Detailed information for compound 1610832
Basic information
Technical information
- Name: Unnamed compound
- MW: 480.945 | Formula: C28H21ClN4O2
-
H donors: 0
H acceptors: 2
LogP: 6.43
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: CCO/C=N/C1=C(C#N)C(c2c(O1)n(nc2c1ccccc1)c1ccccc1)c1ccc(cc1)Cl
- InChi: 1S/C28H21ClN4O2/c1-2-34-18-31-27-23(17-30)24(19-13-15-21(29)16-14-19)25-26(20-9-5-3-6-10-20)32-33(28(25)35-27)22-11-7-4-8-12-22/h3-16,18,24H,2H2,1H3/b31-18+
- InChiKey: KYNYNSOJBPKYSS-FDAWAROLSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0259 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0259 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0259 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Schistosoma mansoni | opsin-like receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Onchocerca volvulus | Adenylate cyclase type 2 homolog | 0.008 | 0.1185 | 0.0187 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0259 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0259 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0259 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0259 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0218 | 0.8011 | 0.7744 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0259 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0259 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0259 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | adenylate cyclase 9 | 0.008 | 0.1185 | 0.1185 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0259 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | adenylate cyclase 9 | 0.008 | 0.1185 | 0.1185 |
| Brugia malayi | hypothetical protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0259 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0259 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0259 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0259 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0259 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0259 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 0.1185 | 0.0187 | |
| Brugia malayi | hypothetical protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0259 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0259 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0259 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0259 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0259 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0259 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0259 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0259 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0259 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0259 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0259 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0259 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0259 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0259 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0259 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0259 | 1 | 1 |
| Onchocerca volvulus | Adenylate cyclase type 3 homolog | 0.0222 | 0.8179 | 0.7973 |
| Brugia malayi | putative neuropeptide receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0259 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Echinococcus multilocularis | somatostatin receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0259 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0259 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0259 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0259 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0259 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0259 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0259 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0259 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0259 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0259 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0259 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0259 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0259 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Echinococcus multilocularis | serotonin receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0259 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0259 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0259 | 1 | 1 |
| Onchocerca volvulus | 0.0259 | 1 | 1 | |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0259 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0259 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| GI50 (functional) | -5.288 | PUBCHEM_BIOASSAY: NCI human tumor cell line growth inhibition assay. Data for the NCI-H23 Non-Small Cell Lung cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| GI50 (functional) | -5.266 | PUBCHEM_BIOASSAY: NCI human tumor cell line growth inhibition assay. Data for the HOP-92 Non-Small Cell Lung cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| GI50 (functional) | -5.247 | PUBCHEM_BIOASSAY: NCI human tumor cell line growth inhibition assay. Data for the HL-60(TB) Leukemia cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| GI50 (functional) | -5.212 | PUBCHEM_BIOASSAY: NCI human tumor cell line growth inhibition assay. Data for the SF-539 Central Nervous System cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| GI50 (functional) | -5.07 | PUBCHEM_BIOASSAY: NCI human tumor cell line growth inhibition assay. Data for the ACHN Renal cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| GI50 (functional) | -4.934 | PUBCHEM_BIOASSAY: NCI human tumor cell line growth inhibition assay. Data for the UO-31 Renal cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| GI50 (functional) | -4.912 | PUBCHEM_BIOASSAY: NCI human tumor cell line growth inhibition assay. Data for the SN12C Renal cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| GI50 (functional) | -4.832 | PUBCHEM_BIOASSAY: NCI human tumor cell line growth inhibition assay. Data for the MDA-N Breast cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| GI50 (functional) | -4.796 | PUBCHEM_BIOASSAY: NCI human tumor cell line growth inhibition assay. Data for the DU-145 Prostate cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1981757
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.