Detailed information for compound 1510441
Basic information
Technical information
- Name: Unnamed compound
- MW: 388.438 | Formula: C19H20N2O5S
-
H donors: 2
H acceptors: 2
LogP: 1.46
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: COCCOC(=O)C1=C(C)NC(=S)NC1c1coc2c(c1=O)cc(cc2)C
- InChi: 1S/C19H20N2O5S/c1-10-4-5-14-12(8-10)17(22)13(9-26-14)16-15(11(2)20-19(27)21-16)18(23)25-7-6-24-3/h4-5,8-9,16H,6-7H2,1-3H3,(H2,20,21,27)
- InChiKey: SSOOCDMKAYHDLE-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0132 | 0.5 | 0.5 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0132 | 0.5 | 0.5 |
| Onchocerca volvulus | 0.0132 | 0.5 | 0.5 | |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0132 | 0.5 | 0.5 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0132 | 0.5 | 0.5 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0132 | 0.5 | 0.5 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0132 | 0.5 | 0.5 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0132 | 0.5 | 0.5 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | steroid hormone receptor | 0.0132 | 0.5 | 0.5 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0132 | 0.5 | 0.5 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0132 | 0.5 | 0.5 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0132 | 0.5 | 0.5 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0132 | 0.5 | 0.5 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0132 | 0.5 | 0.5 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0132 | 0.5 | 0.5 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0132 | 0.5 | 0.5 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0132 | 0.5 | 0.5 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0132 | 0.5 | 0.5 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0132 | 0.5 | 0.5 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0132 | 0.5 | 0.5 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0132 | 0.5 | 0.5 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0132 | 0.5 | 0.5 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | coup transcription factor | 0.0132 | 0.5 | 0.5 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | nuclear hormone receptor | 0.0132 | 0.5 | 0.5 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0132 | 0.5 | 0.5 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0132 | 0.5 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | = 17.4 % | Cytotoxicity against human HeLa cells after 48 hrs by MTT assay | ChEMBL. | 21507635 |
| Activity (functional) | = 21.2 % | Cytotoxicity against human A549 cells after 48 hrs by MTT assay | ChEMBL. | 21507635 |
| Activity (functional) | = 22.8 % | Cytotoxicity against human SK-N-SH cells after 48 hrs by MTT assay | ChEMBL. | 21507635 |
| MIC (functional) | = 32.21 uM | Antituberculosis activity against Mycobacterium tuberculosis H37Rv by agar dilution method | ChEMBL. | 21507635 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1771045
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.