Detailed information for compound 148400
Basic information
Technical information
- Name: Unnamed compound
- MW: 885.948 | Formula: C48H55NO15
-
H donors: 5
H acceptors: 9
LogP: 3.21
Rotable bonds: 17
Rule of 5 violations (Lipinski): 2 - SMILES: CC(=O)O[C@H]1[C@H](O)[C@]2(C)[C@@H](O)C[C@@H]3[C@]([C@H]2[C@@H]([C@]2(C(C1=C(C)[C@@H](OC(=O)[C@@H]([C@@H](NC(=O)c1ccccc1)COc1ccccc1)O)C2)(C)C)O)OC(=O)c1ccccc1)(CO3)OC(=O)C
- InChi: 1S/C48H55NO15/c1-26-33(62-44(57)37(53)32(24-59-31-20-14-9-15-21-31)49-42(55)29-16-10-7-11-17-29)23-48(58)41(63-43(56)30-18-12-8-13-19-30)39-46(6,34(52)22-35-47(39,25-60-35)64-28(3)51)40(54)38(61-27(2)50)36(26)45(48,4)5/h7-21,32-35,37-41,52-54,58H,22-25H2,1-6H3,(H,49,55)/t32-,33-,34-,35+,37+,38+,39-,40-,41-,46+,47-,48+/m0/s1
- InChiKey: CBAXZUOXKVIXJP-NPXJLEPTSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Entamoeba histolytica | tubulin family protein | 0.0077 | 1 | 1 |
| Echinococcus granulosus | tubulin subunit beta | 0.0077 | 1 | 1 |
| Plasmodium falciparum | tubulin beta chain | 0.0077 | 1 | 1 |
| Toxoplasma gondii | beta-tubulin, putative | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta chain | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-4 chain | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-2A chain | 0.0077 | 1 | 1 |
| Echinococcus granulosus | tubulin beta 1 chain | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin gamma chain, putative | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | beta-tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Echinococcus granulosus | beta tubulin | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | BEN-1 protein | 0.0077 | 1 | 1 |
| Echinococcus granulosus | tubulin beta 4A class IVa | 0.0077 | 1 | 1 |
| Toxoplasma gondii | beta-1 tubulin, putative | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0077 | 1 | 1 |
| Entamoeba histolytica | tubulin family protein | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin, putative | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | BEN-1 protein | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | tubulin beta 1 chain | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | beta tubulin | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-1 chain | 0.0077 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0077 | 1 | 1 |
| Trypanosoma cruzi | beta tubulin, putative | 0.0077 | 1 | 1 |
| Brugia malayi | beta-tubulin, identical | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0077 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Toxoplasma gondii | beta tubulin | 0.0077 | 1 | 1 |
| Plasmodium vivax | tubulin beta chain, putative | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha chain, putative | 0.0077 | 1 | 1 |
| Echinococcus granulosus | beta tubulin | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0077 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | tubulin subunit beta | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | tubulin, beta 4A class IVa | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 39 ng ml-1 | In vitro cytotoxicity against HT-29 (human colon adenocarcinoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 39 ng ml-1 | In vitro cytotoxicity against HT-29 (human colon adenocarcinoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 84 ng ml-1 | In vitro cytotoxicity against B16F10 (mouse melanoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 84 ng ml-1 | In vitro cytotoxicity against B16F10 (mouse melanoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 92 ng ml-1 | In vitro cytotoxicity against A549 (human lung carcinoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 92 ng ml-1 | In vitro cytotoxicity against A549 (human lung carcinoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | > 100 ng ml-1 | In vitro cytotoxicity against P388 (murine leukemia) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | > 100 ng ml-1 | In vitro cytotoxicity against P388 (murine leukemia) cell line. | ChEMBL. | 7914927 |
| Ratio (functional) | = 5.81 | Compound was tested for the concentration of agent which reduces the supernatant protein concentration (tubulin, 1 mg/mL) by 50%; ED50/ED50taxol | ChEMBL. | 7914927 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Mus musculus | ChEMBL23 | 7914927 | |
| Homo sapiens | ChEMBL23 | 7914927 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 10102189
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.