Detailed information for compound 1189632
Basic information
Technical information
- Name: Unnamed compound
- MW: 416.515 | Formula: C25H28N4O2
-
H donors: 2
H acceptors: 3
LogP: 3.44
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: ONC(=O)/C=C/c1cccc(c1)c1nc(c(n1[C@@H]1CCCN(C1)C)C)c1ccccc1
- InChi: 1S/C25H28N4O2/c1-18-24(20-9-4-3-5-10-20)26-25(29(18)22-12-7-15-28(2)17-22)21-11-6-8-19(16-21)13-14-23(30)27-31/h3-6,8-11,13-14,16,22,31H,7,12,15,17H2,1-2H3,(H,27,30)/b14-13+/t22-/m1/s1
- InChiKey: OMPKMRAERQQDRQ-DGXIYAMASA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | histone deacetylase 6 | Starlite/ChEMBL | References |
| Homo sapiens | histone deacetylase 8 | Starlite/ChEMBL | References |
| Homo sapiens | histone deacetylase 1 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Plasmodium falciparum | histone deacetylase 1 | histone deacetylase 8 | 286 aa | 241 aa | 44.8 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | tar DNA binding protein | 0.0069 | 0.4373 | 0.2995 |
| Toxoplasma gondii | histone deacetylase HDAC2 | 0.0113 | 1 | 1 |
| Plasmodium falciparum | histone deacetylase 1 | 0.0113 | 1 | 1 |
| Schistosoma mansoni | histone deacetylase 1 2 3 | 0.0058 | 0.3081 | 0.1386 |
| Echinococcus multilocularis | histone deacetylase 1 | 0.0113 | 1 | 1 |
| Schistosoma mansoni | histone deacetylase hda2 | 0.01 | 0.8302 | 0.7887 |
| Echinococcus granulosus | histone deacetylase 6 | 0.0092 | 0.7364 | 0.6718 |
| Brugia malayi | histone deacetylase 11 | 0.0058 | 0.3081 | 0.1386 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0113 | 1 | 0.5 |
| Loa Loa (eye worm) | RNA recognition domain-containing protein domain-containing protein | 0.0069 | 0.4373 | 0.4373 |
| Trichomonas vaginalis | histone deacetylase 1, 2 ,3, putative | 0.0113 | 1 | 0.5 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0069 | 0.4373 | 0.2995 |
| Leishmania major | histone deacetylase, putative | 0.0113 | 1 | 1 |
| Toxoplasma gondii | histone deacetylase HDAC3 | 0.0113 | 1 | 1 |
| Trypanosoma cruzi | histone deacetylase 1, putative | 0.0113 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0113 | 1 | 1 |
| Trichomonas vaginalis | histone deacetylase 1, 2 ,3, putative | 0.0113 | 1 | 0.5 |
| Echinococcus granulosus | tar DNA binding protein | 0.0069 | 0.4373 | 0.2995 |
| Brugia malayi | Histone deacetylase family protein | 0.0092 | 0.7364 | 0.6718 |
| Giardia lamblia | Histone deacetylase | 0.0113 | 1 | 0.5 |
| Toxoplasma gondii | histone deacetylase HDAC1 | 0.0092 | 0.7364 | 0.619 |
| Trypanosoma brucei | histone deacetylase, putative | 0.0092 | 0.7364 | 0.619 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0113 | 1 | 0.5 |
| Trypanosoma cruzi | histone deacetylase, putative | 0.0092 | 0.7364 | 0.619 |
| Echinococcus multilocularis | histone deacetylase 8 | 0.0058 | 0.3081 | 0.1386 |
| Plasmodium vivax | histone deacetylase 2, putative | 0.0092 | 0.7364 | 0.619 |
| Schistosoma mansoni | histone deacetylase | 0.0113 | 1 | 1 |
| Echinococcus multilocularis | histone deacetylase 3 | 0.0113 | 1 | 1 |
| Onchocerca volvulus | Histone deacetylase 10 homolog | 0.0058 | 0.3081 | 0.5 |
| Loa Loa (eye worm) | histone deacetylase | 0.0092 | 0.7364 | 0.7364 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0069 | 0.4373 | 0.2995 |
| Trypanosoma cruzi | histone deacetylase, putative | 0.0092 | 0.7364 | 0.619 |
| Echinococcus multilocularis | histone deacetylase 6 | 0.01 | 0.8302 | 0.7887 |
| Echinococcus multilocularis | histone deacetylase 7 | 0.0092 | 0.7364 | 0.6718 |
| Echinococcus granulosus | histone deacetylase 1 | 0.0113 | 1 | 1 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0113 | 1 | 0.5 |
| Schistosoma mansoni | histone deacetylase 4 5 | 0.0092 | 0.7364 | 0.6718 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0069 | 0.4373 | 0.2995 |
| Echinococcus multilocularis | histone deacetylase 6 | 0.0092 | 0.7364 | 0.6718 |
| Echinococcus granulosus | histone deacetylase 8 | 0.0058 | 0.3081 | 0.1386 |
| Schistosoma mansoni | histone deacetylase 4 5 | 0.0092 | 0.7364 | 0.6718 |
| Trypanosoma cruzi | histone deacetylase 1, putative | 0.0113 | 1 | 1 |
| Trypanosoma cruzi | histone deacetylase, putative | 0.0092 | 0.7364 | 0.619 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.005 | 0.1968 | 0.1968 |
| Schistosoma mansoni | histone deacetylase | 0.0113 | 1 | 1 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0069 | 0.4373 | 0.2995 |
| Loa Loa (eye worm) | RNA binding protein | 0.0069 | 0.4373 | 0.4373 |
| Loa Loa (eye worm) | histone deacetylase 11 | 0.0058 | 0.3081 | 0.3081 |
| Echinococcus granulosus | histone deacetylase | 0.0092 | 0.7364 | 0.6718 |
| Entamoeba histolytica | histone deacetylase, putative | 0.0113 | 1 | 0.5 |
| Plasmodium vivax | histone deacetylase, putative | 0.0092 | 0.7364 | 0.619 |
| Trypanosoma brucei | histone deacetylase 4 | 0.0092 | 0.7364 | 0.619 |
| Brugia malayi | Histone deacetylase family protein | 0.0092 | 0.7364 | 0.6718 |
| Leishmania major | histone deacetylase, putative | 0.0113 | 1 | 1 |
| Brugia malayi | RNA recognition motif domain containing protein | 0.0069 | 0.4373 | 0.2995 |
| Plasmodium vivax | histone deacetylase 1, putative | 0.0113 | 1 | 1 |
| Echinococcus multilocularis | histone deacetylase 6 | 0.0092 | 0.7364 | 0.6718 |
| Brugia malayi | Histone deacetylase 1 | 0.0113 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0058 | 0.3081 | 0.3081 |
| Loa Loa (eye worm) | histone deacetylase 3 | 0.0113 | 1 | 1 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0113 | 1 | 0.5 |
| Loa Loa (eye worm) | histone deacetylase 7A | 0.0092 | 0.7364 | 0.7364 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0069 | 0.4373 | 0.2995 |
| Trichomonas vaginalis | histone deacetylase 1, 2 ,3, putative | 0.0113 | 1 | 0.5 |
| Echinococcus granulosus | histone deacetylase 6 | 0.01 | 0.8302 | 0.7887 |
| Echinococcus multilocularis | histone deacetylase | 0.0092 | 0.7364 | 0.6718 |
| Trypanosoma brucei | histone deacetylase 3 | 0.0092 | 0.7364 | 0.619 |
| Schistosoma mansoni | histone deacetylase hda2 | 0.0058 | 0.3081 | 0.1386 |
| Brugia malayi | RNA binding protein | 0.0069 | 0.4373 | 0.2995 |
| Echinococcus granulosus | histone deacetylase 7 | 0.0092 | 0.7364 | 0.6718 |
| Trypanosoma brucei | histone deacetylase 1 | 0.0113 | 1 | 1 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0113 | 1 | 0.5 |
| Loa Loa (eye worm) | TAR-binding protein | 0.0069 | 0.4373 | 0.4373 |
| Brugia malayi | TAR-binding protein | 0.0069 | 0.4373 | 0.2995 |
| Loa Loa (eye worm) | histone deacetylase 1 | 0.0113 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0938 | 0.0938 |
| Echinococcus granulosus | histone deacetylase 3 | 0.0113 | 1 | 1 |
| Echinococcus granulosus | histone deacetylase 6 | 0.0092 | 0.7364 | 0.6718 |
| Brugia malayi | histone deacetylase 1 (HD1) | 0.0113 | 1 | 1 |
| Trichomonas vaginalis | histone deacetylase, putative | 0.0113 | 1 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 0.04 uM | Cytotoxicity against human HL60 cells assessed as NADH level after 72 hrs by MTS cells | ChEMBL. | 20392637 |
| EC50 (functional) | = 0.1 uM | Cytotoxicity against human PC3 cells assessed as NADH level after 72 hrs by MTS cells | ChEMBL. | 20392637 |
| EC50 (functional) | = 0.6 uM | Cytotoxicity against human A549 cells assessed as NADH level after 72 hrs by MTS cells | ChEMBL. | 20392637 |
| IC50 (binding) | = 5 nM | Inhibition of human recombinant HDAC2 | ChEMBL. | 20392637 |
| IC50 (binding) | = 50 nM | Inhibition of human recombinant HDAC8 | ChEMBL. | 20392637 |
| IC50 (binding) | = 63 nM | Inhibition of human recombinant HDAC6 | ChEMBL. | 20392637 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 20392637 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1094648
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.