Detailed information for compound 1799395
Basic information
Technical information
- Name: Unnamed compound
- MW: 449.542 | Formula: C26H31N3O4
-
H donors: 0
H acceptors: 2
LogP: 6.05
Rotable bonds: 9
Rule of 5 violations (Lipinski): 1 - SMILES: CO/N=C(\c1ccccc1COc1n(C)nc(c1C)c1ccc(cc1)C(C)(C)C)/C(=O)OC
- InChi: 1S/C26H31N3O4/c1-17-22(18-12-14-20(15-13-18)26(2,3)4)27-29(5)24(17)33-16-19-10-8-9-11-21(19)23(28-32-7)25(30)31-6/h8-15H,16H2,1-7H3/b28-23+
- InChiKey: NQQWRMDHXDBIHG-WEMUOSSPSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0122 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0122 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0122 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0122 | 1 | 1 |
| Leishmania major | inosine-5-monophosphate dehydrogenase | 0.0079 | 0.4936 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0122 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0122 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0122 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0122 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0122 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0122 | 1 | 1 |
| Mycobacterium leprae | Probable inosine-5'-monophosphate dehydrogenase GuaB2 (IMP dehydrogenase) (IMPDH) (IMPD) | 0.0079 | 0.4936 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0122 | 1 | 1 |
| Mycobacterium tuberculosis | Probable inosine-5'-monophosphate dehydrogenase GuaB2 (imp dehydrogenase) (inosinic acid dehydrogenase) (inosinate dehydrogenase | 0.0079 | 0.4936 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0122 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0122 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0122 | 1 | 1 |
| Toxoplasma gondii | IMP dehydrogenas | 0.0079 | 0.4936 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Trypanosoma cruzi | GMP reductase | 0.0079 | 0.4936 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0122 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0122 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Trypanosoma cruzi | inosine-5'-monophosphate dehydrogenase, putative | 0.0079 | 0.4936 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus granulosus | somatostatin receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0122 | 1 | 1 |
| Leishmania major | guanosine monophosphate reductase | 0.0079 | 0.4936 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0122 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0122 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0122 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0122 | 1 | 0.5 |
| Trypanosoma cruzi | GMP reductase | 0.0079 | 0.4936 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus multilocularis | somatostatin receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Plasmodium vivax | inosine-5'-monophosphate dehydrogenase, putative | 0.0075 | 0.4377 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0122 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Mycobacterium ulcerans | inosine 5'-monophosphate dehydrogenase | 0.0079 | 0.4936 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Mycobacterium leprae | Probable inosine-5'-monophosphate dehydrogenase GuaB3 (IMP dehydrogenase 2) (inosinic acid dehydrogenase) (inosinate dehydrogena | 0.0042 | 0.0471 | 0.0954 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0122 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0122 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Plasmodium falciparum | inosine-5'-monophosphate dehydrogenase | 0.0075 | 0.4377 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0122 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0122 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0122 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Trypanosoma cruzi | inosine-5'-monophosphate dehydrogenase, putative | 0.0079 | 0.4936 | 0.5 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0122 | 1 | 1 |
| Trypanosoma brucei | GMP reductase | 0.0079 | 0.4936 | 0.5 |
| Wolbachia endosymbiont of Brugia malayi | IMP dehydrogenase | 0.0079 | 0.4936 | 0.5 |
| Brugia malayi | Dopamine receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0122 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0122 | 1 | 1 |
| Trypanosoma cruzi | inosine-5'-monophosphate dehydrogenase, putative | 0.0079 | 0.4936 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0122 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0122 | 1 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0122 | 1 | 1 |
| Trypanosoma brucei | inosine-5'-monophosphate dehydrogenase | 0.0079 | 0.4936 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Mycobacterium ulcerans | inosine 5-monophosphate dehydrogenase | 0.0075 | 0.4377 | 0.8869 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2230327
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.