Detailed information for compound 289924
Basic information
Technical information
- Name: Unnamed compound
- MW: 699.73 | Formula: C30H30FN7O8S2
-
H donors: 3
H acceptors: 7
LogP: 2.53
Rotable bonds: 12
Rule of 5 violations (Lipinski): 2 - SMILES: CO/N=C(/C(=O)N[C@@H]1C(=O)N2C1SCC(=C2C(=O)O)COC(=O)c1cn(CC)c2c(c1=O)cc(c(c2)N1CCCC1)F)\c1csc(n1)N
- InChi: 1S/C30H30FN7O8S2/c1-3-36-10-16(24(39)15-8-17(31)20(9-19(15)36)37-6-4-5-7-37)29(44)46-11-14-12-47-27-22(26(41)38(27)23(14)28(42)43)34-25(40)21(35-45-2)18-13-48-30(32)33-18/h8-10,13,22,27H,3-7,11-12H2,1-2H3,(H2,32,33)(H,34,40)(H,42,43)/b35-21+/t22-,27?/m1/s1
- InChiKey: VNXVQDLMDRUAHB-UTDQBPBXSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0071 | 0.1297 | 0.0252 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.0788 | 0.0788 |
| Schistosoma mansoni | histamine h1 receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0343 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0343 | 1 | 1 |
| Schistosoma mansoni | CREB-binding protein 2 | 0.0118 | 0.2793 | 0.1927 |
| Schistosoma mansoni | neuropeptide receptor | 0.0343 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0071 | 0.1297 | 0.0252 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Brugia malayi | TAZ zinc finger family protein | 0.0118 | 0.2793 | 0.2793 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Brugia malayi | AKH receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0343 | 1 | 1 |
| Trypanosoma brucei | cytochrome P450, putative | 0.0031 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0343 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0071 | 0.1297 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | CREB binding protein | 0.0081 | 0.1605 | 0.0597 |
| Echinococcus multilocularis | somatostatin receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0343 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Brugia malayi | Dopamine receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0343 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0343 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0343 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0343 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0343 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Brugia malayi | Cytochrome P450 family protein | 0.0065 | 0.1096 | 0.1096 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0343 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0343 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0343 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0071 | 0.1297 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0343 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0343 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0071 | 0.1297 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0343 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0343 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Brugia malayi | larval opioid receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0343 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0343 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0343 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0343 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0343 | 1 | 1 |
| Echinococcus granulosus | CREB binding protein | 0.0073 | 0.1344 | 0.0305 |
| Brugia malayi | Serotonin receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Echinococcus granulosus | g-protein coupled receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0343 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Brugia malayi | G protein-coupled receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0343 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0343 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0031 | 0 | 0.5 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0343 | 1 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.0343 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0343 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0343 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0062 | 0.1009 | 0.1009 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Schistosoma mansoni | CREB-binding protein 1 (SmCBP1) | 0.0118 | 0.2793 | 0.1927 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Brugia malayi | neuropeptide F receptor | 0.0343 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0343 | 1 | 1 |
| Trypanosoma cruzi | cytochrome P450, putative | 0.0031 | 0 | 0.5 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0343 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0343 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0343 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0343 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0343 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0343 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0343 | 1 | 0.5 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0071 | 0.1297 | 0.0252 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | CREB binding protein | 0.0118 | 0.2793 | 0.1927 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0343 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Echinococcus granulosus | g protein coupled receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0343 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0343 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0343 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0343 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0343 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0065 | 0.1096 | 0.1096 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0343 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0343 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0343 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0343 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0343 | 1 | 1 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0071 | 0.1297 | 0.1297 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0343 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0343 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | CBP-B | 0.0082 | 0.1638 | 0.1638 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0343 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0343 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0343 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0343 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0343 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0343 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0343 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0343 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0343 | 1 | 1 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0071 | 0.1297 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0343 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0343 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0343 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0343 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0343 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0343 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0343 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0343 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0343 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Inhibition (binding) | = 0.1 % | Evaluated for concentration required for 90 % inhibition of [14C]- penicillin G binding to PBP's of E. coli UB 1005 as penicillin-binding protein 3 60 kDa | ChEMBL. | 2153215 |
| Inhibition (binding) | = 2 % | Evaluated for concentration required for 90 % inhibition of [14C]- penicillin G binding to PBP's of E. coli UB 1005 as penicillin-binding protein 1a 90 kDa | ChEMBL. | 2153215 |
| Inhibition (binding) | = 2 % | Evaluated for concentration required for 90 % inhibition of [14C]- penicillin G binding to PBP's of E. coli UB 1005 as penicillin-binding protein 1a 90 kDa | ChEMBL. | 2153215 |
| Inhibition (binding) | = 10 % | Evaluated for concentration required for 90 % inhibition of [14C]- penicillin G binding to PBP's of E. coli UB 1005 as penicillin-binding protein 1b 90 kDa | ChEMBL. | 2153215 |
| Inhibition (binding) | = 10 % | Evaluated for concentration required for 90 % inhibition of [14C]- penicillin G binding to PBP's of E. coli UB 1005 as penicillin-binding protein 4 49 kDa | ChEMBL. | 2153215 |
| Inhibition (binding) | = 10 % | Evaluated for concentration required for 90 % inhibition of [14C]- penicillin G binding to PBP's of E. coli UB 1005 as penicillin-binding protein 1b 90 kDa | ChEMBL. | 2153215 |
| Inhibition (binding) | > 100 % | Evaluated for concentration required for 90 % inhibition of [14C]- penicillin G binding to PBP's of E. coli UB 1005 as penicillin-binding protein 2 66 kDa | ChEMBL. | 2153215 |
| Inhibition (binding) | > 100 % | Evaluated for concentration required for 90 % inhibition of [14C]- penicillin G binding to PBP's of E. coli UB 1005 as Penicillin-binding protein 5/6 40 kDa | ChEMBL. | 2153215 |
| Inhibition (binding) | > 100 % | Evaluated for concentration required for 90 % inhibition of [14C]- penicillin G binding to PBP's of E. coli UB 1005 as penicillin-binding protein 2 66 kDa | ChEMBL. | 2153215 |
| MIC (functional) | < 0.008 ug ml-1 | Minimum inhibitory concentration against Streptococcus pneumoniae 6301 | ChEMBL. | 2153215 |
| MIC (functional) | = 0.25 ug ml-1 | Minimum inhibitory concentration against Staphylococcus aureus ATCC 29213 (inducible, low level beta-lactamase producer) | ChEMBL. | 2153215 |
| MIC (functional) | = 0.25 ug ml-1 | Minimum inhibitory concentration against Staphylococcus aureus 1059B (inducible, high level beta-lactamase producer) | ChEMBL. | 2153215 |
| MIC (functional) | = 0.5 ug ml-1 | Minimum inhibitory concentration against Escherichia coli TEM-1 (TEM-1 (class IIIa) beta-lactamase producer) | ChEMBL. | 2153215 |
| MIC (functional) | = 0.5 ug ml-1 | Minimum inhibitory concentration against Proteus mirabilis 90 | ChEMBL. | 2153215 |
| MIC (functional) | = 0.5 ug ml-1 | Minimum inhibitory concentration against Staphylococcus aureus 95 (Methicillin-resistant, high-level beta-lactamase producer) | ChEMBL. | 2153215 |
| MIC (functional) | = 0.5 ug ml-1 | Evaluated for the minimum inhibitory concentration against E. coli UB 1005 | ChEMBL. | 2153215 |
| MIC (functional) | = 0.5 ug ml-1 | Minimum inhibitory concentration against Escherichia coli TEM-1 (TEM-1 (class IIIa) beta-lactamase producer) | ChEMBL. | 2153215 |
| MIC (functional) | = 0.5 ug ml-1 | Evaluated for the minimum inhibitory concentration against E. coli UB 1005 | ChEMBL. | 2153215 |
| MIC (functional) | = 1 ug ml-1 | Minimum inhibitory concentration against Streptococcus pyogenes 4 | ChEMBL. | 2153215 |
| MIC (functional) | = 2 ug ml-1 | In vitro antibacterial activity was determined against Escherichia coli ATCC 25922 | ChEMBL. | 2153215 |
| MIC (functional) | = 2 ug ml-1 | Minimum inhibitory concentration against Enterobacter cloacae P99 (Class Ia beta-lactamase overproducer) | ChEMBL. | 2153215 |
| MIC (functional) | = 2 ug ml-1 | Evaluated for the minimum inhibitory concentration against Serratia marcescens 1071 | ChEMBL. | 2153215 |
| MIC (functional) | = 2 ug ml-1 | In vitro antibacterial activity was determined against Escherichia coli ATCC 25922 | ChEMBL. | 2153215 |
| MIC (functional) | = 4 ug ml-1 | Evaluated for the minimum inhibitory concentration against Proteus vulgaris 1028 BC ( Class Ic beta-lactamase overproducer) | ChEMBL. | 2153215 |
| MIC (functional) | = 16 ug ml-1 | Evaluated for the minimum inhibitory concentration against Citrobacter freundii BS-16. | ChEMBL. | 2153215 |
| MIC (functional) | = 32 ug ml-1 | Evaluated for the minimum inhibitory concentration against Pseudomonas aeruginosa 18S/H ( Class Id beta-lactamase overproducer) | ChEMBL. | 2153215 |
| MIC (functional) | = 32 ug ml-1 | Evaluated for the minimum inhibitory concentration against Enterococcus faecalis ATCC 29212 | ChEMBL. | 2153215 |
| MIC (functional) | > 128 ug ml-1 | Minimum inhibitory concentration against Pseudomonas aeruginosa ATCC 27853 | ChEMBL. | 2153215 |
| Morphology (functional) | 0 | Evaluated for morphology; F represents filaments | ChEMBL. | 2153215 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL169395
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.