Detailed information for compound 1799657
Basic information
Technical information
- Name: Unnamed compound
- MW: 407.462 | Formula: C23H25N3O4
-
H donors: 0
H acceptors: 2
LogP: 4.74
Rotable bonds: 8
Rule of 5 violations (Lipinski): 1 - SMILES: CO/N=C(\c1ccccc1COc1n(C)nc(c1C)c1ccc(cc1)C)/C(=O)OC
- InChi: 1S/C23H25N3O4/c1-15-10-12-17(13-11-15)20-16(2)22(26(3)24-20)30-14-18-8-6-7-9-19(18)21(25-29-5)23(27)28-4/h6-13H,14H2,1-5H3/b25-21+
- InChiKey: FIKYOVUFAVDSKA-NJNXFGOHSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0122 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0122 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Leishmania major | inosine-5-monophosphate dehydrogenase | 0.0079 | 0.4936 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0122 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0122 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0122 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0122 | 1 | 1 |
| Trypanosoma cruzi | GMP reductase | 0.0079 | 0.4936 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Toxoplasma gondii | IMP dehydrogenas | 0.0079 | 0.4936 | 0.5 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Brugia malayi | neuropeptide F receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0122 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0122 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Mycobacterium tuberculosis | Probable inosine-5'-monophosphate dehydrogenase GuaB2 (imp dehydrogenase) (inosinic acid dehydrogenase) (inosinate dehydrogenase | 0.0079 | 0.4936 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Mycobacterium leprae | Probable inosine-5'-monophosphate dehydrogenase GuaB2 (IMP dehydrogenase) (IMPDH) (IMPD) | 0.0079 | 0.4936 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0122 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0122 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Trypanosoma cruzi | inosine-5'-monophosphate dehydrogenase, putative | 0.0079 | 0.4936 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0122 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Plasmodium vivax | inosine-5'-monophosphate dehydrogenase, putative | 0.0075 | 0.4377 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0122 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0122 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Trypanosoma cruzi | GMP reductase | 0.0079 | 0.4936 | 0.5 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0122 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0122 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0122 | 1 | 1 |
| Leishmania major | guanosine monophosphate reductase | 0.0079 | 0.4936 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Plasmodium falciparum | inosine-5'-monophosphate dehydrogenase | 0.0075 | 0.4377 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0122 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0122 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Mycobacterium leprae | Probable inosine-5'-monophosphate dehydrogenase GuaB3 (IMP dehydrogenase 2) (inosinic acid dehydrogenase) (inosinate dehydrogena | 0.0042 | 0.0471 | 0.0954 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Mycobacterium ulcerans | inosine 5'-monophosphate dehydrogenase | 0.0079 | 0.4936 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0122 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0122 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0122 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0122 | 1 | 1 |
| Trypanosoma cruzi | inosine-5'-monophosphate dehydrogenase, putative | 0.0079 | 0.4936 | 0.5 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0122 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0122 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | IMP dehydrogenase | 0.0079 | 0.4936 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.0122 | 1 | 1 |
| Trypanosoma brucei | GMP reductase | 0.0079 | 0.4936 | 0.5 |
| Schistosoma mansoni | adenoreceptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0122 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0122 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0122 | 1 | 1 |
| Onchocerca volvulus | 0.0122 | 1 | 0.5 | |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0122 | 1 | 1 |
| Mycobacterium ulcerans | inosine 5-monophosphate dehydrogenase | 0.0075 | 0.4377 | 0.8869 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0122 | 1 | 1 |
| Trypanosoma brucei | inosine-5'-monophosphate dehydrogenase | 0.0079 | 0.4936 | 0.5 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0122 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0122 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0122 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0122 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0122 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0122 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0122 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0122 | 1 | 1 |
| Trypanosoma cruzi | inosine-5'-monophosphate dehydrogenase, putative | 0.0079 | 0.4936 | 0.5 |
| Brugia malayi | larval opioid receptor | 0.0122 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0122 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0122 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2230331
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.