
| Inhibition (functional) | = 100 % | WHO-TDR: Schistosomiasis | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | ||
| Plasmodium falciparum | |||
| Schistosoma mansoni | ChEMBL23 | ||
| Trypanosoma cruzi | ChEMBL23 | ||
| Leishmania infantum | ChEMBL23 | ||
| Trypanosoma brucei gambiense |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2093436
- Search by WHO/TDR
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.