Detailed information for compound 1466301
Basic information
Technical information
- Name: Unnamed compound
- MW: 479.442 | Formula: C24H32Cl2N4O2
-
H donors: 2
H acceptors: 1
LogP: 4.64
Rotable bonds: 13
Rule of 5 violations (Lipinski): 1 - SMILES: ClCCN(c1ccc(cc1)NC(=O)Nc1cccc(c1)OCCN1CCCCC1)CCCl
- InChi: 1S/C24H32Cl2N4O2/c25-11-15-30(16-12-26)22-9-7-20(8-10-22)27-24(31)28-21-5-4-6-23(19-21)32-18-17-29-13-2-1-3-14-29/h4-10,19H,1-3,11-18H2,(H2,27,28,31)
- InChiKey: JCBFLXAXTUPKQT-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0105 | 0.5 | 0.5 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0105 | 0.5 | 0.5 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.5 | 0.5 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0105 | 0.5 | 0.5 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0105 | 0.5 | 0.5 |
| Onchocerca volvulus | 0.0105 | 0.5 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.5 | 0.5 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0105 | 0.5 | 0.5 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0105 | 0.5 | 0.5 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0105 | 0.5 | 0.5 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0105 | 0.5 | 0.5 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | steroid hormone receptor | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0105 | 0.5 | 0.5 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0105 | 0.5 | 0.5 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0105 | 0.5 | 0.5 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0105 | 0.5 | 0.5 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.5 | 0.5 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0105 | 0.5 | 0.5 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | coup transcription factor | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | nuclear hormone receptor | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0105 | 0.5 | 0.5 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0105 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0105 | 0.5 | 0.5 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0105 | 0.5 | 0.5 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0105 | 0.5 | 0.5 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0105 | 0.5 | 0.5 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0105 | 0.5 | 0.5 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0105 | 0.5 | 0.5 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0105 | 0.5 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 0.19 uM | Cytotoxicity against human CCRF-CEM cells after 72 hrs by XTT assay | ChEMBL. | 21106377 |
| IC50 (functional) | = 0.19 uM | Cytotoxicity against human MX1 cells after 72 hrs by SRB assay | ChEMBL. | 21106377 |
| IC50 (functional) | = 0.27 uM | Cytotoxicity against human HCT116 cells after 72 hrs by SRB assay | ChEMBL. | 21106377 |
| IC50 (functional) | = 0.57 uM | Cytotoxicity against taxol-resistant human CCRF-CEM cells after 72 hrs by XTT assay | ChEMBL. | 21106377 |
| IC50 (functional) | = 0.73 uM | Cytotoxicity against vinblastine-resistant human CCRF-CEM cells after 72 hrs by XTT assay | ChEMBL. | 21106377 |
| IC50 (functional) | = 1.13 uM | Cytotoxicity against human PC3 cells after 72 hrs by alamar blue assay | ChEMBL. | 21106377 |
| IC50 (functional) | = 1.82 uM | Cytotoxicity against human MCF7 cells after 72 hrs by alamar blue assay | ChEMBL. | 21106377 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 21106377 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1643821
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.