Detailed information for compound 1762890
Basic information
Technical information
- Name: Unnamed compound
- MW: 438.328 | Formula: C19H17Cl2N3O3S
-
H donors: 1
H acceptors: 3
LogP: 3.56
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: CCS(=O)(=O)Nc1cccc(c1)c1cc(=O)n(nc1C)c1cc(Cl)cc(c1)Cl
- InChi: 1S/C19H17Cl2N3O3S/c1-3-28(26,27)23-16-6-4-5-13(7-16)18-11-19(25)24(22-12(18)2)17-9-14(20)8-15(21)10-17/h4-11,23H,3H2,1-2H3
- InChiKey: RVAJMPJEDUOSDF-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | androgen receptor | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | pyruvate kinase-PB | 0.0446 | 0.6166 | 0.6166 |
| Echinococcus granulosus | pyruvate kinase | 0.0639 | 1 | 1 |
| Loa Loa (eye worm) | pyruvate kinase | 0.0639 | 1 | 1 |
| Trypanosoma brucei | pyruvate kinase 1 | 0.0639 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable pyruvate kinase PykA | 0.0639 | 1 | 0.5 |
| Echinococcus multilocularis | pyruvate kinase | 0.0639 | 1 | 1 |
| Echinococcus multilocularis | pyruvate kinase | 0.0505 | 0.7331 | 0.5671 |
| Onchocerca volvulus | Pyruvate kinase homolog | 0.0639 | 1 | 0.5 |
| Leishmania major | pyruvate kinase | 0.0639 | 1 | 0.5 |
| Brugia malayi | Pyruvate kinase, M2 isozyme | 0.0639 | 1 | 1 |
| Schistosoma mansoni | pyruvate kinase | 0.0639 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0639 | 1 | 1 |
| Plasmodium falciparum | pyruvate kinase | 0.0639 | 1 | 1 |
| Onchocerca volvulus | Pyruvate kinase homolog | 0.0639 | 1 | 0.5 |
| Chlamydia trachomatis | pyruvate kinase | 0.0639 | 1 | 0.5 |
| Loa Loa (eye worm) | pyruvate kinase | 0.0639 | 1 | 1 |
| Onchocerca volvulus | Pyruvate kinase homolog | 0.0639 | 1 | 0.5 |
| Entamoeba histolytica | pyruvate kinase, putative | 0.0446 | 0.6166 | 0.5 |
| Trypanosoma cruzi | pyruvate kinase 2, putative | 0.0639 | 1 | 0.5 |
| Trypanosoma cruzi | pyruvate kinase 2, putative | 0.0639 | 1 | 0.5 |
| Plasmodium vivax | pyruvate kinase, putative | 0.0639 | 1 | 1 |
| Giardia lamblia | Pyruvate kinase | 0.0639 | 1 | 1 |
| Brugia malayi | Pyruvate kinase, alpha/beta domain containing protein | 0.0193 | 0.1164 | 0.1164 |
| Mycobacterium ulcerans | pyruvate kinase | 0.0639 | 1 | 0.5 |
| Trichomonas vaginalis | pyruvate kinase, putative | 0.0639 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0446 | 0.6166 | 0.6166 |
| Loa Loa (eye worm) | pyruvate kinase | 0.0639 | 1 | 1 |
| Leishmania major | pyruvate kinase | 0.0639 | 1 | 0.5 |
| Echinococcus multilocularis | pyruvate kinase | 0.0639 | 1 | 1 |
| Trichomonas vaginalis | pyruvate kinase, putative | 0.0639 | 1 | 0.5 |
| Mycobacterium leprae | Probable pyruvate kinase PykA | 0.0639 | 1 | 0.5 |
| Trypanosoma brucei | pyruvate kinase 1, putative | 0.0639 | 1 | 0.5 |
| Toxoplasma gondii | pyruvate kinase PyK1 | 0.0639 | 1 | 1 |
| Schistosoma mansoni | pyruvate kinase | 0.0639 | 1 | 1 |
| Echinococcus granulosus | pyruvate kinase | 0.0639 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 13.19 uM | Inhibition of androgen receptor in human LNCAP cells after 1 day by luciferase reporter gene assay | ChEMBL. | 23727044 |
| IC50 (functional) | = 22.93 uM | Cytotoxicity against human LNCAP cells assessed as cell viability after 2 days by cell counting method | ChEMBL. | 23727044 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2397335
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.