Detailed information for compound 429759
Basic information
Technical information
- Name: Unnamed compound
- MW: 643.708 | Formula: C34H38FN7O5
-
H donors: 1
H acceptors: 3
LogP: 3.79
Rotable bonds: 11
Rule of 5 violations (Lipinski): 2 - SMILES: COc1cc(OC)ccc1N(C(c1nc2ccccc2c(=O)n1N1CCN(CC1)C(=O)N1CCCC1)C)C(=O)Nc1ccc(cc1)F
- InChi: 1S/C34H38FN7O5/c1-23(41(29-15-14-26(46-2)22-30(29)47-3)33(44)36-25-12-10-24(35)11-13-25)31-37-28-9-5-4-8-27(28)32(43)42(31)40-20-18-39(19-21-40)34(45)38-16-6-7-17-38/h4-5,8-15,22-23H,6-7,16-21H2,1-3H3,(H,36,44)
- InChiKey: LEUMQVNIJMAQGR-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0082 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0082 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0082 | 1 | 1 |
| Trypanosoma cruzi | cyclin 6, putative | 0.0014 | 0.0486 | 0.5 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0082 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0082 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0082 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0082 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0045 | 0.4706 | 0.4436 |
| Echinococcus granulosus | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0082 | 1 | 1 |
| Trichomonas vaginalis | ras-dva small GTPase, putative | 0.0045 | 0.4706 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Trypanosoma cruzi | CYC2-like cyclin, putative | 0.0014 | 0.0486 | 0.5 |
| Trypanosoma cruzi | cyclin, putative | 0.0014 | 0.0486 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Giardia lamblia | G2/mitotic-specific cyclin B | 0.0014 | 0.0486 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Giardia lamblia | Cyclin A | 0.0014 | 0.0486 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | Ras protein let-60 | 0.0045 | 0.4706 | 0.4436 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Echinococcus multilocularis | allatostatin A receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Echinococcus granulosus | serotonin receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0082 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0082 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0082 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0082 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0082 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0082 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0014 | 0.0486 | 0.5 |
| Entamoeba histolytica | ras-1, putative | 0.0045 | 0.4706 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0082 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0082 | 1 | 1 |
| Trypanosoma cruzi | cyclin, putative | 0.0014 | 0.0486 | 0.5 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0082 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0082 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Brugia malayi | Ras protein let-60 | 0.0045 | 0.4706 | 0.4436 |
| Trichomonas vaginalis | rap1 and, putative | 0.0045 | 0.4706 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0082 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0082 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0082 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0082 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0082 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0082 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0082 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0082 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0082 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Leishmania major | CYC2-like cyclin, putative,cyclin 6, putative | 0.0014 | 0.0486 | 0.5 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Leishmania major | cyclin | 0.0014 | 0.0486 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Brugia malayi | Serotonin receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0082 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0082 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0082 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0082 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0082 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | ras gtpase | 0.0045 | 0.4706 | 0.4436 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0082 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0082 | 1 | 1 |
| Brugia malayi | Ras-related protein R-Ras2 | 0.0045 | 0.4706 | 0.4436 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0082 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0082 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0082 | 1 | 1 |
| Trichomonas vaginalis | ral, putative | 0.0045 | 0.4706 | 1 |
| Entamoeba histolytica | Ras family GTPase | 0.0045 | 0.4706 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0082 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0082 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0082 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0082 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Brugia malayi | larval opioid receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0082 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Plasmodium falciparum | cyclin | 0.0014 | 0.0486 | 0.5 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0082 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | ras gtpase | 0.0045 | 0.4706 | 0.4436 |
| Brugia malayi | ORL1-like opioid receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0082 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0082 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0082 | 1 | 1 |
| Trypanosoma brucei | mitotic cyclin 6 | 0.0014 | 0.0486 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0011 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0082 | 1 | 1 |
| Entamoeba histolytica | Ras family GTPase | 0.0045 | 0.4706 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 1 | 1 |
| Trichomonas vaginalis | dexras1, putative | 0.0045 | 0.4706 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0082 | 1 | 1 |
| Onchocerca volvulus | 0.0082 | 1 | 1 | |
| Brugia malayi | Serotonin receptor | 0.0082 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0082 | 1 | 1 |
| Trichomonas vaginalis | GTP-binding protein rit, putative | 0.0045 | 0.4706 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0082 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0082 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0082 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0082 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0082 | 1 | 1 |
| Trichomonas vaginalis | rheb, putative | 0.0045 | 0.4706 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (ADMET) | 0 | Protein binding in Sprague-Dawley rat serum | ChEMBL. | 17350259 |
| Activity (functional) | < 0.03 ug ml-1 | In vitro potentiation of fluconazole antifungal activity in Candida glabrata YEM19 assessed as 8 fold reduction in fluconazole MIC | ChEMBL. | 17350259 |
| Activity (functional) | = 0.0625 ug ml-1 | In vitro potentiation of fluconazole antifungal activity in Candida albicans YEM15 assessed as 8 fold reduction in fluconazole MIC | ChEMBL. | 17350259 |
| Activity (functional) | = 0.0625 ug ml-1 | In vitro potentiation of fluconazole antifungal activity in Candida albicans YEM15 assessed as 8 fold reduction in fluconazole MIC | ChEMBL. | 17350259 |
| Stabilty (ADMET) | = 0 % | Stability in Sprague-Dawley rat hepatocyte after 24 hrs | ChEMBL. | 17350259 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL388514
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.