Detailed information for compound 1509817
Basic information
Technical information
- TDR Targets ID: 1509817
- Name: N-[2-(cyclopentylamino)-1-(3-methoxyphenyl)-2 -oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop- 2-ynamide
- MW: 444.446 | Formula: C24H23F3N2O3
-
H donors: 1
H acceptors: 2
LogP: 4.93
Rotable bonds: 9
Rule of 5 violations (Lipinski): 1 - SMILES: COc1cccc(c1)C(N(c1cccc(c1)C(F)(F)F)C(=O)C#C)C(=O)NC1CCCC1
- InChi: 1S/C24H23F3N2O3/c1-3-21(30)29(19-12-7-9-17(15-19)24(25,26)27)22(16-8-6-13-20(14-16)32-2)23(31)28-18-10-4-5-11-18/h1,6-9,12-15,18,22H,4-5,10-11H2,2H3,(H,28,31)
- InChiKey: BDUHYUALIVDKAF-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[2-(cyclopentylamino)-1-(3-methoxyphenyl)-2-oxo-ethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide
- N-[2-(cyclopentylamino)-2-keto-1-(3-methoxyphenyl)ethyl]-N-[3-(trifluoromethyl)phenyl]propiolamide
- ASN 06088163
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0041 | 0.5 | 0.5 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.5 | 0.5 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0041 | 0.5 | 0.5 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0041 | 0.5 | 0.5 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0041 | 0.5 | 0.5 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0041 | 0.5 | 0.5 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0041 | 0.5 | 0.5 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0041 | 0.5 | 0.5 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0041 | 0.5 | 0.5 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0041 | 0.5 | 0.5 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0041 | 0.5 | 0.5 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | nuclear hormone receptor | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | steroid hormone receptor | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0041 | 0.5 | 0.5 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0041 | 0.5 | 0.5 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0041 | 0.5 | 0.5 |
| Onchocerca volvulus | 0.0041 | 0.5 | 0.5 | |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0041 | 0.5 | 0.5 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0041 | 0.5 | 0.5 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0041 | 0.5 | 0.5 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | coup transcription factor | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0041 | 0.5 | 0.5 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.5 | 0.5 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0041 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0041 | 0.5 | 0.5 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0041 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0041 | 0.5 | 0.5 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0041 | 0.5 | 0.5 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0041 | 0.5 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | = 1 % | Induction of apoptosis in human MDA-MB-435 cells assessed as apoptotic cells at 10 uM after 24 hrs using by annexin V and propidium iodide staining by flow cytometry relative to control | ChEMBL. | 21443194 |
| Activity (functional) | = 1 % | Induction of apoptosis in human MDA-MB-435 cells assessed as apoptotic cells at 10 uM after 48 hrs using by annexin V and propidium iodide staining by flow cytometry relative to control | ChEMBL. | 21443194 |
| Activity (functional) | = 2 % | Induction of apoptosis in human MDA-MB-435 cells assessed as pre-necrotic cells at 10 uM after 24 hrs using by annexin V and propidium iodide staining by flow cytometry relative to control | ChEMBL. | 21443194 |
| Activity (functional) | = 4 % | Induction of apoptosis in human MDA-MB-435 cells assessed as necrotic cells at 10 uM after 24 hrs using by annexin V and propidium iodide staining by flow cytometry relative to control | ChEMBL. | 21443194 |
| Activity (functional) | = 10 % | Induction of apoptosis in human MDA-MB-435 cells assessed as pre-necrotic cells at 10 uM after 48 hrs using by annexin V and propidium iodide staining by flow cytometry relative to control | ChEMBL. | 21443194 |
| Activity (functional) | = 37 % | Induction of apoptosis in human MDA-MB-435 cells assessed as necrotic cells at 10 uM after 48 hrs using by annexin V and propidium iodide staining by flow cytometry relative to control | ChEMBL. | 21443194 |
| Activity (functional) | = 52 % | Induction of apoptosis in human MDA-MB-435 cells assessed as viable cells at 10 uM after 48 hrs using by annexin V and propidium iodide staining by flow cytometry relative to control | ChEMBL. | 21443194 |
| Activity (functional) | = 93 % | Induction of apoptosis in human MDA-MB-435 cells assessed as viable cells at 10 uM after 24 hrs using by annexin V and propidium iodide staining by flow cytometry relative to control | ChEMBL. | 21443194 |
| Activity (ADMET) | = 29 g | Toxicity in human MDA-MB-435 cells xenografted athymic nude mouse assessed as change in doy weight at 10 mg/kg, ip for 9 days followed by 20 mg/kg, ip for 5 days followed by 40 mg/kg, ip for 12 days | ChEMBL. | 21443194 |
| IC50 (functional) | = 0.2 uM | Cytotoxicity against human NCI/ADR-RES cells after 72 hrs by MTT assay | ChEMBL. | 21443194 |
| IC50 (functional) | = 0.6 uM | Cytotoxicity against human 5637 cells after 72 hrs by MTT assay | ChEMBL. | 21443194 |
| IC50 (functional) | = 5.2 uM | Cytotoxicity against human HEY cells after 72 hrs by MTT assay | ChEMBL. | 21443194 |
| IC50 (functional) | = 6.3 uM | Cytotoxicity against human MDA-MB-435 cells after 72 hrs by MTT assay | ChEMBL. | 21443194 |
| IC50 (functional) | = 7.2 uM | Cytotoxicity against human HT-29 cells after 72 hrs by MTT assay | ChEMBL. | 21443194 |
| IC50 (functional) | = 8.8 uM | Cytotoxicity against p53 deficient human HCT116 cells expressing p53 after 72 hrs by MTT assay | ChEMBL. | 21443194 |
| IC50 (functional) | > 10 uM | Cytotoxicity against human HCT116 cells expressing p53 after 72 hrs by MTT assay | ChEMBL. | 21443194 |
| IC50 (functional) | > 20 uM | Cytotoxicity against human UM-UC-3 cells after 72 hrs by MTT assay | ChEMBL. | 21443194 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 21443194 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1766682
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.