Detailed information for compound 1668227
Basic information
Technical information
- Name: Unnamed compound
- MW: 299.278 | Formula: C16H13NO5
-
H donors: 3
H acceptors: 5
LogP: 2.75
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: CC(=O)c1ccc(c(c1)C(=O)O)Nc1cccc(c1)C(=O)O
- InChi: 1S/C16H13NO5/c1-9(18)10-5-6-14(13(8-10)16(21)22)17-12-4-2-3-11(7-12)15(19)20/h2-8,17H,1H3,(H,19,20)(H,21,22)
- InChiKey: FUMRJGBEMSCDNN-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | aldo-keto reductase family 1, member B10 (aldose reductase) | Starlite/ChEMBL | References |
| Homo sapiens | aldo-keto reductase family 1, member C3 | Starlite/ChEMBL | References |
| Homo sapiens | aldo-keto reductase family 1, member C1 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Leishmania major | aldo-keto reductase-like protein | aldo-keto reductase family 1, member C1 | 323 aa | 325 aa | 35.1 % |
| Mycobacterium tuberculosis | Conserved protein | aldo-keto reductase family 1, member B10 (aldose reductase) | 316 aa | 331 aa | 22.4 % |
| Leishmania major | aldo-keto reductase-like protein | aldo-keto reductase family 1, member C3 | 323 aa | 325 aa | 34.1 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma cruzi | aldo/keto reductase, putative | 0.006 | 1 | 1 |
| Plasmodium vivax | aldehyde reductase, putative | 0.0033 | 0 | 0.5 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Mycobacterium leprae | PROBABLE OXIDOREDUCTASE | 0.006 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.006 | 1 | 1 |
| Plasmodium vivax | oxidoreductase, aldo/keto reductase domain containing protein | 0.0033 | 0 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase | 0.006 | 1 | 1 |
| Trypanosoma brucei | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.006 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 1 | |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 1 | |
| Echinococcus granulosus | hypothetical protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.006 | 1 | 1 |
| Toxoplasma gondii | aldose reductase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | aldo-keto reductase | 0.006 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.006 | 1 | 1 |
| Schistosoma mansoni | aldo-keto reductase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Leishmania major | prostaglandin f2-alpha synthase/D-arabinose dehydrogenase | 0.006 | 1 | 1 |
| Giardia lamblia | Aldose reductase | 0.006 | 1 | 0.5 |
| Echinococcus multilocularis | aldo keto reductase | 0.006 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Plasmodium falciparum | aldo-keto reductase, putative | 0.0033 | 0 | 0.5 |
| Echinococcus granulosus | aldo keto reductase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Plasmodium falciparum | aldehyde reductase, putative | 0.0033 | 0 | 0.5 |
| Leishmania major | aldo-keto reductase-like protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.006 | 1 | 1 |
| Trypanosoma cruzi | aldo-keto reductase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.006 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 1 | |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.006 | 1 | 1 |
| Entamoeba histolytica | aldose reductase, putative | 0.006 | 1 | 1 |
| Giardia lamblia | Aldose reductase | 0.006 | 1 | 0.5 |
| Onchocerca volvulus | 0.006 | 1 | 1 | |
| Loa Loa (eye worm) | oxidoreductase | 0.006 | 1 | 1 |
| Trypanosoma brucei | prostaglandin f synthase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | dihydrodiol dehydrogenase, putative | 0.006 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Leishmania major | prostaglandin f synthase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Leishmania major | aldehyde reductase, putative,oxidoreductase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo/keto reductase, putative | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 1 | |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.006 | 1 | 1 |
| Echinococcus multilocularis | aldo keto reductase family 1, member B4 | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 1 | |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | pol-related | 0.006 | 1 | 1 |
| Brugia malayi | oxidoreductase, aldo/keto reductase family protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | aldo keto reductase family 1 member B4 | 0.006 | 1 | 1 |
| Trichomonas vaginalis | aldo-keto reductase, putative | 0.006 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 0.04 uM | Inhibition of recombinant AKR1C3 assessed as NADP+ dependent oxidation of S-tetralol by fluorescence assay | ChEMBL. | 22263837 |
| IC50 (binding) | = 6.41 uM | Inhibition of recombinant AKR1C2 assessed as NADP+ dependent oxidation of S-tetralol by fluorescence assay | ChEMBL. | 22263837 |
| IC50 (binding) | = 16.2 uM | Inhibition of recombinant AKR1B10 assessed as NADP+ dependent reduction of DL-glyceraldehyde by fluorescence assay | ChEMBL. | 22263837 |
| IC50 (binding) | = 27.7 uM | Inhibition of recombinant AKR1B1 assessed as NADP+ dependent reduction of DL-glyceraldehyde by fluorescence assay | ChEMBL. | 22263837 |
| IC50 (binding) | = 28.7 uM | Inhibition of recombinant AKR1C4 assessed as NADP+ dependent oxidation of S-tetralol by fluorescence assay | ChEMBL. | 22263837 |
| IC50 (binding) | = 30.5 uM | Inhibition of recombinant AKR1C1 assessed as NADP+ dependent oxidation of S-tetralol by fluorescence assay | ChEMBL. | 22263837 |
| IC50 (binding) | > 100 uM | Inhibition of COX2 expressed in baculovirus infected SF-21 cells assessed as formation of PGH2 from PGG2 using arachidonic acid as substrate preincubated for 5 mins | ChEMBL. | 22263837 |
| Inhibition (binding) | Inhibition of AKR1C3 expressed in androgen dependent LNCaP cells assessed inhibition of testosterone formation from delta4-androstene-3,17-dione at 10 uM after 48 hrs | ChEMBL. | 22263837 | |
| Inhibition (binding) | = 10 % | Inhibition of COX2 expressed in baculovirus infected SF-21 cells assessed as formation of PGH2 from PGG2 using arachidonic acid as substrate at 100 uM preincubated for 5 mins | ChEMBL. | 22263837 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2041554
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.