Detailed information for compound 288947
Basic information
Technical information
- Name: Unnamed compound
- MW: 303.81 | Formula: C15H14ClN3S
-
H donors: 1
H acceptors: 2
LogP: 3.96
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: Clc1ccc(cc1)Cc1csc(n1)CCc1nc[nH]c1
- InChi: 1S/C15H14ClN3S/c16-12-3-1-11(2-4-12)7-14-9-20-15(19-14)6-5-13-8-17-10-18-13/h1-4,8-10H,5-7H2,(H,17,18)
- InChiKey: BYPPCUMAIXZHRL-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Rattus norvegicus | Histamine H3 receptor | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | Histamine H3 receptor | 445 aa | 384 aa | 22.4 % |
| Echinococcus granulosus | biogenic amine 5HT receptor | Histamine H3 receptor | 445 aa | 405 aa | 25.2 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | CBP-B | 0.0082 | 0.1803 | 0.1803 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0314 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0314 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0314 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0314 | 1 | 1 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0071 | 0.1427 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0314 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0314 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0314 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0314 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0314 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0314 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0314 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0065 | 0.1207 | 0.1207 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0314 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0314 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0314 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0314 | 1 | 1 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0071 | 0.1427 | 0.1427 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0314 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0314 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0314 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0314 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0314 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0314 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0314 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0314 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0314 | 1 | 0.5 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0314 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0071 | 0.1427 | 0.028 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | CREB binding protein | 0.0118 | 0.3074 | 0.2148 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0314 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0314 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0314 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0314 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0314 | 1 | 0.5 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0031 | 0 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0314 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0314 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0314 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0062 | 0.111 | 0.111 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0314 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Schistosoma mansoni | CREB-binding protein 1 (SmCBP1) | 0.0118 | 0.3074 | 0.2148 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Brugia malayi | neuropeptide F receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0314 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0314 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0031 | 0 | 0.5 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0314 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0314 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0314 | 1 | 1 |
| Echinococcus granulosus | CREB binding protein | 0.0073 | 0.148 | 0.034 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0314 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0314 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Echinococcus granulosus | g-protein coupled receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0314 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0314 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0314 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0314 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0314 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0071 | 0.1427 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0314 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0071 | 0.1427 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Schistosoma mansoni | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0314 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0314 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0314 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | CREB binding protein | 0.0081 | 0.1767 | 0.0666 |
| Echinococcus multilocularis | somatostatin receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0314 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0314 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Brugia malayi | Dopamine receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0314 | 1 | 1 |
| Brugia malayi | Cytochrome P450 family protein | 0.0065 | 0.1207 | 0.1207 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0314 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0314 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0314 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0314 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | CREB-binding protein 2 | 0.0118 | 0.3074 | 0.2148 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0071 | 0.1427 | 0.028 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.0867 | 0.0867 |
| Brugia malayi | TAZ zinc finger family protein | 0.0118 | 0.3074 | 0.3074 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0314 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0071 | 0.1427 | 0.028 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0314 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0314 | 1 | 1 |
| Onchocerca volvulus | 0.0314 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0314 | 1 | 1 |
| Trypanosoma brucei | cytochrome P450, putative | 0.0031 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0314 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0071 | 0.1427 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0314 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0314 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0314 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0314 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0314 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Ki (binding) | = -6.7 | Binding affinity against H3 receptor in rat cerebral cortex membranes was evaluated using [3H]-N-methyl-histamine as radioligand | ChEMBL. | No reference |
| Log Ki (binding) | = 6.7 | Binding affinity against H3 receptor in rat cerebral cortex membranes was evaluated using [3H]-N-methyl-histamine as radioligand | ChEMBL. | No reference |
| pKB (functional) | Antagonistic activity at H2 receptor was assessed against histamine-induced tachycardia in guinea pig isolated atria | ChEMBL. | No reference | |
| pKB (functional) | Antagonistic activity against H1 receptor was determined in histamine induced contractions of guinea pig isolated whole ileum | ChEMBL. | No reference | |
| pKB (functional) | = 7.3 | Antagonistic activity at H3 receptor was assessed on guinea-pig longitudinal muscle strips subjected to electrical field stimulation | ChEMBL. | No reference |
| pKB (functional) | 0 | Antagonistic activity at H2 receptor was assessed against histamine-induced tachycardia in guinea pig isolated atria | ChEMBL. | No reference |
| pKB (functional) | 0 | Antagonistic activity against H1 receptor was determined in histamine induced contractions of guinea pig isolated whole ileum | ChEMBL. | No reference |
| pKB (functional) | = 7.3 | Antagonistic activity at H3 receptor was assessed on guinea-pig longitudinal muscle strips subjected to electrical field stimulation | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL169026
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.