Detailed information for compound 919271
Basic information
Technical information
- Name: Unnamed compound
- MW: 308.331 | Formula: C18H16N2O3
-
H donors: 1
H acceptors: 1
LogP: 3.24
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc2c(c1)OC(=C([C@H]2c1cccc(c1)OC)C#N)N
- InChi: 1S/C18H16N2O3/c1-21-12-5-3-4-11(8-12)17-14-7-6-13(22-2)9-16(14)23-18(20)15(17)10-19/h3-9,17H,20H2,1-2H3/t17-/m0/s1
- InChiKey: WKLKYONGSSJYLW-KRWDZBQOSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus multilocularis | orexin receptor type 2 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Mycobacterium leprae | SECRETED ANTIGEN 85-C FBPC (85C) (ANTIGEN 85 COMPLEX C) (AG58C) (MYCOLYL TRANSFERASE 85C) (FIBRONECTIN-BINDING PROTEIN C) | 0.0891 | 0.516 | 0.5 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.1366 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | GnHR receptor homolog | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.1366 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.1366 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | putative neuropeptide receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.1366 | 1 | 1 |
| Leishmania major | C-8 sterol isomerase-like protein | 0.0384 | 0 | 0.5 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Mycobacterium ulcerans | secreted antigen 85-C FbpC | 0.0891 | 0.516 | 0.5 |
| Trypanosoma brucei | C-8 sterol isomerase, putative | 0.0384 | 0 | 0.5 |
| Echinococcus granulosus | g-protein coupled receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Brugia malayi | sulfakinin receptor protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | norepinephrine transporter | 0.0478 | 0.0958 | 0.0958 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1366 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Mycobacterium tuberculosis | Secreted antigen 85-C FbpC (85C) (antigen 85 complex C) (AG58C) (mycolyl transferase 85C) (fibronectin-binding protein C) | 0.0891 | 0.516 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.1366 | 1 | 1 |
| Brugia malayi | Sodium:neurotransmitter symporter family protein | 0.0478 | 0.0958 | 0.0958 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1366 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | solute carrier family 6 member 4 | 0.0478 | 0.0958 | 0.0958 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Trypanosoma cruzi | C-8 sterol isomerase, putative | 0.0384 | 0 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | opsin-like receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.1366 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.1366 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0478 | 0.0958 | 0.0958 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | serotonin transporter b | 0.0478 | 0.0958 | 0.0958 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Treponema pallidum | sodium- and chloride- dependent transporter | 0.0478 | 0.0958 | 0.5 |
| Brugia malayi | follicle stimulating hormone receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.1366 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0478 | 0.0958 | 0.0958 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.1366 | 1 | 1 |
| Brugia malayi | RE15519p | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.1366 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0478 | 0.0958 | 0.0958 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.1366 | 1 | 1 |
| Onchocerca volvulus | 0.1366 | 1 | 1 | |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.1366 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.1366 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.1366 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.1366 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.1366 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.1366 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.1366 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.1366 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.1366 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3315190
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.