Detailed information for compound 108319
Basic information
Technical information
- Name: Unnamed compound
- MW: 541.573 | Formula: C26H27N3O8S
-
H donors: 3
H acceptors: 5
LogP: 2.57
Rotable bonds: 13
Rule of 5 violations (Lipinski): 2 - SMILES: ONC(=O)[C@H](N(S(=O)(=O)c1ccc(cc1)OC)Cc1ccc2c(c1)OCO2)CCNC(=O)c1ccccc1
- InChi: 1S/C26H27N3O8S/c1-35-20-8-10-21(11-9-20)38(33,34)29(16-18-7-12-23-24(15-18)37-17-36-23)22(26(31)28-32)13-14-27-25(30)19-5-3-2-4-6-19/h2-12,15,22,32H,13-14,16-17H2,1H3,(H,27,30)(H,28,31)/t22-/m1/s1
- InChiKey: REJYQXSMUHXQNK-JOCHJYFZSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | tolloid-like 2 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Dopamine receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.008 | 1 | 1 |
| Brugia malayi | Fibulin-1 precursor | 0.0018 | 0.0281 | 0.0281 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.008 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | multiple epidermal growth factor-like domains 6 | 0.0018 | 0.0281 | 0.0281 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.008 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.008 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.1013 | 0.1013 |
| Schistosoma mansoni | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.008 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.008 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.008 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.008 | 1 | 1 |
| Toxoplasma gondii | calcium binding egf domain-containing protein | 0.0018 | 0.0281 | 0.5 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.008 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.008 | 1 | 1 |
| Echinococcus granulosus | Tolloid protein 1 | 0.0056 | 0.6134 | 0.6023 |
| Echinococcus granulosus | sex peptide receptor | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | Calcium binding EGF domain containing protein | 0.0018 | 0.0281 | 0.0281 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | Tolloid protein 1 | 0.0056 | 0.6134 | 0.6023 |
| Schistosoma mansoni | myosin xvIII | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.008 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.008 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.008 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | AStacin protease | 0.0035 | 0.2896 | 0.2896 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.008 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.008 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.008 | 1 | 1 |
| Toxoplasma gondii | calcium binding egf domain-containing protein | 0.0018 | 0.0281 | 0.5 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.008 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.008 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.008 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.008 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.008 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.008 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.008 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.008 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0281 | 0.0281 |
| Schistosoma mansoni | neuropeptide receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.008 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.008 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.008 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0053 | 0.5783 | 0.5783 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.008 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.008 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.008 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.008 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | subfamily M12A unassigned peptidase (M12 family) | 0.0056 | 0.6134 | 0.6134 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.008 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.008 | 1 | 1 |
| Brugia malayi | RE15519p | 0.008 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.008 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.008 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.008 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Brugia malayi | larval opioid receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.008 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Loa Loa (eye worm) | bone morphogenetic protein 1b | 0.0056 | 0.6134 | 0.6134 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Brugia malayi | sulfakinin receptor protein | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.008 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.008 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.008 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.008 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.008 | 1 | 1 |
| Onchocerca volvulus | 0.008 | 1 | 1 | |
| Echinococcus multilocularis | serotonin receptor | 0.008 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.008 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.008 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Ki (binding) | = 470 nM | In vitro inhibitory activity against procollagen C-terminal proteinase (PCP) in HT-1080 cells using synthetic peptide as substrate | ChEMBL. | 12798313 |
| Ki (binding) | = 470 nM | In vitro inhibitory activity against procollagen C-terminal proteinase (PCP) in HT-1080 cells using synthetic peptide as substrate | ChEMBL. | 12798313 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
No external resources registered for this compound
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.