Detailed information for compound 924852
Basic information
Technical information
- Name: Unnamed compound
- MW: 304.424 | Formula: C19H28O3
-
H donors: 0
H acceptors: 1
LogP: 6.26
Rotable bonds: 11
Rule of 5 violations (Lipinski): 1 - SMILES: CCCCCCCC=Cc1cccc(c1C(=O)OCC)OC
- InChi: 1S/C19H28O3/c1-4-6-7-8-9-10-11-13-16-14-12-15-17(21-3)18(16)19(20)22-5-2/h11-15H,4-10H2,1-3H3
- InChiKey: XCCGGEPEBJAUBK-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | opsin-like receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0142 | 1 | 1 |
| Brugia malayi | FAD binding domain containing protein | 0.0075 | 0.358 | 0.3006 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0142 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | NADPH dependent diflavin oxidoreductase 1 | 0.0075 | 0.358 | 0.3006 |
| Trypanosoma cruzi | cytochrome P450 reductase, putative | 0.0075 | 0.358 | 0.5 |
| Brugia malayi | AKH receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0142 | 1 | 1 |
| Trypanosoma brucei | NADPH-cytochrome p450 reductase, putative | 0.0075 | 0.358 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0142 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0142 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | cytochrome P450 reductase | 0.0075 | 0.358 | 0.358 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0067 | 0.276 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Trichomonas vaginalis | sulfite reductase, putative | 0.0075 | 0.358 | 1 |
| Loa Loa (eye worm) | FAD binding domain-containing protein | 0.0075 | 0.358 | 0.3006 |
| Echinococcus granulosus | serotonin receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0142 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Chlamydia trachomatis | sulfite reductase | 0.0046 | 0.082 | 0.5 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0142 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Giardia lamblia | Nitric oxide synthase, inducible | 0.0067 | 0.276 | 0.5 |
| Schistosoma mansoni | histamine h1 receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0142 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0142 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0142 | 1 | 1 |
| Trypanosoma brucei | NADPH-dependent diflavin oxidoreductase 1 | 0.0075 | 0.358 | 0.5 |
| Mycobacterium ulcerans | formate dehydrogenase H FdhF | 0.0075 | 0.358 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0142 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Trypanosoma brucei | NADPH--cytochrome P450 reductase, putative | 0.0075 | 0.358 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0142 | 1 | 1 |
| Leishmania major | NADPH-cytochrome p450 reductase-like protein | 0.0075 | 0.358 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0142 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0142 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0142 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0142 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0142 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0142 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450 reductase, putative | 0.0075 | 0.358 | 0.5 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus multilocularis | serotonin receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | NADPH cytochrome P450 reductase | 0.0075 | 0.358 | 0.3006 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Plasmodium falciparum | nitric oxide synthase, putative | 0.0075 | 0.358 | 0.5 |
| Echinococcus multilocularis | NADPH dependent diflavin oxidoreductase 1 | 0.0075 | 0.358 | 0.3006 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0142 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0142 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0142 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0142 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0142 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0142 | 1 | 0.5 |
| Leishmania major | p450 reductase, putative | 0.0075 | 0.358 | 1 |
| Trypanosoma cruzi | p450 reductase, putative | 0.0075 | 0.358 | 0.5 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Trypanosoma brucei | NADPH--cytochrome P450 reductase, putative | 0.0075 | 0.358 | 0.5 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | flavodoxin family protein | 0.0075 | 0.358 | 0.3006 |
| Schistosoma mansoni | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | 5-methyl tetrahydrofolate-homocysteine methyltransferase reductase | 0.0046 | 0.082 | 0.082 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0142 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Schistosoma mansoni | opsin-like receptor | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0142 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0075 | 0.358 | 0.3006 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Echinococcus multilocularis | NADPH cytochrome P450 reductase | 0.0075 | 0.358 | 0.3006 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0142 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0142 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0142 | 1 | 1 |
| Onchocerca volvulus | 0.0142 | 1 | 0.5 | |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0142 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0142 | 1 | 1 |
| Trypanosoma cruzi | NADPH-dependent FMN/FAD containing oxidoreductase, putative | 0.0075 | 0.358 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0142 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Plasmodium vivax | NADPH-cytochrome p450 reductase, putative | 0.0075 | 0.358 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0142 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0142 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0142 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0142 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0142 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0142 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0142 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | > 300 uM | Inhibition of Trypanosoma cruzi recombinant glycosomal GAPDH expressed in Escherichia coli using GAPDH and D-glyceraldehyde-3-phosphate | ChEMBL. | 18789702 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1784976
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.