Detailed information for compound 508815
Basic information
Technical information
- Name: Unnamed compound
- MW: 335.403 | Formula: C19H21N5O
-
H donors: 1
H acceptors: 4
LogP: 3.26
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: CC(Cn1nnnc1CNC(=O)c1ccc(cc1)c1ccccc1)C
- InChi: 1S/C19H21N5O/c1-14(2)13-24-18(21-22-23-24)12-20-19(25)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-11,14H,12-13H2,1-2H3,(H,20,25)
- InChiKey: LRNPKCMRIWOTBE-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | cannabinoid receptor 1 (brain) | Starlite/ChEMBL | References |
| Homo sapiens | cannabinoid receptor 2 (macrophage) | Starlite/ChEMBL | References |
| Homo sapiens | transient receptor potential cation channel, subfamily V, member 1 | Starlite/ChEMBL | References |
| Homo sapiens | diacylglycerol lipase, alpha | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | g protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | serotonin receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0006 | 0.0109 | 1 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | sulfakinin receptor protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | G protein-coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Trichomonas vaginalis | lipase containing protein, putative | 0.0173 | 1 | 0.5 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | serotonin receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | sn1 specific diacylglycerol lipase beta | 0.0173 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0006 | 0.0109 | 0.0109 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0173 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0006 | 0.0109 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | g protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | Serotonin receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | larval opioid receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | neuropeptide receptor | 0.0006 | 0.0109 | 1 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | amine GPCR | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | biogenic amine receptor | 0.0006 | 0.0109 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | lipase | 0.0173 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0006 | 0.0109 | 0.0109 |
| Trichomonas vaginalis | lipase containing protein, putative | 0.0173 | 1 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | Melatonin receptor type 1A | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0006 | 0.0109 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | myosin xvIII | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0006 | 0.0109 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | opsin-like receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | Serotonin receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | biogenic amine receptor | 0.0006 | 0.0109 | 1 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | serotonin receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0006 | 0.0109 | 0.0109 |
| Trypanosoma brucei | lipase domain protein, putative | 0.0173 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0006 | 0.0109 | 1 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0006 | 0.0109 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | hypothetical protein | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | hypothetical protein | 0.0006 | 0.0109 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | AKH receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | hypothetical protein | 0.0006 | 0.0109 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | amine GPCR | 0.0006 | 0.0109 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0173 | 1 | 0.5 |
| Brugia malayi | ORL1-like opioid receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | amine GPCR | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | neuropeptide receptor | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0006 | 0.0109 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | putative neuropeptide receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | neuropeptide F receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | opsin-like receptor | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | hypothetical protein | 0.0006 | 0.0109 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0006 | 0.0109 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | somatostatin receptor | 0.0006 | 0.0109 | 0.0109 |
| Onchocerca volvulus | 0.0173 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | sex peptide receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0006 | 0.0109 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | allatostatin A receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | Dopamine receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | neuropeptide receptor | 0.0006 | 0.0109 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0006 | 0.0109 | 0.0109 |
| Leishmania major | hypothetical protein, conserved | 0.0173 | 1 | 0.5 |
| Echinococcus granulosus | sn1 specific diacylglycerol lipase beta | 0.0173 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0006 | 0.0109 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0006 | 0.0109 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0006 | 0.0109 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | opsin-like receptor | 0.0006 | 0.0109 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0006 | 0.0109 | 1 |
| Brugia malayi | RE15519p | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | adenoreceptor | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0006 | 0.0109 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | amine GPCR | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | GnHR receptor homolog | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0006 | 0.0109 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | histamine h1 receptor | 0.0006 | 0.0109 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | somatostatin receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | neuropeptide receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Trypanosoma brucei | lipase domain protein, putative | 0.0173 | 1 | 0.5 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0006 | 0.0109 | 0.0109 |
| Brugia malayi | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Loa Loa (eye worm) | hypothetical protein | 0.0006 | 0.0109 | 0.0109 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0006 | 0.0109 | 0.0109 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0006 | 0.0109 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 15 uM | Agonist activity at human TRPV1 channel expressed in human HEK293 cells assessed as elevation in intracellular calcium flux | ChEMBL. | 18424134 |
| EC50 (functional) | = 15 uM | Agonist activity at human TRPV1 channel expressed in human HEK293 cells assessed as elevation in intracellular calcium flux | ChEMBL. | 18424134 |
| EC50 (functional) | > 100 uM | Agonist activity at rat TRPA1 channel expressed in human HEK293 cells assessed as elevation in intracellular calcium flux | ChEMBL. | 18424134 |
| EC50 (functional) | > 100 uM | Agonist activity at rat TRPA1 channel expressed in human HEK293 cells assessed as elevation in intracellular calcium flux | ChEMBL. | 18424134 |
| Efficacy (functional) | = 9.1 % | Agonist activity at human TRPV1 channel expressed in human HEK293 cells assessed as elevation in intracellular calcium flux at 10 uM relative to ionomycin | ChEMBL. | 18424134 |
| Efficacy (functional) | = 9.1 % | Agonist activity at human TRPV1 channel expressed in human HEK293 cells assessed as elevation in intracellular calcium flux at 10 uM relative to ionomycin | ChEMBL. | 18424134 |
| Efficacy (functional) | = 26.1 % | Agonist activity at rat TRPA1 channel expressed in human HEK293 cells assessed as elevation in intracellular calcium flux at 100 uM relative to mustard oil | ChEMBL. | 18424134 |
| Efficacy (functional) | = 26.1 % | Agonist activity at rat TRPA1 channel expressed in human HEK293 cells assessed as elevation in intracellular calcium flux at 100 uM relative to mustard oil | ChEMBL. | 18424134 |
| IC50 (binding) | > 10 uM | Inhibition of human MAGL mediated [14C]2-AG hydrolysis in COS cell | ChEMBL. | 18424134 |
| IC50 (binding) | > 10 uM | Inhibition of human DAGLalpha mediated sn-1-[14C]oleoyl-2-arachidonoyl-glycerol hydrolysis to 2-AG in COS cell | ChEMBL. | 18424134 |
| IC50 (binding) | > 10 uM | Inhibition of human DAGLalpha mediated sn-1-[14C]oleoyl-2-arachidonoyl-glycerol hydrolysis to 2-AG in COS cell | ChEMBL. | 18424134 |
| IC50 (functional) | > 25 uM | Inhibition of [14C]anandamide uptake in rat RBL-2H3 | ChEMBL. | 18424134 |
| IC50 (binding) | > 50 uM | Inhibition of rat brain FAAH mediated [14C]anandamide hydrolysis | ChEMBL. | 18424134 |
| IC50 (binding) | > 50 uM | Inhibition of rat brain FAAH mediated [14C]anandamide hydrolysis | ChEMBL. | 18424134 |
| Ki (binding) | > 10 uM | Binding affinity to human CB1 receptor expressed in COS cells | ChEMBL. | 18424134 |
| Ki (binding) | > 10 uM | Binding affinity to human CB2 receptor expressed in COS cells | ChEMBL. | 18424134 |
| Ki (binding) | > 10 uM | Binding affinity to human CB1 receptor expressed in COS cells | ChEMBL. | 18424134 |
| Ki (binding) | > 10 uM | Binding affinity to human CB2 receptor expressed in COS cells | ChEMBL. | 18424134 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL257570
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.