Detailed information for compound 1850379
Basic information
Technical information
- Name: Unnamed compound
- MW: 290.384 | Formula: C14H18N4OS
-
H donors: 2
H acceptors: 1
LogP: 2.04
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: CSCCc1nc(oc1C)c1cccc(c1)NC(=N)N
- InChi: 1S/C14H18N4OS/c1-9-12(6-7-20-2)18-13(19-9)10-4-3-5-11(8-10)17-14(15)16/h3-5,8H,6-7H2,1-2H3,(H4,15,16,17)
- InChiKey: LDACHIYNXYKRLR-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | lysine (K)-specific demethylase 1A | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | G-protein coupled receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0108 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0108 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0108 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0108 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0108 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0108 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0108 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0108 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0108 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0108 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0108 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0108 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0083 | 0.7051 | 0.7051 |
| Brugia malayi | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0108 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0108 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0108 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0108 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0108 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0083 | 0.7051 | 0.7051 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0108 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0108 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0108 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0108 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0108 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0108 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0108 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0108 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0108 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0108 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0108 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0108 | 1 | 1 |
| Brugia malayi | SWIRM domain containing protein | 0.009 | 0.7888 | 0.7888 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0108 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0108 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0108 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.009 | 0.7888 | 0.7888 |
| Schistosoma mansoni | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0108 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0108 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0108 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0108 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0108 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0108 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0108 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0108 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0108 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0108 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0108 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0108 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0108 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0108 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0108 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0108 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0108 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0108 | 1 | 1 |
| Onchocerca volvulus | 0.0108 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0108 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0108 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 1.2 nM | Cytotoxicity against human HeLa cells after 72 hrs by MTT assay | ChEMBL. | No reference |
| IC50 (binding) | = 9.5 uM | Inhibition of LSD1 (unknown origin) using H3K4 peptide as substrate | ChEMBL. | No reference |
| Inhibition (binding) | > 50 % | Inhibition of N-terminal 6X His-tagged human recombinant full-length LSD1 expressed in Escherichia coli BL21(DE3) using H3K4me2 (1 to 21) peptide as substrate at 10 uM after 3 hrs by chemiluminescence assay relative to control | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3134309
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.