Detailed information for compound 944484
Basic information
Technical information
- Name: Unnamed compound
- MW: 305.202 | Formula: C16H14Cl2N2
-
H donors: 1
H acceptors: 1
LogP: 5.35
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: Clc1cc2[nH]c(nc2cc1Cl)CCCc1ccccc1
- InChi: 1S/C16H14Cl2N2/c17-12-9-14-15(10-13(12)18)20-16(19-14)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2,(H,19,20)
- InChiKey: ICLDRFCGTXBUSE-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Plasmodium falciparum | glutathione reductase | 0.0038 | 0.303 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0109 | 1 | 1 |
| Mycobacterium ulcerans | flavoprotein disulfide reductase | 0.0013 | 0.0596 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0109 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0109 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0109 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Brugia malayi | alpha keto acid dehydrogenase complex, E3 component, lipoamide dehydrogenase | 0.001 | 0.0253 | 0.0253 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Echinococcus granulosus | g protein coupled receptor | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Trypanosoma brucei | trypanothione reductase | 0.0038 | 0.303 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0109 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Loa Loa (eye worm) | thioredoxin reductase | 0.0038 | 0.303 | 0.303 |
| Mycobacterium tuberculosis | NADPH-dependent mycothiol reductase Mtr | 0.0038 | 0.303 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | dihydrolipoamide dehydrogenase | 0.0013 | 0.0596 | 0.0596 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0109 | 1 | 1 |
| Leishmania major | trypanothione reductase | 0.0038 | 0.303 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, mitochondrial, putative | 0.0013 | 0.0596 | 0.1966 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0109 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0109 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0109 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | dihydrolipoyl dehydrogenase, mitochondrial precursor, putative | 0.0013 | 0.0596 | 0.0596 |
| Echinococcus granulosus | somatostatin receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Toxoplasma gondii | thioredoxin reductase | 0.0038 | 0.303 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0109 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Mycobacterium leprae | DIHYDROLIPOAMIDE DEHYDROGENASE LPD (LIPOAMIDE REDUCTASE (NADH)) (LIPOYL DEHYDROGENASE) (DIHYDROLIPOYL DEHYDROGENASE) (DIAPHORASE | 0.0013 | 0.0596 | 0.5 |
| Schistosoma mansoni | adenoreceptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0109 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0109 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0109 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0109 | 1 | 1 |
| Treponema pallidum | NADH oxidase | 0.0013 | 0.0596 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0109 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0109 | 1 | 1 |
| Brugia malayi | GCC2 and GCC3 family protein | 0.0011 | 0.0376 | 0.0376 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, apicoplast | 0.0013 | 0.0596 | 0.1966 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0109 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0109 | 1 | 1 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, apicoplast, putative | 0.0013 | 0.0596 | 0.1966 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | thioredoxin glutathione reductase | 0.0038 | 0.303 | 0.303 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Plasmodium falciparum | thioredoxin reductase | 0.0038 | 0.303 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0109 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0011 | 0.0376 | 0.0376 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0109 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0078 | 0.0078 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | dihydrolipoamide dehydrogenase | 0.0013 | 0.0596 | 0.0596 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0013 | 0.0596 | 0.5 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | roundabout 2 | 0.0009 | 0.0174 | 0.0174 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0109 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Toxoplasma gondii | pyruvate dehydrogenase complex subunit PDH-E3II | 0.0013 | 0.0596 | 0.1966 |
| Echinococcus multilocularis | sex peptide receptor | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0109 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0109 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0109 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0109 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0109 | 1 | 1 |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase, LpdB | 0.0013 | 0.0596 | 0.5 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0109 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0109 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0109 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0109 | 1 | 1 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0038 | 0.303 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0109 | 1 | 1 |
| Plasmodium falciparum | thioredoxin reductase | 0.0013 | 0.0596 | 0.1966 |
| Schistosoma mansoni | neuropeptide receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase | 0.0013 | 0.0596 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Echinococcus multilocularis | somatostatin receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0109 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0109 | 1 | 1 |
| Trichomonas vaginalis | glutathione reductase, putative | 0.0013 | 0.0596 | 0.5 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0109 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0013 | 0.0596 | 0.5 |
| Plasmodium vivax | thioredoxin reductase, putative | 0.0038 | 0.303 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0109 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0109 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0109 | 1 | 1 |
| Trichomonas vaginalis | mercuric reductase, putative | 0.0013 | 0.0596 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0109 | 1 | 1 |
| Giardia lamblia | NADH oxidase lateral transfer candidate | 0.0013 | 0.0596 | 0.5 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0109 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | dihydrolipoamide dehydrogenase | 0.0013 | 0.0596 | 0.0596 |
| Brugia malayi | glutathione reductase | 0.0038 | 0.303 | 0.303 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | TK/KIN16 protein kinase | 0.0007 | 0.0034 | 0.0034 |
| Echinococcus granulosus | sex peptide receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0109 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0009 | 0.0174 | 0.0174 |
| Loa Loa (eye worm) | hypothetical protein | 0.0009 | 0.0174 | 0.0174 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0109 | 1 | 1 |
| Chlamydia trachomatis | dihydrolipoyl dehydrogenase | 0.0013 | 0.0596 | 0.5 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0109 | 1 | 1 |
| Schistosoma mansoni | cell adhesion molecule | 0.0007 | 0.0034 | 0.0034 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0109 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0109 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Brugia malayi | Thioredoxin reductase | 0.0038 | 0.303 | 0.303 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0109 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0007 | 0.0034 | 0.0034 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0109 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | roundabout 2 | 0.0009 | 0.0174 | 0.0174 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0109 | 1 | 1 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, mitochondrial | 0.0013 | 0.0596 | 0.1966 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Echinococcus granulosus | fmrfamide receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0109 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0109 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0109 | 1 | 1 |
| Echinococcus granulosus | thioredoxin glutathione reductase | 0.0038 | 0.303 | 0.303 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0109 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0109 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0109 | 1 | 1 |
| Echinococcus granulosus | neurotracting:lsamp:neurotrimin:obcam | 0.0007 | 0.0034 | 0.0034 |
| Onchocerca volvulus | 0.0109 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0109 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0109 | 1 | 1 |
| Brugia malayi | Pyridine nucleotide-disulphide oxidoreductase, dimerisation domain containing protein | 0.001 | 0.0253 | 0.0253 |
| Echinococcus granulosus | hypothetical protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0109 | 1 | 1 |
| Toxoplasma gondii | NADPH-glutathione reductase | 0.0013 | 0.0596 | 0.1966 |
| Plasmodium falciparum | glutathione reductase | 0.0013 | 0.0596 | 0.1966 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0007 | 0.0034 | 0.0034 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0109 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0109 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0109 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0109 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0109 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0109 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0109 | 1 | 1 |
| Plasmodium vivax | glutathione reductase, putative | 0.0038 | 0.303 | 1 |
| Loa Loa (eye worm) | glutathione reductase | 0.0038 | 0.303 | 0.303 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0109 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| MIC (functional) | = 6.2 ug ml-1 | Antimicrobial activity against Mycobacterium tuberculosis Spec. 192 by two-fold serial dilution method | ChEMBL. | 25462221 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3358774
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.