Detailed information for compound 279891
Basic information
Technical information
- Name: Unnamed compound
- MW: 317.21 | Formula: C11H13FN3O5P
-
H donors: 5
H acceptors: 7
LogP: -2.94
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: Fc1cc(CN[C@@H](P(=O)(O)O)C)c2c(c1)nc(c(n2)O)O
- InChi: 1S/C11H13FN3O5P/c1-5(21(18,19)20)13-4-6-2-7(12)3-8-9(6)15-11(17)10(16)14-8/h2-3,5,13H,4H2,1H3,(H,14,16)(H,15,17)(H2,18,19,20)/t5-/m0/s1
- InChiKey: OQBBXIJMKTYKAW-YFKPBYRVSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | glutamate receptor, ionotropic, N-methyl D-aspartate 1 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | g protein coupled receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0055 | 0.1755 | 0.1741 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0055 | 0.1755 | 0.1741 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0055 | 0.1755 | 0.1755 |
| Schistosoma mansoni | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0178 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor subfamily 1 group D | 0.0029 | 0.0017 | 0.0017 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0178 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0178 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0178 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0178 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0055 | 0.1755 | 0.1741 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0055 | 0.1755 | 0.1741 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Echinococcus granulosus | sex peptide receptor | 0.0178 | 1 | 1 |
| Brugia malayi | ecdysteroid receptor | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0178 | 1 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0178 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | nmda type glutamate receptor | 0.0104 | 0.5045 | 0.5045 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0178 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0178 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0178 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0178 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0178 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0178 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0055 | 0.1755 | 0.1741 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0178 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0178 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0055 | 0.1755 | 0.1741 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | nmda type glutamate receptor | 0.0104 | 0.5045 | 0.5045 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0178 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0178 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | nmda type glutamate receptor | 0.01 | 0.4753 | 0.4753 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0178 | 1 | 1 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0178 | 1 | 1 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0055 | 0.1755 | 0.1741 |
| Brugia malayi | putative neuropeptide receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0178 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0178 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | g protein coupled receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0055 | 0.1755 | 0.1755 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0178 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0178 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0178 | 1 | 1 |
| Echinococcus granulosus | glutamate receptor NMDA | 0.0095 | 0.4445 | 0.4445 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0178 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0178 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0178 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0178 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0055 | 0.1755 | 0.1741 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0178 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0178 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0178 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0178 | 1 | 1 |
| Brugia malayi | steroid hormone receptor | 0.0055 | 0.1755 | 0.1741 |
| Schistosoma mansoni | amine GPCR | 0.0178 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | nuclear receptor subfamily 1 group D | 0.0029 | 0.0017 | 0.0017 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | nmda type glutamate receptor | 0.01 | 0.4753 | 0.4753 |
| Schistosoma mansoni | neuropeptide receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0055 | 0.1755 | 0.1755 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0055 | 0.1755 | 0.1741 |
| Schistosoma mansoni | opsin-like receptor | 0.0178 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | coup transcription factor | 0.0055 | 0.1755 | 0.1741 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0178 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0178 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0178 | 1 | 1 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0178 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0055 | 0.1755 | 0.1741 |
| Schistosoma mansoni | opsin-like receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0178 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0055 | 0.1755 | 0.1755 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0178 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0055 | 0.1755 | 0.1755 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0178 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0178 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0178 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0055 | 0.1755 | 0.1741 |
| Schistosoma mansoni | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Brugia malayi | nuclear hormone receptor | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0178 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0055 | 0.1755 | 0.1755 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0178 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0178 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | glutamate receptor NMDA | 0.0095 | 0.4445 | 0.4445 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Schistosoma mansoni | glutamate receptor NMDA | 0.0124 | 0.6375 | 0.6369 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0055 | 0.1755 | 0.1755 |
| Brugia malayi | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0055 | 0.1755 | 0.1741 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0055 | 0.1755 | 0.1741 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0178 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0178 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0178 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0055 | 0.1755 | 0.1741 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0178 | 1 | 1 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0055 | 0.1755 | 0.1741 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0055 | 0.1755 | 0.1755 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0178 | 1 | 1 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0055 | 0.1755 | 0.1741 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0055 | 0.1755 | 0.1741 |
| Brugia malayi | G protein-coupled receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0178 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0178 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0178 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0178 | 1 | 1 |
| Onchocerca volvulus | 0.0178 | 1 | 1 | |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0055 | 0.1755 | 0.1741 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0055 | 0.1755 | 0.1741 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0178 | 1 | 1 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0055 | 0.1755 | 0.1741 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0055 | 0.1755 | 0.1755 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0178 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0178 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0178 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0178 | 1 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0055 | 0.1755 | 0.1741 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0178 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0178 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0178 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0178 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0178 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0178 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 9 nM | Compound was evaluated for its binding affinity for the glycine binding site on N-methyl-D-aspartate glutamate receptor by using [3H]-MDL-105,519 binding assay | ChEMBL. | 10636248 |
| IC50 (binding) | = 9 nM | Compound was evaluated for its binding affinity for the glycine binding site on N-methyl-D-aspartate glutamate receptor by using [3H]-MDL-105,519 binding assay | ChEMBL. | 10636248 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
No external resources registered for this compound
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.