Detailed information for compound 148400
Basic information
Technical information
- Name: Unnamed compound
- MW: 885.948 | Formula: C48H55NO15
-
H donors: 5
H acceptors: 9
LogP: 3.21
Rotable bonds: 17
Rule of 5 violations (Lipinski): 2 - SMILES: CC(=O)O[C@H]1[C@H](O)[C@]2(C)[C@@H](O)C[C@@H]3[C@]([C@H]2[C@@H]([C@]2(C(C1=C(C)[C@@H](OC(=O)[C@@H]([C@@H](NC(=O)c1ccccc1)COc1ccccc1)O)C2)(C)C)O)OC(=O)c1ccccc1)(CO3)OC(=O)C
- InChi: 1S/C48H55NO15/c1-26-33(62-44(57)37(53)32(24-59-31-20-14-9-15-21-31)49-42(55)29-16-10-7-11-17-29)23-48(58)41(63-43(56)30-18-12-8-13-19-30)39-46(6,34(52)22-35-47(39,25-60-35)64-28(3)51)40(54)38(61-27(2)50)36(26)45(48,4)5/h7-21,32-35,37-41,52-54,58H,22-25H2,1-6H3,(H,49,55)/t32-,33-,34-,35+,37+,38+,39-,40-,41-,46+,47-,48+/m0/s1
- InChiKey: CBAXZUOXKVIXJP-NPXJLEPTSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Plasmodium vivax | tubulin beta chain, putative | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | tubulin, beta 4A class IVa | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-1 chain | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Echinococcus granulosus | tubulin beta 4A class IVa | 0.0077 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | tubulin beta 1 chain | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-2A chain | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta chain | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin gamma chain, putative | 0.0077 | 1 | 1 |
| Entamoeba histolytica | tubulin family protein | 0.0077 | 1 | 1 |
| Toxoplasma gondii | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Brugia malayi | beta-tubulin, identical | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Toxoplasma gondii | beta-tubulin, putative | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | beta-tubulin | 0.0077 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | BEN-1 protein | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | BEN-1 protein | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha chain, putative | 0.0077 | 1 | 1 |
| Echinococcus granulosus | tubulin subunit beta | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0077 | 1 | 1 |
| Entamoeba histolytica | tubulin family protein | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin, putative | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Trypanosoma cruzi | beta tubulin, putative | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Echinococcus granulosus | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Echinococcus granulosus | beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0077 | 1 | 1 |
| Trypanosoma brucei | beta tubulin | 0.0077 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Plasmodium falciparum | tubulin beta chain | 0.0077 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0077 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0077 | 1 | 1 |
| Echinococcus granulosus | tubulin beta 1 chain | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | tubulin subunit beta | 0.0077 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Echinococcus multilocularis | beta tubulin | 0.0077 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-4 chain | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0077 | 1 | 1 |
| Toxoplasma gondii | beta-1 tubulin, putative | 0.0077 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0077 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 39 ng ml-1 | In vitro cytotoxicity against HT-29 (human colon adenocarcinoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 39 ng ml-1 | In vitro cytotoxicity against HT-29 (human colon adenocarcinoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 84 ng ml-1 | In vitro cytotoxicity against B16F10 (mouse melanoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 84 ng ml-1 | In vitro cytotoxicity against B16F10 (mouse melanoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 92 ng ml-1 | In vitro cytotoxicity against A549 (human lung carcinoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | = 92 ng ml-1 | In vitro cytotoxicity against A549 (human lung carcinoma) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | > 100 ng ml-1 | In vitro cytotoxicity against P388 (murine leukemia) cell line. | ChEMBL. | 7914927 |
| IC50 (functional) | > 100 ng ml-1 | In vitro cytotoxicity against P388 (murine leukemia) cell line. | ChEMBL. | 7914927 |
| Ratio (functional) | = 5.81 | Compound was tested for the concentration of agent which reduces the supernatant protein concentration (tubulin, 1 mg/mL) by 50%; ED50/ED50taxol | ChEMBL. | 7914927 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 7914927 | |
| Mus musculus | ChEMBL23 | 7914927 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 10102189
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.