Detailed information for compound 1265014
Basic information
Technical information
- TDR Targets ID: 1265014
- Name: N-(2-chlorophenyl)-2-(pyridin-4-ylmethylsulfa nyl)pyridine-3-carboxamide
- MW: 355.841 | Formula: C18H14ClN3OS
-
H donors: 1
H acceptors: 3
LogP: 3.58
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(c1cccnc1SCc1ccncc1)Nc1ccccc1Cl
- InChi: 1S/C18H14ClN3OS/c19-15-5-1-2-6-16(15)22-17(23)14-4-3-9-21-18(14)24-12-13-7-10-20-11-8-13/h1-11H,12H2,(H,22,23)
- InChiKey: HWHUZNXVYXCLGV-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-(2-chlorophenyl)-2-(4-pyridylmethylsulfanyl)pyridine-3-carboxamide
- N-(2-chlorophenyl)-2-(4-pyridylmethylthio)-3-pyridinecarboxamide
- N-(2-chlorophenyl)-2-(4-pyridylmethylthio)nicotinamide
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0051 | 1 | 1 |
| Schistosoma mansoni | coup transcription factor | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0049 | 0.9038 | 0.9038 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0051 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0051 | 1 | 1 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0051 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0051 | 1 | 1 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0027 | 0.0005 | 0.0005 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0051 | 1 | 1 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0051 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0051 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0051 | 1 | 1 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0051 | 1 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0051 | 1 | 1 |
| Brugia malayi | Cytochrome P450 family protein | 0.0049 | 0.9038 | 0.9037 |
| Brugia malayi | Cytochrome P450 family protein | 0.0049 | 0.9038 | 0.9037 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0051 | 1 | 1 |
| Onchocerca volvulus | 0.0051 | 1 | 0.5 | |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0051 | 1 | 0.5 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0027 | 0.0005 | 0.0005 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0051 | 1 | 1 |
| Mycobacterium ulcerans | cytochrome P450 185A4 Cyp185A4 | 0.0049 | 0.9038 | 0.5 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0051 | 1 | 1 |
| Trypanosoma brucei | cytochrome P450, putative | 0.0049 | 0.9038 | 0.5 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0051 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0051 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0051 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0027 | 0.0005 | 0.0005 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0051 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 1 | 1 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0051 | 1 | 1 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0051 | 1 | 1 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0051 | 1 | 1 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0051 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0051 | 1 | 1 |
| Brugia malayi | steroid hormone receptor | 0.0051 | 1 | 1 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 1 | 1 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0051 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 1 | 1 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0051 | 1 | 1 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0051 | 1 | 0.5 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0027 | 0.0005 | 0.0005 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0051 | 1 | 1 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0051 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0051 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0051 | 1 | 1 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0027 | 0.0005 | 0.0005 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0049 | 0.9038 | 0.5 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0051 | 1 | 0.5 |
| Leishmania major | cytochrome p450-like protein | 0.0049 | 0.9038 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0051 | 1 | 1 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | CYP4Cod1 | 0.0049 | 0.9038 | 0.9038 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0051 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0051 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0049 | 0.9038 | 0.9038 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0027 | 0.0005 | 0.0005 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0051 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0051 | 1 | 1 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0051 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0049 | 0.9038 | 0.5 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0051 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0051 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0051 | 1 | 1 |
| Brugia malayi | nuclear hormone receptor | 0.0051 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | > 2000 nM | Inhibition of VEGF-induced HUVEC proliferation treated 1 hr before VEGF challenge measured 3 days by WST-8 assay | ChEMBL. | 21074435 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 21074435 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1288086
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.