TDR Targets

Basic information

Technical information

TDR Targets ID: 423397
Name: 2-[[4-chloro-1-(diaminomethylideneamino)isoqu inolin-7-yl]sulfonylamino]acetic acid
MW: 357.773 | Formula: C12H12ClN5O4S
H donors: 4 H acceptors: 5 LogP: 0.11 Rotable bonds: 5
Rule of 5 violations (Lipinski): 1
SMILES: OC(=O)CNS(=O)(=O)c1ccc2c(c1)c(ncc2Cl)N=C(N)N
InChi: 1S/C12H12ClN5O4S/c13-9-4-16-11(18-12(14)15)8-3-6(1-2-7(8)9)23(21,22)17-5-10(19)20/h1-4,17H,5H2,(H,19,20)(H4,14,15,16,18)
InChiKey: NDLXLLJSLDEOHD-UHFFFAOYSA-N

Network

Hover on a compound node to display the structore

Target Layer

Model Organisms

Species	Viewmode
Arabidopsis thaliana
Caenorhabditis elegans
Dictyostelium discoideum
Drosophila melanogaster
Escherichia coli
Homo sapiens
Mus musculus
Oryza sativa
Saccharomyces cerevisiae
Schmidtea mediterranea
Other organisms

TDR Pathogens:

Species	Viewmode
Brugia malayi
Chlamydia trachomatis
Echinococcus granulosus
Entamoeba histolytica
Echinococcus multilocularis
Giardia lamblia
Leishmania major
Loa Loa (eye worm)
Mycobacterium leprae
Mycobacterium tuberculosis
Mycobacterium ulcerans
Onchocerca volvulus
Plasmodium falciparum
Plasmodium vivax
Schistosoma mansoni
Trypanosoma brucei
Trypanosoma cruzi
Toxoplasma gondii
Treponema pallidum
Trichomonas vaginalis
Wolbachia endosymbiont of Brugia malayi

Other Pathogens:

Species	Viewmode
Babesia bovis
Candida albicans
Cryptosporidium hominis
Cryptosporidium parvum
Leishmania braziliensis
Leishmania donovani
Leishmania infantum
Leishmania mexicana
Neospora caninum
Plasmodium berghei
Plasmodium knowlesi
Plasmodium yoelii
Schistosoma japonicum
Trypanosoma brucei gambiense
Trypanosoma congolense
Theileria parva

Compound Layer

This is a work in progress. Come back soon to try this features!

Clustering layers

This is a work in progress. Come back soon to try this features!

Synonyms

2-[(4-chloro-1-guanidino-7-isoquinolyl)sulfonylamino]acetic acid
2-[[1-[bis(azanyl)methylideneamino]-4-chloro-isoquinolin-7-yl]sulfonylamino]ethanoic acid
2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]ethanoic acid

Targets

Known targets for this compound

Species	Target name	Source	Bibliographic reference
Homo sapiens	plasminogen activator, urokinase	Starlite/ChEMBL	References

Predicted pathogen targets for this compound

By orthology

No druggable targets predicted by orthology data

By sequence similarity to non orthologous known druggable targets

Species	Potential target	Known druggable target	Length	Alignment span	Identity
Echinococcus granulosus	Mastin	plasminogen activator, urokinase	414 aa	340 aa	24.4 %

Ranking Plot

Putative Targets List

Species	Potential target	Raw	Global	Species
Echinococcus granulosus	hypothetical protein	0.0047	0.5	0.5
Echinococcus granulosus	orexin receptor type 2	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus multilocularis	tm gpcr rhodopsin gpcr rhodopsin superfamily	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Loa Loa (eye worm)	melatonin receptor type 1A	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	biogenic amine (5HT) receptor	0.0047	0.5	0.5
Echinococcus multilocularis	g-protein coupled receptor	0.0047	0.5	0.5
Brugia malayi	Unidentified vitellogenin-linked transcript protein 6, putative	0.0047	0.5	0.5
Brugia malayi	Serotonin receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	neuropeptide F receptor	0.0047	0.5	0.5
Schistosoma mansoni	peptide (FMRFamide/somatostatin)-like receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	biogenic amine receptor	0.0047	0.5	0.5
Echinococcus granulosus	g protein coupled receptor	0.0047	0.5	0.5
Echinococcus granulosus	neuropeptide FF receptor 2	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	myosin xvIII	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	neuropeptide receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.0047	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.0047	0.5	0.5
Echinococcus multilocularis	peptide (allatostatin:somatostatin)	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus multilocularis	tm gpcr rhodopsin gpcr rhodopsin superfamily	0.0047	0.5	0.5
Echinococcus granulosus	neuropeptides capa receptor	0.0047	0.5	0.5
Echinococcus multilocularis	serotonin receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	follicle stimulating hormone receptor	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus multilocularis	tm gpcr rhodopsin gpcr rhodopsin superfamily	0.0047	0.5	0.5
Echinococcus multilocularis	tachykinin peptides receptor 99D	0.0047	0.5	0.5
Schistosoma mansoni	opsin-like receptor	0.0047	0.5	0.5
Echinococcus granulosus	growth hormone secretagogue receptor type 1	0.0047	0.5	0.5
Schistosoma mansoni	biogenic amine (dopamine) receptor	0.0047	0.5	0.5
Schistosoma mansoni	amine GPCR	0.0047	0.5	0.5
Echinococcus multilocularis	thyrotropin releasing hormone receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	neuropeptide F-like receptor	0.0047	0.5	0.5
Brugia malayi	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	biogenic amine (5HT) receptor	0.0047	0.5	0.5
Schistosoma mansoni	amine GPCR	0.0047	0.5	0.5
Echinococcus multilocularis	neuropeptide FF receptor 2	0.0047	0.5	0.5
Schistosoma mansoni	peptide (allatostatin/somatostatin)-like receptor	0.0047	0.5	0.5
Echinococcus multilocularis	allatostatin A receptor	0.0047	0.5	0.5
Brugia malayi	Serotonin/octopamine receptor family protein 7	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus granulosus	tm gpcr rhodopsin	0.0047	0.5	0.5
Loa Loa (eye worm)	G-protein-linked acetylcholine receptor protein 2	0.0047	0.5	0.5
Echinococcus granulosus	serotonin receptor	0.0047	0.5	0.5
Brugia malayi	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	Tachykinin-like peptides receptor 99D	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Onchocerca volvulus	Dopamine\/Ecdysteroid receptor homolog	0.0047	0.5	0.5
Echinococcus multilocularis	G-protein coupled receptor, putative	0.0047	0.5	0.5
Brugia malayi	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	G-protein coupled receptor	0.0047	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.0047	0.5	0.5
Brugia malayi	sulfakinin receptor protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	amine GPCR	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.0047	0.5	0.5
Echinococcus multilocularis	g protein linked acetylcholine receptor gar 2a	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Echinococcus granulosus	g protein coupled receptor	0.0047	0.5	0.5
Echinococcus granulosus	neuropeptides capa receptor	0.0047	0.5	0.5
Echinococcus multilocularis	neuropeptides capa receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	biogenic amine receptor	0.0047	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Echinococcus granulosus	tm gpcr rhodopsin	0.0047	0.5	0.5
Brugia malayi	neuropeptide F receptor	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Schistosoma mansoni	muscarinic acetylcholine (GAR) receptor	0.0047	0.5	0.5
Echinococcus multilocularis	G protein coupled 5 hydroxytryptamine receptor	0.0047	0.5	0.5
Echinococcus granulosus	g protein linked acetylcholine receptor gar 2a	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Echinococcus granulosus	dro:myosuppressin receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.0047	0.5	0.5
Brugia malayi	larval opioid receptor	0.0047	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.0047	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.0047	0.5	0.5
Echinococcus granulosus	tachykinin peptides receptor 99D	0.0047	0.5	0.5
Echinococcus multilocularis	biogenic amine (5HT) receptor	0.0047	0.5	0.5
Echinococcus multilocularis	neuropeptide Y receptor	0.0047	0.5	0.5
Brugia malayi	putative neuropeptide receptor NPR1	0.0047	0.5	0.5
Schistosoma mansoni	peptide (allatostatin)-like receptor	0.0047	0.5	0.5
Echinococcus multilocularis	serotonin receptor	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Schistosoma mansoni	peptide (FMRFamide/somatostatin)-like receptor	0.0047	0.5	0.5
Brugia malayi	G protein-coupled receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	hypothetical protein	0.0047	0.5	0.5
Echinococcus granulosus	7tm_1 domain containing protein	0.0047	0.5	0.5
Echinococcus multilocularis	somatostatin receptor	0.0047	0.5	0.5
Schistosoma mansoni	alpha-1 adrenergic receptor	0.0047	0.5	0.5
Schistosoma mansoni	biogenic amine receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	Melatonin receptor type 1A	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Echinococcus multilocularis	dro:myosuppressin receptor	0.0047	0.5	0.5
Schistosoma mansoni	opsin-like receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	G protein-coupled receptor F59B2.13	0.0047	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.0047	0.5	0.5
Schistosoma mansoni	growth hormone secretagogue receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	neuropeptide F-like receptor	0.0047	0.5	0.5
Schistosoma mansoni	opsin-like receptor	0.0047	0.5	0.5
Echinococcus granulosus	neuropeptide Y receptor	0.0047	0.5	0.5
Schistosoma mansoni	ancient conserved domain protein 2 (cyclin m2)	0.0047	0.5	0.5
Schistosoma mansoni	biogenic amine (dopamine) receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.0047	0.5	0.5
Echinococcus multilocularis	pyroglutamylated rfamide peptide receptor	0.0047	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.0047	0.5	0.5
Brugia malayi	Dopamine receptor	0.0047	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.0047	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.0047	0.5	0.5
Schistosoma mansoni	amine GPCR	0.0047	0.5	0.5
Brugia malayi	G-protein-linked acetylcholine receptor protein 2, putative	0.0047	0.5	0.5
Echinococcus granulosus	pyroglutamylated rfamide peptide receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	5-hydroxytryptamine 2C receptor	0.0047	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.0047	0.5	0.5
Loa Loa (eye worm)	G-protein coupled receptor	0.0047	0.5	0.5
Echinococcus multilocularis	neuropeptide receptor	0.0047	0.5	0.5
Echinococcus multilocularis	g protein linked acetylcholine receptor gar 2a	0.0047	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus granulosus	G protein coupled 5 hydroxytryptamine receptor	0.0047	0.5	0.5
Brugia malayi	follicle stimulating hormone receptor	0.0047	0.5	0.5
Brugia malayi	G-protein coupled receptor	0.0047	0.5	0.5
Brugia malayi	Dopamine receptor protein 1, putative (partial)	0.0047	0.5	0.5
Schistosoma mansoni	histamine h1 receptor	0.0047	0.5	0.5
Brugia malayi	AKH receptor	0.0047	0.5	0.5
Echinococcus multilocularis	growth hormone secretagogue receptor type 1	0.0047	0.5	0.5
Echinococcus granulosus	biogenic amine 5HT receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Echinococcus multilocularis	fmrfamide receptor	0.0047	0.5	0.5
Echinococcus granulosus	tm gpcr rhodopsin	0.0047	0.5	0.5
Echinococcus granulosus	neuropeptide s receptor	0.0047	0.5	0.5
Echinococcus granulosus	neuropeptide receptor	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus granulosus	fmrfamide receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	gonadotropin-releasing hormone receptor 2	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	hypothetical protein	0.0047	0.5	0.5
Echinococcus multilocularis	orexin receptor type 2	0.0047	0.5	0.5
Echinococcus multilocularis	neuropeptide receptor	0.0047	0.5	0.5
Echinococcus granulosus	G protein coupled receptor 139	0.0047	0.5	0.5
Echinococcus multilocularis	neuropeptides capa receptor	0.0047	0.5	0.5
Onchocerca volvulus	Neuropeptide F receptor homolog	0.0047	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.0047	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.0047	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.0047	0.5	0.5
Echinococcus multilocularis	sex peptide receptor	0.0047	0.5	0.5
Echinococcus multilocularis	alpha 1A adrenergic receptor	0.0047	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.0047	0.5	0.5
Echinococcus multilocularis	neuropeptide s receptor	0.0047	0.5	0.5
Schistosoma mansoni	biogenic amine (dopamine) receptor	0.0047	0.5	0.5
Echinococcus granulosus	allatostatin A receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	unidentified vitellogenin-linked transcript protein 6	0.0047	0.5	0.5
Echinococcus granulosus	g protein coupled receptor	0.0047	0.5	0.5
Echinococcus multilocularis	neuropeptide Y receptor	0.0047	0.5	0.5
Echinococcus granulosus	sex peptide receptor	0.0047	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus multilocularis	g protein coupled receptor	0.0047	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.0047	0.5	0.5
Echinococcus multilocularis	neuropeptide receptor A26	0.0047	0.5	0.5
Loa Loa (eye worm)	G-protein coupled receptor	0.0047	0.5	0.5
Echinococcus granulosus	somatostatin receptor	0.0047	0.5	0.5
Echinococcus granulosus	g protein linked acetylcholine receptor gar 2a	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	GnHR receptor homolog	0.0047	0.5	0.5
Loa Loa (eye worm)	gonadotropin-releasing hormone receptor 2	0.0047	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.0047	0.5	0.5
Brugia malayi	RE15519p	0.0047	0.5	0.5
Schistosoma mansoni	amine GPCR	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	hypothetical protein	0.0047	0.5	0.5
Echinococcus granulosus	7TM GPCR rhodopsin	0.0047	0.5	0.5
Schistosoma mansoni	neuropeptide receptor	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus multilocularis	g protein coupled receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	neuropeptide F receptor	0.0047	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Schistosoma mansoni	peptide (FMRFamide/neurokinin-3)-like receptor	0.0047	0.5	0.5
Schistosoma mansoni	thyrotropin-releasing hormone receptor	0.0047	0.5	0.5
Echinococcus granulosus	peptide allatostatin:somatostatin	0.0047	0.5	0.5
Schistosoma mansoni	neuropeptide f receptor 76f	0.0047	0.5	0.5
Brugia malayi	neuropeptide F receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	Dopamine receptor protein 2	0.0047	0.5	0.5
Echinococcus granulosus	neuropeptide receptor A26	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus granulosus	rhodopsin orphan GPCR	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Echinococcus multilocularis	fmrfamide receptor	0.0047	0.5	0.5
Echinococcus granulosus	g-protein coupled receptor	0.0047	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.0047	0.5	0.5
Brugia malayi	putative neuropeptide receptor	0.0047	0.5	0.5
Echinococcus multilocularis	7TM GPCR, rhodopsin	0.0047	0.5	0.5
Schistosoma mansoni	histamine-responsive GPCR (AAF21638)	0.0047	0.5	0.5
Echinococcus granulosus	alpha 1A adrenergic receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	neuropeptide receptor	0.0047	0.5	0.5
Brugia malayi	hypothetical protein	0.0047	0.5	0.5
Echinococcus multilocularis	g protein coupled receptor	0.0047	0.5	0.5
Brugia malayi	Serotonin receptor	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Schistosoma mansoni	rhodopsin-like orphan GPCR	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0047	0.5	0.5
Echinococcus granulosus	biogenic amine 5HT receptor	0.0047	0.5	0.5
Echinococcus granulosus	neuropeptide Y receptor	0.0047	0.5	0.5
Schistosoma mansoni	neuropeptide receptor	0.0047	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.0047	0.5	0.5
Onchocerca volvulus		0.0047	0.5	0.5
Echinococcus multilocularis	rhodopsin orphan GPCR	0.0047	0.5	0.5
Schistosoma mansoni	biogenic amine (octopamine/dopamine) receptor	0.0047	0.5	0.5
Echinococcus granulosus	thyrotropin releasing hormone receptor	0.0047	0.5	0.5
Echinococcus multilocularis	G protein coupled receptor 139	0.0047	0.5	0.5
Echinococcus granulosus	neuropeptide receptor	0.0047	0.5	0.5
Brugia malayi	ORL1-like opioid receptor	0.0047	0.5	0.5
Brugia malayi	Dopamine receptor protein 1	0.0047	0.5	0.5
Schistosoma mansoni	adenoreceptor	0.0047	0.5	0.5
Loa Loa (eye worm)	TYRA-2 protein	0.0047	0.5	0.5

Activities

Activity type	Activity value	Assay description	Source	Reference
Ki (binding)	= 48 nM	Inhibition of human uPA	ChEMBL.	17447747
Ki (binding)	= 48 nM	Inhibition of human uPA	ChEMBL.	17447747
Ki (binding)	> 30 uM	Inhibition of human tPA	ChEMBL.	17447747
Ki (binding)	> 30 uM	Inhibition of human plasmin	ChEMBL.	17447747
Ki (binding)	> 30 uM	Inhibition of human tPA	ChEMBL.	17447747
Ki (binding)	> 30 uM	Inhibition of human plasmin	ChEMBL.	17447747

Phenotypes

Whole-cell/tissue/organism interactions

We have no records of whole-cell/tissue assays done with this compound What does this mean?

Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.

Annotated phenotypes:

We have no manually annotated phenotypes for this drug. What does this mean? / Care to help?

In TDR Targets, information about phenotypes that are caused by drugs, or by genetic manipulation of cells (e.g. gene knockouts or knockdowns) is manually curated from the literature. These descriptions help to describe the potential of the target for drug development. If no information is available for this gene or if the information is incomplete, this may mean that i) the papers containing this information either appeared after the curation effort for this organism was carried out or they were inadvertently missed by curators; or that ii) the curation effort for this organism has not yet started.

In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.

External resources for this compound

ChEMBL: CHEMBL226716
PubChem: 16658680

Bibliographic References

1 literature reference was collected for this gene.

If you have references for this compound, please enter them in a user comment (below) or Contact us.

Detailed information for compound 423397