Detailed information for compound 1816713
Basic information
Technical information
- Name: Unnamed compound
- MW: 302.371 | Formula: C14H10N2O2S2
-
H donors: 3
H acceptors: 2
LogP: 2.7
Rotable bonds: 2
Rule of 5 violations (Lipinski): 1 - SMILES: S=C1N/C(=C/c2ccc(s2)c2ccc(cc2)O)/C(=O)N1
- InChi: 1S/C14H10N2O2S2/c17-9-3-1-8(2-4-9)12-6-5-10(20-12)7-11-13(18)16-14(19)15-11/h1-7,17H,(H2,15,16,18,19)/b11-7+
- InChiKey: ZAVXPAHLIMDCCL-YRNVUSSQSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | perforin 1 (pore forming protein) | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 1 | 1 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0024 | 1 | 1 |
| Onchocerca volvulus | 0.0024 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 1 | 1 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0024 | 1 | 1 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0024 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0024 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0024 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0024 | 1 | 1 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0024 | 1 | 1 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0024 | 1 | 1 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.1071 | 0.1071 |
| Schistosoma mansoni | coup transcription factor | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0024 | 1 | 1 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0024 | 1 | 1 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0024 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 1 | 1 |
| Schistosoma mansoni | ecdysone-induced protein 78c (dr-78) | 0.0012 | 0.1071 | 0.1071 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0024 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0024 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0024 | 1 | 1 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0012 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0024 | 1 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.1071 | 0.1071 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0012 | 0.1071 | 0.1071 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0024 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor subfamily 1 group D | 0.0012 | 0.1071 | 0.1071 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0024 | 1 | 1 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0024 | 1 | 1 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0024 | 1 | 1 |
| Brugia malayi | nuclear hormone receptor | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0024 | 1 | 1 |
| Brugia malayi | steroid hormone receptor | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0024 | 1 | 1 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0024 | 1 | 1 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0024 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0012 | 0.1071 | 0.1071 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0012 | 0.1071 | 0.1071 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0024 | 1 | 1 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0024 | 1 | 1 |
| Brugia malayi | nuclear receptor RXR | 0.0012 | 0.1071 | 0.1071 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.1071 | 0.1071 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0024 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor subfamily 1 group D | 0.0012 | 0.1071 | 0.1071 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0024 | 1 | 1 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0024 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0024 | 1 | 1 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0024 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0024 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0024 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0012 | 0.1071 | 0.1071 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0024 | 1 | 1 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0024 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0012 | 0.1071 | 0.1071 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0024 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0024 | 1 | 1 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0024 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.1071 | 0.1071 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 7.72 uM | Inhibition of recombinant perforin (unknown origin)-mediated lysis of human [51Cr]-labelled Jurkat cells assessed as release of [51Cr] preincubated for 30 mins followed by addition of cells measured after 4 hrs by gamma counting analysis | ChEMBL. | 24195776 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3104016
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.