Detailed information for compound 946807
Basic information
Technical information
- Name: Unnamed compound
- MW: 376.854 | Formula: C19H17ClO4S
-
H donors: 1
H acceptors: 2
LogP: 4.82
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: CCOc1cccc(c1)C1CC(=C(C(=O)O1)Sc1ccccc1Cl)O
- InChi: 1S/C19H17ClO4S/c1-2-23-13-7-5-6-12(10-13)16-11-15(21)18(19(22)24-16)25-17-9-4-3-8-14(17)20/h3-10,16,21H,2,11H2,1H3
- InChiKey: QNKHQXZWRNJCRS-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | lactate dehydrogenase C | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Plasmodium falciparum | lactate dehydrogenase, putative | lactate dehydrogenase C | 332 aa | 307 aa | 29.6 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0081 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Plasmodium vivax | lactate dehydrogenase | 0.0056 | 0.4605 | 0.5 |
| Entamoeba histolytica | malate dehydrogenase, putative | 0.0056 | 0.4605 | 0.5 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0081 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0081 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0081 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0081 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0081 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0081 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0081 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0081 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0081 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0081 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0081 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0081 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Echinococcus granulosus | L lactate dehydrogenase B chain | 0.0056 | 0.4605 | 0.4605 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | L lactate dehydrogenase B chain | 0.0056 | 0.4605 | 0.4605 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0081 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0081 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0081 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0081 | 1 | 1 |
| Echinococcus granulosus | lactate dehydrogenase a | 0.0056 | 0.4605 | 0.4605 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0081 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0081 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | malate dehydrogenase | 0.0056 | 0.4605 | 0.5 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0081 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0081 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0081 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0081 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0081 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0081 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0081 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | lactate dehydrogenase protein | 0.0056 | 0.4605 | 0.4605 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | lactate dehydrogenase a | 0.0056 | 0.4605 | 0.4605 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0081 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Plasmodium vivax | malate dehydrogenase, putative | 0.0056 | 0.4605 | 0.5 |
| Toxoplasma gondii | lactate dehydrogenase LDH2 | 0.0056 | 0.4605 | 0.5 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0081 | 1 | 1 |
| Leishmania major | malate dehydrogenase, putative | 0.0056 | 0.4605 | 0.5 |
| Brugia malayi | Serotonin receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0081 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0081 | 1 | 1 |
| Plasmodium falciparum | malate dehydrogenase | 0.0056 | 0.4605 | 0.5 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0081 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0081 | 1 | 1 |
| Echinococcus granulosus | lactate dehydrogenase a | 0.0056 | 0.4605 | 0.4605 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0081 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Echinococcus granulosus | somatostatin receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0081 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Echinococcus multilocularis | allatostatin A receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0081 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0081 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0081 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0081 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0081 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | lactate dehydrogenase a | 0.0056 | 0.4605 | 0.4605 |
| Echinococcus granulosus | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0081 | 1 | 1 |
| Toxoplasma gondii | lactate dehydrogenase LDH1 | 0.0056 | 0.4605 | 0.5 |
| Brugia malayi | larval opioid receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0081 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0081 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0081 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0081 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0081 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0081 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0081 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0081 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0081 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0081 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0081 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0081 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0081 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0081 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0081 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0081 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0081 | 1 | 1 |
| Plasmodium falciparum | L-lactate dehydrogenase | 0.0056 | 0.4605 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0081 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0081 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0081 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0081 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0081 | 1 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.0081 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0081 | 1 | 1 |
| Echinococcus granulosus | lactate dehydrogenase protein | 0.0056 | 0.4605 | 0.4605 |
| Echinococcus multilocularis | lactate dehydrogenase a | 0.0056 | 0.4605 | 0.4605 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0081 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0081 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0081 | 1 | 1 |
| Onchocerca volvulus | 0.0081 | 1 | 0.5 | |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0081 | 1 | 1 |
| Toxoplasma gondii | malate dehydrogenase MDH | 0.0056 | 0.4605 | 0.5 |
| Brugia malayi | sulfakinin receptor protein | 0.0081 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0081 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0081 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0081 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 2.2 uM | Inhibition of human LDH-A by biochemical assay | ChEMBL. | 25467161 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3358878
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.