Detailed information for compound 648280
Basic information
Technical information
- TDR Targets ID: 648280
- Name: 1-(2,4-dichlorophenyl)-3-[5-[(4-methoxyphenox y)methyl]-1,3,4-thiadiazol-2-yl]urea
- MW: 425.289 | Formula: C17H14Cl2N4O3S
-
H donors: 2
H acceptors: 3
LogP: 3.99
Rotable bonds: 8
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc(cc1)OCc1nnc(s1)NC(=O)Nc1ccc(cc1Cl)Cl
- InChi: 1S/C17H14Cl2N4O3S/c1-25-11-3-5-12(6-4-11)26-9-15-22-23-17(27-15)21-16(24)20-14-7-2-10(18)8-13(14)19/h2-8H,9H2,1H3,(H2,20,21,23,24)
- InChiKey: HTGNMSBDWXDVSP-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- STK068401
- Oprea1_281213
- BAS 04872698
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | phosphoglycerate kinase | 0.0166 | 0.6481 | 0.5594 |
| Schistosoma mansoni | opsin-like receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0225 | 1 | 1 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0109 | 0.3097 | 0.4156 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0225 | 1 | 1 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0109 | 0.3097 | 0.4156 |
| Loa Loa (eye worm) | 6-phosphofructokinase | 0.0109 | 0.3097 | 0.1356 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0225 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0225 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine phosphatase, putative | 0.0182 | 0.7452 | 1 |
| Echinococcus granulosus | 6 phosphofructokinase | 0.0109 | 0.3097 | 0.1356 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0225 | 1 | 1 |
| Trypanosoma brucei | phosphoglycerate kinase | 0.0166 | 0.6481 | 1 |
| Brugia malayi | hypothetical protein | 0.0225 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Leishmania major | ATP-dependent phosphofructokinase | 0.0109 | 0.3097 | 0.4779 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0225 | 1 | 1 |
| Trypanosoma cruzi | phosphoglycerate kinase, putative | 0.0166 | 0.6481 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0166 | 0.6481 | 0.5594 |
| Mycobacterium tuberculosis | Probable phosphoglycerate kinase Pgk | 0.0166 | 0.6481 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0225 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0225 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0225 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0225 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Chlamydia trachomatis | phosphoglycerate kinase | 0.0166 | 0.6481 | 0.5 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0225 | 1 | 1 |
| Trichomonas vaginalis | low molecular weight protein tyrosine phosphatase, putative | 0.0182 | 0.7452 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0225 | 1 | 1 |
| Trichomonas vaginalis | low molecular weight protein tyrosine phosphatase, putative | 0.0182 | 0.7452 | 1 |
| Trypanosoma brucei | phosphoglycerate kinase, putative | 0.0061 | 0.0277 | 0.0428 |
| Echinococcus granulosus | neuropeptide receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0225 | 1 | 1 |
| Trichomonas vaginalis | low molecular weight protein-tyrosine-phosphatase, putative | 0.0182 | 0.7452 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | 6 phosphofructokinase | 0.0109 | 0.3097 | 0.1356 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0225 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0225 | 1 | 1 |
| Brugia malayi | 6-phosphofructokinase | 0.0109 | 0.3097 | 0.2901 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0225 | 1 | 1 |
| Trypanosoma brucei | ATP-dependent 6-phosphofructokinase, glycosomal | 0.0109 | 0.3097 | 0.4779 |
| Toxoplasma gondii | phosphoglycerate kinase PGKII | 0.0166 | 0.6481 | 0.5 |
| Echinococcus multilocularis | sex peptide receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0225 | 1 | 1 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0109 | 0.3097 | 0.4156 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0225 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0225 | 1 | 1 |
| Trypanosoma cruzi | phosphoglycerate kinase, putative | 0.0166 | 0.6481 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Leishmania major | phosphoglycerate kinase C, glycosomal | 0.0166 | 0.6481 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Trichomonas vaginalis | low molecular weight protein tyrosine phosphatase, putative | 0.0182 | 0.7452 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0225 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0225 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0225 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0225 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0225 | 1 | 1 |
| Trypanosoma cruzi | phosphoglycerate kinase, putative | 0.0061 | 0.0277 | 0.0428 |
| Brugia malayi | Low molecular weight phosphotyrosine protein phosphatase containing protein | 0.0182 | 0.7452 | 0.738 |
| Echinococcus multilocularis | serotonin receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0225 | 1 | 1 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.009 | 0.2015 | 0.1787 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0225 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0225 | 1 | 1 |
| Trypanosoma cruzi | ATP-dependent 6-phosphofructokinase, glycosomal | 0.0109 | 0.3097 | 0.4779 |
| Brugia malayi | hypothetical protein | 0.0225 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0225 | 1 | 1 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0109 | 0.3097 | 0.4156 |
| Brugia malayi | putative neuropeptide receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0225 | 1 | 1 |
| Brugia malayi | phosphofructokinase | 0.0109 | 0.3097 | 0.2901 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0225 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0225 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | phosphotyrosine protein phosphatase | 0.0182 | 0.7452 | 0.681 |
| Giardia lamblia | Low molecular weight protein-tyrosine-phosphatase | 0.0182 | 0.7452 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0225 | 1 | 1 |
| Mycobacterium ulcerans | phosphoglycerate kinase | 0.0166 | 0.6481 | 0.7771 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Trypanosoma cruzi | PAS-domain containing phosphoglycerate kinase, putative | 0.0061 | 0.0277 | 0.0428 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Brugia malayi | G protein-coupled receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0225 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0225 | 1 | 1 |
| Trypanosoma cruzi | phosphoglycerate kinase, putative | 0.0061 | 0.0277 | 0.0428 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0225 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0225 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0225 | 1 | 1 |
| Trypanosoma brucei | phosphoglycerate kinase | 0.0061 | 0.0277 | 0.0428 |
| Trichomonas vaginalis | phosphoglycerate kinase, putative | 0.0166 | 0.6481 | 0.8697 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Trichomonas vaginalis | low molecular weight protein-tyrosine-phosphatase, putative | 0.0182 | 0.7452 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0225 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0225 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | 6-phosphofructokinase | 0.0109 | 0.3097 | 0.1356 |
| Leishmania major | PAS-domain containing phosphoglycerate kinase, putative | 0.0061 | 0.0277 | 0.0428 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0225 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0225 | 1 | 1 |
| Trichomonas vaginalis | low molecular weight protein-tyrosine-phosphatase, putative | 0.0182 | 0.7452 | 1 |
| Wolbachia endosymbiont of Brugia malayi | phosphoglycerate kinase | 0.0166 | 0.6481 | 0.5 |
| Plasmodium falciparum | phosphoglycerate kinase | 0.0166 | 0.6481 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.0225 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0225 | 1 | 1 |
| Trypanosoma cruzi | PAS-domain containing phosphoglycerate kinase, putative | 0.0061 | 0.0277 | 0.0428 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Entamoeba histolytica | phosphoglycerate kinase, putative | 0.0166 | 0.6481 | 0.7771 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0225 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0225 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Schistosoma mansoni | 6-phosphofructokinase | 0.0109 | 0.3097 | 0.1356 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0225 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0225 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0225 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0225 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0225 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0225 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0225 | 1 | 1 |
| Mycobacterium tuberculosis | Phosphotyrosine protein phosphatase PtpA (protein-tyrosine-phosphatase) (PTPase) (LMW phosphatase) | 0.0126 | 0.4131 | 0.3055 |
| Echinococcus multilocularis | phosphoglycerate kinase 1 | 0.0166 | 0.6481 | 0.5594 |
| Brugia malayi | neuropeptide F receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0225 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0225 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0225 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0225 | 1 | 1 |
| Treponema pallidum | phosphoglycerate kinase | 0.0166 | 0.6481 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0225 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | 6-phosphofructokinase | 0.0109 | 0.3097 | 0.1356 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0225 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0225 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0225 | 1 | 1 |
| Mycobacterium leprae | Probable phosphoglycerate kinase Pgk | 0.0166 | 0.6481 | 1 |
| Brugia malayi | Phosphoglycerate kinase | 0.0166 | 0.6481 | 0.6381 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0225 | 1 | 1 |
| Plasmodium vivax | phosphoglycerate kinase, putative | 0.0166 | 0.6481 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Entamoeba histolytica | protein tyrosine phosphatase, putative | 0.0182 | 0.7452 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | phosphofructokinase | 0.0109 | 0.3097 | 0.1356 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0225 | 1 | 1 |
| Mycobacterium ulcerans | phosphotyrosine protein phosphatase PtpA | 0.0182 | 0.7452 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0225 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Trichomonas vaginalis | phosphoglycerate kinase, putative | 0.0166 | 0.6481 | 0.8697 |
| Schistosoma mansoni | phosphoglycerate kinase | 0.0166 | 0.6481 | 0.5594 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | phosphoglycerate kinase 1 | 0.0166 | 0.6481 | 0.5594 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0225 | 1 | 1 |
| Brugia malayi | 6-phosphofructokinase | 0.0109 | 0.3097 | 0.2901 |
| Leishmania major | phosphoglycerate kinase B, cytosolic | 0.0166 | 0.6481 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0225 | 1 | 1 |
| Toxoplasma gondii | phosphoglycerate kinase PGKI | 0.0166 | 0.6481 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Trypanosoma brucei | phosphoglycerate kinase | 0.0166 | 0.6481 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0225 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0225 | 1 | 1 |
| Trypanosoma cruzi | 3-phosphoglycerate kinase, glycosomal | 0.0061 | 0.0277 | 0.0428 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0225 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0225 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0225 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0225 | 1 | 1 |
| Onchocerca volvulus | 0.0225 | 1 | 1 | |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0225 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.