Detailed information for compound 917685
Basic information
Technical information
- Name: Unnamed compound
- MW: 356.406 | Formula: C17H19F3N2OS
-
H donors: 2
H acceptors: 1
LogP: 5.4
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: CC(C(Nc1cc(cc(c1)C(F)(F)F)NC(=O)c1cccs1)C)C
- InChi: 1S/C17H19F3N2OS/c1-10(2)11(3)21-13-7-12(17(18,19)20)8-14(9-13)22-16(23)15-5-4-6-24-15/h4-11,21H,1-3H3,(H,22,23)
- InChiKey: JJOTYXMTNZIMSZ-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | transient receptor potential cation channel, subfamily A, member 1 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Mycobacterium tuberculosis | Secreted antigen 85-a FbpA (mycolyl transferase 85A) (fibronectin-binding protein A) (antigen 85 complex A) | 0.0035 | 0.0222 | 0.0238 |
| Echinococcus multilocularis | serotonin receptor | 0.0892 | 1 | 1 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0029 | 0.015 | 0.0149 |
| Plasmodium falciparum | glutathione reductase | 0.0046 | 0.0343 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0892 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0892 | 1 | 1 |
| Entamoeba histolytica | phosphofructokinase, putative | 0.0106 | 0.1024 | 1 |
| Schistosoma mansoni | transient receptor potential cation channel subfamily A member | 0.0192 | 0.201 | 0.2009 |
| Brugia malayi | 6-phosphofructokinase | 0.0106 | 0.1024 | 0.1024 |
| Brugia malayi | chromobox protein homolog 3 | 0.0038 | 0.0252 | 0.0252 |
| Brugia malayi | hypothetical protein | 0.0892 | 1 | 1 |
| Mycobacterium ulcerans | hypothetical protein | 0.0035 | 0.0222 | 0.0238 |
| Onchocerca volvulus | Heterochromatin protein 1 homolog | 0.0041 | 0.0285 | 0.0248 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0892 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0892 | 1 | 1 |
| Mycobacterium ulcerans | hypothetical protein | 0.0035 | 0.0222 | 0.0238 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0106 | 0.1024 | 0.4187 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | chromobox protein 1 | 0.0068 | 0.0591 | 0.059 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0016 | 0.0001 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | thioredoxin glutathione reductase | 0.0046 | 0.0343 | 0.0342 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Entamoeba histolytica | phosphofructokinase, putative | 0.0106 | 0.1024 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0892 | 1 | 1 |
| Brugia malayi | jmjC domain containing protein | 0.0057 | 0.0471 | 0.0471 |
| Loa Loa (eye worm) | heterochromatin protein 1 | 0.0068 | 0.0591 | 0.0555 |
| Onchocerca volvulus | 0.023 | 0.2443 | 0.2414 | |
| Plasmodium vivax | multidomain scavenger receptor, putative | 0.0019 | 0.0038 | 0.1078 |
| Brugia malayi | hypothetical protein | 0.0024 | 0.0099 | 0.0099 |
| Echinococcus granulosus | RUN | 0.0019 | 0.0038 | 0.0037 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Dihydrolipoamide dehydrogenase LpdC (lipoamide reductase (NADH)) (lipoyl dehydrogenase) (dihydrolipoyl dehydrogenase) (diaphoras | 0.0116 | 0.1148 | 0.1233 |
| Echinococcus granulosus | chromobox protein 1 | 0.0068 | 0.0591 | 0.059 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | survival motor neuron protein 1 | 0.023 | 0.2439 | 0.2438 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0892 | 1 | 1 |
| Entamoeba histolytica | Niemann-Pick C1 protein, putative | 0.0096 | 0.091 | 0.8709 |
| Schistosoma mansoni | opsin-like receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0892 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.004 | 0.0271 | 0.027 |
| Brugia malayi | neuropeptide F receptor | 0.0892 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0892 | 1 | 1 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Schistosoma mansoni | 6-phosphofructokinase | 0.0106 | 0.1024 | 0.1023 |
| Mycobacterium tuberculosis | Probable conserved exported protein | 0.0035 | 0.0222 | 0.0238 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0892 | 1 | 1 |
| Brugia malayi | Heterochromatin protein 1 | 0.0068 | 0.0591 | 0.0591 |
| Echinococcus granulosus | g protein coupled receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0892 | 1 | 1 |
| Plasmodium falciparum | thioredoxin reductase | 0.0046 | 0.0343 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0892 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0892 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | NADPH-dependent mycothiol reductase Mtr | 0.0046 | 0.0343 | 0.0368 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0892 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | CMGC/MAPK/ERK1 protein kinase | 0.0049 | 0.0384 | 0.0347 |
| Onchocerca volvulus | 0.004 | 0.0277 | 0.0239 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Giardia lamblia | Kinase, CMGC MAPK | 0.0049 | 0.0384 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | Polycystic kidney disease protein | 0.0019 | 0.0038 | 0.0037 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0892 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0892 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Trypanosoma brucei | mitogen activated protein kinase 4, putative | 0.0049 | 0.0384 | 0.3745 |
| Schistosoma mansoni | hypothetical protein | 0.004 | 0.0271 | 0.027 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Echinococcus multilocularis | arachidonate 5 lipoxygenase | 0.0054 | 0.0431 | 0.043 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0892 | 1 | 1 |
| Mycobacterium leprae | PROBABLE 6-PHOSPHOFRUCTOKINASE PFKA (PHOSPHOHEXOKINASE) (PHOSPHOFRUCTOKINASE) | 0.0106 | 0.1024 | 0.0883 |
| Toxoplasma gondii | thioredoxin reductase | 0.0046 | 0.0343 | 0.697 |
| Echinococcus multilocularis | lipoxygenase domain containing protein | 0.0019 | 0.0038 | 0.0037 |
| Echinococcus granulosus | lysine specific demethylase 5A | 0.0057 | 0.0471 | 0.047 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Brugia malayi | phosphofructokinase | 0.0106 | 0.1024 | 0.1024 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Loa Loa (eye worm) | abnormal chemotaxis protein 14 | 0.0041 | 0.0288 | 0.0251 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0892 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Probable NADH dehydrogenase Ndh | 0.0105 | 0.1014 | 0.109 |
| Trypanosoma cruzi | mitogen activated protein kinase 2, putative | 0.0049 | 0.0384 | 0.3745 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0892 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.004 | 0.0271 | 0.027 |
| Leishmania major | mitogen activated protein kinase 4, putative;with=GeneDB:LmxM19.1440 | 0.0049 | 0.0384 | 0.3745 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0892 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-A FbpA | 0.0035 | 0.0222 | 0.0238 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0892 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.023 | 0.2439 | 0.2439 |
| Brugia malayi | hypothetical protein | 0.0892 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | ankyrin repeat protein | 0.0192 | 0.201 | 0.2009 |
| Leishmania major | hypothetical protein, conserved | 0.0024 | 0.0099 | 0.0956 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0041 | 0.0288 | 0.1173 |
| Brugia malayi | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0892 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | Niemann Pick C1 protein | 0.0096 | 0.091 | 0.0909 |
| Echinococcus multilocularis | protein dispatched 1 | 0.0047 | 0.0354 | 0.0353 |
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0831 | 0.9299 | 1 |
| Echinococcus multilocularis | ankyrin repeat protein | 0.0192 | 0.201 | 0.2009 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0892 | 1 | 1 |
| Giardia lamblia | Pyrophosphate-fructose 6-phosphate 1-phosphotransferase alpha subunit | 0.0029 | 0.0145 | 0.3755 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0368 | 0.0331 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | Niemann Pick C1 protein | 0.0137 | 0.1378 | 0.1377 |
| Brugia malayi | hypothetical protein | 0.0118 | 0.1168 | 0.1168 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0892 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0892 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Brugia malayi | dihydrolipoyl dehydrogenase, mitochondrial precursor, putative | 0.0016 | 0.0001 | 0.0001 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | Transcription factor, JmjC domain containing protein | 0.0057 | 0.0471 | 0.047 |
| Brugia malayi | neuropeptide F receptor | 0.0892 | 1 | 1 |
| Mycobacterium leprae | PROBABLE NADH DEHYDROGENASE NDH | 0.0105 | 0.1014 | 0.0873 |
| Brugia malayi | Doublecortin family protein | 0.0019 | 0.0038 | 0.0038 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0024 | 0.0099 | 0.0956 |
| Brugia malayi | Melatonin receptor type 1A | 0.0892 | 1 | 1 |
| Trypanosoma cruzi | ATP-dependent 6-phosphofructokinase, glycosomal | 0.0106 | 0.1024 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0892 | 1 | 1 |
| Leishmania major | trypanothione reductase | 0.0046 | 0.0343 | 0.3347 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0038 | 0.0252 | 0.1028 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Probable reductase | 0.0105 | 0.1014 | 0.109 |
| Plasmodium falciparum | ATP-dependent 6-phosphofructokinase | 0.0029 | 0.0145 | 0.4201 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0106 | 0.1024 | 0.4187 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Onchocerca volvulus | 0.003 | 0.0159 | 0.0121 | |
| Mycobacterium ulcerans | secreted Mpt51/Mpb51 antigen protein FbpD | 0.0035 | 0.0222 | 0.0238 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0892 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Putative ferredoxin reductase | 0.0105 | 0.1014 | 0.109 |
| Schistosoma mansoni | histamine h1 receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Plasmodium falciparum | ATP-dependent 6-phosphofructokinase | 0.0029 | 0.0145 | 0.4201 |
| Echinococcus multilocularis | transient receptor potential cation channel | 0.0196 | 0.2054 | 0.2053 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0288 | 0.0251 |
| Schistosoma mansoni | chromobox protein | 0.0068 | 0.0591 | 0.059 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0892 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | phosphofructokinase | 0.0106 | 0.1024 | 0.0989 |
| Echinococcus granulosus | sterol regulatory element binding protein | 0.0041 | 0.0288 | 0.0287 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0029 | 0.0145 | 0.0589 |
| Onchocerca volvulus | 0.0047 | 0.0354 | 0.0317 | |
| Echinococcus multilocularis | protein patched | 0.0041 | 0.0288 | 0.0287 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-B FbpB | 0.0035 | 0.0222 | 0.0238 |
| Brugia malayi | Iron-sulfur cluster assembly accessory protein | 0.0047 | 0.0354 | 0.0354 |
| Trypanosoma brucei | ATP-dependent 6-phosphofructokinase, glycosomal | 0.0106 | 0.1024 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.015 | 0.0113 |
| Trichomonas vaginalis | set domain proteins, putative | 0.023 | 0.2443 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Possible conserved membrane protein | 0.0035 | 0.0222 | 0.0238 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0892 | 1 | 1 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Echinococcus multilocularis | Polycystic kidney disease protein | 0.0019 | 0.0038 | 0.0037 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0892 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0892 | 1 | 1 |
| Brugia malayi | Thioredoxin reductase | 0.0046 | 0.0343 | 0.0343 |
| Echinococcus granulosus | g protein coupled receptor | 0.0892 | 1 | 1 |
| Brugia malayi | MAP kinase sur-1 | 0.0049 | 0.0384 | 0.0384 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Trichomonas vaginalis | CMGC family protein kinase | 0.0049 | 0.0384 | 0.1568 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0024 | 0.0099 | 0.0956 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0892 | 1 | 1 |
| Brugia malayi | CHE-14 protein | 0.0041 | 0.0288 | 0.0288 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0106 | 0.1024 | 0.4187 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Brugia malayi | sulfakinin receptor protein | 0.0892 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0892 | 1 | 1 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0029 | 0.0145 | 0.0589 |
| Plasmodium vivax | SET domain protein, putative | 0.0029 | 0.015 | 0.4358 |
| Schistosoma mansoni | histone-lysine n-methyltransferase suv9 | 0.004 | 0.0277 | 0.0275 |
| Brugia malayi | G-protein coupled receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Trichomonas vaginalis | CMGC family protein kinase | 0.0049 | 0.0384 | 0.1568 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0892 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0892 | 1 | 1 |
| Trypanosoma cruzi | mitogen activated protein kinase 4, putative | 0.0049 | 0.0384 | 0.3745 |
| Toxoplasma gondii | phosphofructokinase PFKII | 0.0029 | 0.0145 | 0.2928 |
| Echinococcus multilocularis | tumor protein p63 | 0.0328 | 0.3562 | 0.3561 |
| Trichomonas vaginalis | CMGC family protein kinase | 0.0049 | 0.0384 | 0.1568 |
| Brugia malayi | jmjC domain containing protein | 0.0057 | 0.0471 | 0.0471 |
| Mycobacterium tuberculosis | Probable aldehyde dehydrogenase | 0.0059 | 0.0492 | 0.0528 |
| Entamoeba histolytica | endo-1,4-beta-xylanase, putative | 0.0035 | 0.0222 | 0.0881 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0892 | 1 | 1 |
| Plasmodium falciparum | LCCL domain-containing protein | 0.0019 | 0.0038 | 0.1078 |
| Echinococcus granulosus | tumor protein p63 | 0.0328 | 0.3562 | 0.3561 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0892 | 1 | 1 |
| Chlamydia trachomatis | fructose-6-phosphate phosphotransferase | 0.0029 | 0.0145 | 1 |
| Echinococcus multilocularis | RUN | 0.0019 | 0.0038 | 0.0037 |
| Loa Loa (eye worm) | hypothetical protein | 0.0308 | 0.3333 | 0.3308 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | atpase aaa+ type core atpase aaa type core | 0.0787 | 0.8801 | 0.8801 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0892 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0019 | 0.0038 | 0.0038 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | histone lysine N methyltransferase SETMAR | 0.0029 | 0.015 | 0.0149 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0106 | 0.1024 | 0.4187 |
| Leishmania major | ATP-dependent phosphofructokinase | 0.0106 | 0.1024 | 1 |
| Trypanosoma cruzi | mitogen-activated protein kinase 11, putative | 0.0049 | 0.0384 | 0.3745 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.0159 | 0.0121 |
| Brugia malayi | Pre-SET motif family protein | 0.0029 | 0.015 | 0.015 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase 3 | 0.0049 | 0.0384 | 0.0383 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0892 | 1 | 1 |
| Schistosoma mansoni | survival motor neuron protein | 0.0047 | 0.0354 | 0.0353 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0892 | 1 | 1 |
| Plasmodium vivax | glutathione reductase, putative | 0.0046 | 0.0343 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0892 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0038 | 0.0037 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0892 | 1 | 1 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0029 | 0.0145 | 0.0589 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | 6-phosphofructokinase | 0.0106 | 0.1024 | 0.0989 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Toxoplasma gondii | 6-phosphofructokinase | 0.0029 | 0.0145 | 0.2928 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0041 | 0.0285 | 0.1163 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Toxoplasma gondii | phosphofructokinase domain-containing protein | 0.0029 | 0.0145 | 0.2928 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0105 | 0.1014 | 0.109 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0892 | 1 | 1 |
| Schistosoma mansoni | loxhd1 | 0.0019 | 0.0038 | 0.0037 |
| Mycobacterium tuberculosis | Probable 6-phosphofructokinase PfkA (phosphohexokinase) (phosphofructokinase) | 0.0106 | 0.1024 | 0.11 |
| Echinococcus multilocularis | sex peptide receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | thioredoxin glutathione reductase | 0.0046 | 0.0343 | 0.0342 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Onchocerca volvulus | Heterochromatin protein 1 homolog | 0.0038 | 0.0252 | 0.0215 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0068 | 0.0591 | 0.2417 |
| Leishmania major | mitogen activated protein kinase, putative,map kinase, putative | 0.0049 | 0.0384 | 0.3745 |
| Brugia malayi | ORL1-like opioid receptor | 0.0892 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0831 | 0.9299 | 1 |
| Schistosoma mansoni | niemann-pick C1 (NPC1) | 0.0097 | 0.0927 | 0.0926 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | chromobox protein 1 | 0.0068 | 0.0591 | 0.059 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0892 | 1 | 1 |
| Mycobacterium ulcerans | hypothetical protein | 0.0035 | 0.0222 | 0.0238 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | S formylglutathione hydrolase | 0.0035 | 0.0222 | 0.0221 |
| Echinococcus granulosus | mitogen activated protein kinase 3 | 0.0049 | 0.0384 | 0.0383 |
| Echinococcus multilocularis | aldehyde dehydrogenase, mitochondrial | 0.0059 | 0.0492 | 0.0491 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0029 | 0.0145 | 0.0589 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | glutathione reductase | 0.0046 | 0.0343 | 0.0307 |
| Brugia malayi | Serotonin receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Entamoeba histolytica | phosphofructokinase, putative | 0.0106 | 0.1024 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0252 | 0.0215 |
| Echinococcus multilocularis | serotonin receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | 5'partial|histone lysine N methyltransferase SETDB2 | 0.0028 | 0.0138 | 0.0137 |
| Echinococcus multilocularis | histone lysine methyltransferase setb histone lysine methyltransferase eggless | 0.0029 | 0.015 | 0.0149 |
| Schistosoma mansoni | lipoxygenase | 0.0019 | 0.0038 | 0.0037 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | sterol regulatory element binding protein | 0.0041 | 0.0288 | 0.0287 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0892 | 1 | 1 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0046 | 0.0343 | 0.3347 |
| Schistosoma mansoni | amine GPCR | 0.0892 | 1 | 1 |
| Brugia malayi | Pre-SET motif family protein | 0.0202 | 0.2125 | 0.2125 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0892 | 1 | 1 |
| Treponema pallidum | diphosphate--fructose-6-phosphate 1-phosphotransferase | 0.0106 | 0.1024 | 1 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0068 | 0.0591 | 0.2417 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0892 | 1 | 1 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0019 | 0.0038 | 0.0038 |
| Schistosoma mansoni | lipoxygenase | 0.0054 | 0.0431 | 0.043 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0892 | 1 | 1 |
| Brugia malayi | Niemann-Pick C1 protein precursor | 0.0096 | 0.091 | 0.091 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0892 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.005 | 0.0393 | 0.0356 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0892 | 1 | 1 |
| Plasmodium vivax | 6-phosphofructokinase, putative | 0.0029 | 0.0145 | 0.4201 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0059 | 0.0492 | 0.0491 |
| Schistosoma mansoni | hypothetical protein | 0.0892 | 1 | 1 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0892 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0892 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0892 | 1 | 1 |
| Schistosoma mansoni | cellular tumor antigen P53 | 0.0048 | 0.0368 | 0.0366 |
| Brugia malayi | larval opioid receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | expressed conserved protein | 0.009 | 0.0844 | 0.0843 |
| Schistosoma mansoni | rab6-interacting | 0.0019 | 0.0038 | 0.0037 |
| Echinococcus granulosus | Protein patched homolog 1 | 0.0041 | 0.0288 | 0.0287 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0892 | 1 | 1 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0057 | 0.0471 | 0.047 |
| Brugia malayi | 6-phosphofructokinase | 0.0106 | 0.1024 | 0.1024 |
| Echinococcus granulosus | allatostatin A receptor | 0.0892 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | arachidonate 5 lipoxygenase | 0.0054 | 0.0431 | 0.043 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0892 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0027 | 0.0126 | 0.0511 |
| Schistosoma mansoni | hypothetical protein | 0.0047 | 0.0354 | 0.0353 |
| Plasmodium vivax | thioredoxin reductase, putative | 0.0046 | 0.0343 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | Niemann Pick C1 protein | 0.0137 | 0.1378 | 0.1377 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0892 | 1 | 1 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0059 | 0.0492 | 0.0491 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | lipoxygenase domain containing protein | 0.0019 | 0.0038 | 0.0037 |
| Schistosoma mansoni | neuropeptide receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0099 | 0.0061 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0892 | 1 | 1 |
| Mycobacterium leprae | DIHYDROLIPOAMIDE DEHYDROGENASE LPD (LIPOAMIDE REDUCTASE (NADH)) (LIPOYL DEHYDROGENASE) (DIHYDROLIPOYL DEHYDROGENASE) (DIAPHORASE | 0.0116 | 0.1148 | 0.1019 |
| Trichomonas vaginalis | CMGC family protein kinase | 0.0049 | 0.0384 | 0.1568 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0892 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | NAD(P)H quinone reductase LpdA | 0.0116 | 0.1148 | 0.1233 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Trypanosoma cruzi | mitogen-activated protein kinase 11, putative | 0.0049 | 0.0384 | 0.3745 |
| Trypanosoma brucei | trypanothione reductase | 0.0046 | 0.0343 | 0.3347 |
| Echinococcus granulosus | Transcription factor JmjC domain containing protein | 0.0057 | 0.0471 | 0.047 |
| Schistosoma mansoni | biogenic amine receptor | 0.0892 | 1 | 1 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.0024 | 0.0099 | 0.2855 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0059 | 0.0492 | 0.0528 |
| Schistosoma mansoni | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | transient receptor potential cation channel | 0.0196 | 0.2054 | 0.2053 |
| Echinococcus granulosus | lipoxygenase domain containing protein | 0.0019 | 0.0038 | 0.0037 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0892 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0892 | 1 | 1 |
| Schistosoma mansoni | 6-phosphofructokinase | 0.0106 | 0.1024 | 0.1023 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0892 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0892 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0027 | 0.0126 | 0.0511 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0892 | 1 | 1 |
| Plasmodium vivax | 6-phosphofructokinase, putative | 0.0029 | 0.0145 | 0.4201 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Probable membrane NADH dehydrogenase NdhA | 0.0105 | 0.1014 | 0.109 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Secreted antigen 85-B FbpB (85B) (antigen 85 complex B) (mycolyl transferase 85B) (fibronectin-binding protein B) (extracellular | 0.0035 | 0.0222 | 0.0238 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0892 | 1 | 1 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0024 | 0.0099 | 0.2855 |
| Loa Loa (eye worm) | thioredoxin reductase | 0.0046 | 0.0343 | 0.0307 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0892 | 1 | 1 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0059 | 0.0492 | 0.0528 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0892 | 1 | 1 |
| Toxoplasma gondii | CMGC kinase, MAPK family (ERK) MAPK-1 | 0.0049 | 0.0384 | 0.7797 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0892 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0892 | 1 | 1 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0892 | 1 | 1 |
| Schistosoma mansoni | polycystin 1-related | 0.0019 | 0.0038 | 0.0037 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.023 | 0.2439 | 0.241 |
| Mycobacterium tuberculosis | Secreted MPT51/MPB51 antigen protein FbpD (MPT51/MPB51 antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-bind | 0.0035 | 0.0222 | 0.0238 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0892 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0049 | 0.0384 | 0.0383 |
| Onchocerca volvulus | 0.0048 | 0.0368 | 0.0331 | |
| Schistosoma mansoni | rab6-interacting | 0.0019 | 0.0038 | 0.0037 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0892 | 1 | 1 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0024 | 0.0099 | 0.2855 |
| Echinococcus multilocularis | 6 phosphofructokinase | 0.0106 | 0.1024 | 0.1023 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0892 | 1 | 1 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0059 | 0.0492 | 0.0528 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0029 | 0.015 | 0.0149 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0038 | 0.0252 | 0.1028 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | esterase D | 0.0035 | 0.0222 | 0.0185 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0029 | 0.015 | 0.0149 |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0831 | 0.9299 | 1 |
| Loa Loa (eye worm) | pre-SET domain-containing protein family protein | 0.0202 | 0.2125 | 0.2095 |
| Leishmania major | aldehyde dehydrogenase, mitochondrial precursor | 0.0059 | 0.0492 | 0.4803 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0892 | 1 | 1 |
| Brugia malayi | glutathione reductase | 0.0046 | 0.0343 | 0.0343 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0057 | 0.0471 | 0.047 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | lysine specific demethylase 5A | 0.0057 | 0.0471 | 0.047 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0892 | 1 | 1 |
| Mycobacterium ulcerans | hypothetical protein | 0.0035 | 0.0222 | 0.0238 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0892 | 1 | 1 |
| Onchocerca volvulus | 0.0892 | 1 | 1 | |
| Echinococcus granulosus | 6 phosphofructokinase | 0.0106 | 0.1024 | 0.1023 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | survival motor neuron protein 1 | 0.023 | 0.2439 | 0.2438 |
| Echinococcus granulosus | mitogen activated protein kinase | 0.0049 | 0.0384 | 0.0383 |
| Echinococcus multilocularis | lipoxygenase domain containing protein | 0.0019 | 0.0038 | 0.0037 |
| Mycobacterium tuberculosis | Probable nitrite reductase [NAD(P)H] large subunit [FAD flavoprotein] NirB | 0.0105 | 0.1014 | 0.109 |
| Brugia malayi | Dopamine receptor | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0892 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0892 | 1 | 1 |
| Echinococcus granulosus | expressed conserved protein | 0.009 | 0.0844 | 0.0843 |
| Trichomonas vaginalis | chromobox protein, putative | 0.0041 | 0.0285 | 0.1163 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0892 | 1 | 1 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0029 | 0.0145 | 0.0589 |
| Echinococcus granulosus | Niemann Pick C1 protein | 0.0096 | 0.091 | 0.0909 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Conserved hypothetical membrane protein | 0.0035 | 0.0222 | 0.0238 |
| Trypanosoma brucei | protein kinase, putative | 0.0049 | 0.0384 | 0.3745 |
| Schistosoma mansoni | hypothetical protein | 0.004 | 0.0271 | 0.027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Conserved protein | 0.0035 | 0.0222 | 0.0238 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Chlamydia trachomatis | fructose-6-phosphate phosphotransferase | 0.0029 | 0.0145 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0892 | 1 | 1 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.0024 | 0.0099 | 0.0956 |
| Schistosoma mansoni | chromobox protein | 0.0068 | 0.0591 | 0.059 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.0024 | 0.0099 | 0.199 |
| Schistosoma mansoni | patched 1 | 0.0041 | 0.0288 | 0.0287 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0057 | 0.0471 | 0.047 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0057 | 0.0471 | 0.0435 |
| Treponema pallidum | diphosphate--fructose-6-phosphate 1-phosphotransferase | 0.0029 | 0.0145 | 0.1406 |
| Mycobacterium ulcerans | 6-phosphofructokinase | 0.0106 | 0.1024 | 0.11 |
| Toxoplasma gondii | histone lysine methyltransferase SET/SUV39 | 0.0029 | 0.015 | 0.3037 |
| Loa Loa (eye worm) | 6-phosphofructokinase | 0.0106 | 0.1024 | 0.0989 |
| Brugia malayi | Esterase D | 0.0035 | 0.0222 | 0.0222 |
| Toxoplasma gondii | aldehyde dehydrogenase | 0.0059 | 0.0492 | 1 |
| Trichomonas vaginalis | 6-phosphofructokinase, putative | 0.0029 | 0.0145 | 0.0589 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | chromobox protein 1 | 0.0068 | 0.0591 | 0.059 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0016 | 0.0001 | 0.5 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0892 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus granulosus | aldehyde dehydrogenase mitochondrial | 0.0059 | 0.0492 | 0.0491 |
| Echinococcus granulosus | histone lysine methyltransferase setb | 0.0029 | 0.015 | 0.0149 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase | 0.0049 | 0.0384 | 0.0383 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0892 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0892 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0116 | 0.1148 | 0.1233 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0029 | 0.0145 | 0.0589 |
| Loa Loa (eye worm) | hypothetical protein | 0.0892 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0892 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0892 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0892 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0892 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0096 | 0.091 | 0.0875 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0892 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0892 | 1 | 1 |
| Echinococcus multilocularis | S formylglutathione hydrolase | 0.0035 | 0.0222 | 0.0221 |
| Brugia malayi | hypothetical protein | 0.0892 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 1.3 uM | Antagonist activity at human TRPA1 expressed in HEK293-TREx cells assessed as change in calcium level by Fluo-4NW assay | ChEMBL. | 24880903 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3311180
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.