Detailed information for compound 908618
Basic information
Technical information
- TDR Targets ID: 908618
- Name: N-(4-methoxyphenyl)-7-morpholin-4-yl-4-nitro- 2,1,3-benzoxadiazol-5-amine
- MW: 371.347 | Formula: C17H17N5O5
-
H donors: 1
H acceptors: 4
LogP: 2.82
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc(cc1)Nc1cc(N2CCOCC2)c2c(c1[N+](=O)[O-])non2
- InChi: 1S/C17H17N5O5/c1-25-12-4-2-11(3-5-12)18-13-10-14(21-6-8-26-9-7-21)15-16(20-27-19-15)17(13)22(23)24/h2-5,10,18H,6-9H2,1H3
- InChiKey: RTIZWMNQCRILIH-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-(4-methoxyphenyl)-7-morpholino-4-nitro-2,1,3-benzoxadiazol-5-amine
- (4-methoxyphenyl)-(7-morpholino-4-nitro-benzofurazan-5-yl)amine
- EU-0041207
- Oprea1_523337
- ChemDiv1_006789
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | RE15519p | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.013 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | nmda type glutamate receptor | 0.0085 | 0.5633 | 0.5633 |
| Schistosoma mansoni | amine GPCR | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.013 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.013 | 1 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | hypothetical protein | 0.013 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.013 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.013 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.013 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.013 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.013 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.013 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.013 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.013 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.013 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.013 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.013 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | somatostatin receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.013 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Brugia malayi | AKH receptor | 0.013 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.013 | 1 | 0.5 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.013 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.013 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.013 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.013 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | adenoreceptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.013 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.013 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | g-protein coupled receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.013 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.013 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.013 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Brugia malayi | putative neuropeptide receptor | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.013 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.013 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.013 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.013 | 1 | 0.5 |
| Brugia malayi | Serotonin receptor | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.013 | 1 | 1 |
| Echinococcus granulosus | nmda type glutamate receptor | 0.0109 | 0.7903 | 0.5584 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.013 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.013 | 1 | 0.5 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.013 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Brugia malayi | neuropeptide F receptor | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | nmda type glutamate receptor | 0.0085 | 0.5633 | 0.0803 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.013 | 1 | 0.5 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.013 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.013 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.013 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.013 | 1 | 0.5 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.013 | 1 | 0.5 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | nmda type glutamate receptor | 0.0109 | 0.7903 | 0.7903 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.013 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.013 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.013 | 1 | 0.5 |
| Brugia malayi | Dopamine receptor protein 2 | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.013 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Brugia malayi | ORL1-like opioid receptor | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.013 | 1 | 0.5 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.013 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.013 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | glutamate receptor NMDA | 0.0082 | 0.5251 | 0.5251 |
| Echinococcus granulosus | serotonin receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | histamine h1 receptor | 0.013 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.013 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.013 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.013 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.013 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.013 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.013 | 1 | 0.5 |
| Brugia malayi | larval opioid receptor | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.013 | 1 | 0.5 |
| Brugia malayi | follicle stimulating hormone receptor | 0.013 | 1 | 0.5 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.013 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.013 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.013 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.013 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.013 | 1 | 1 |
| Onchocerca volvulus | 0.013 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.013 | 1 | 0.5 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.