Detailed information for compound 808735
Basic information
Technical information
- TDR Targets ID: 808735
- Name: (E)-3-(4-bromophenyl)-N-(1,5-dimethyl-3-oxo-2 -phenylpyrazol-4-yl)prop-2-enamide
- MW: 412.28 | Formula: C20H18BrN3O2
-
H donors: 1
H acceptors: 2
LogP: 4.15
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(Nc1c(C)n(n(c1=O)c1ccccc1)C)C=Cc1ccc(cc1)Br
- InChi: 1S/C20H18BrN3O2/c1-14-19(20(26)24(23(14)2)17-6-4-3-5-7-17)22-18(25)13-10-15-8-11-16(21)12-9-15/h3-13H,1-2H3,(H,22,25)/b13-10+
- InChiKey: XVCPEPODYMYHGI-JLHYYAGUSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 3-(4-bromophenyl)-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)prop-2-enamide
- (E)-3-(4-bromophenyl)-N-(1,5-dimethyl-3-oxo-2-phenyl-pyrazol-4-yl)prop-2-enamide
- 3-(4-bromophenyl)-N-(1,5-dimethyl-3-oxo-2-phenyl-pyrazol-4-yl)prop-2-enamide
- (E)-3-(4-bromophenyl)-N-(1,5-dimethyl-3-oxo-2-phenyl-4-pyrazolyl)prop-2-enamide
- 3-(4-bromophenyl)-N-(1,5-dimethyl-3-oxo-2-phenyl-4-pyrazolyl)prop-2-enamide
- (E)-3-(4-bromophenyl)-N-(3-keto-1,5-dimethyl-2-phenyl-pyrazol-4-yl)acrylamide
- 3-(4-bromophenyl)-N-(3-keto-1,5-dimethyl-2-phenyl-pyrazol-4-yl)acrylamide
- CBMicro_011825
- BIM-0011695.P001
- ZINC01214965
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Serotonin receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Echinococcus granulosus | allatostatin A receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0136 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0136 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0136 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | NAALADASE L peptidase (M28 family) | 0.0064 | 0.3782 | 0.2582 |
| Echinococcus granulosus | neuropeptide receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0136 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0136 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0136 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0136 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | n acetylated alpha linked acidic dipeptidase 2 | 0.0098 | 0.6716 | 0.4462 |
| Brugia malayi | G-protein coupled receptor | 0.0136 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0136 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0136 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0136 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0136 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Brugia malayi | Metabotropic glutamate receptor precursor. | 0.0081 | 0.5208 | 0.5208 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0136 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0136 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0136 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0136 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0136 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0136 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0136 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0136 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0136 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0136 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0136 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.01 | 0.6924 | 0.6924 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Schistosoma mansoni | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0136 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0136 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0136 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0136 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Echinococcus multilocularis | serotonin receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0136 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0136 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | glutamate receptor | 0.0032 | 0.096 | 0.096 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | metabotropic glutamate receptor 5 | 0.0099 | 0.6826 | 0.4647 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0136 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0136 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0136 | 1 | 0.5 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0136 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0136 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | metabotropic glutamate receptor | 0.0067 | 0.4071 | 0.2927 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0136 | 1 | 1 |
| Brugia malayi | metabotropic glutamate receptor subtype 5a (mGluR5a), putative | 0.0073 | 0.4549 | 0.4549 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0136 | 1 | 0.5 |
| Schistosoma mansoni | neuropeptide receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Schistosoma mansoni | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0136 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0136 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0091 | 0.6149 | 0.6149 |
| Schistosoma mansoni | neuropeptide receptor | 0.0136 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0136 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0136 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0136 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0136 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Schistosoma mansoni | adenoreceptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0136 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | metabotropic glutamate receptor 5 | 0.0099 | 0.6826 | 0.4647 |
| Echinococcus granulosus | serotonin receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0136 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 0.399 | 0.399 |
| Loa Loa (eye worm) | hypothetical protein | 0.0099 | 0.6826 | 0.6826 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0136 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | glutamate receptor | 0.0081 | 0.5208 | 0.5208 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0136 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Brugia malayi | metabotropic glutamate receptor type 2 | 0.0039 | 0.1618 | 0.1618 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0136 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | metabotropic glutamate receptor 2 3 (mglur group 2) | 0.0092 | 0.6168 | 0.5428 |
| Echinococcus multilocularis | somatostatin receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0136 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0136 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0136 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0136 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0136 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0136 | 1 | 1 |
| Onchocerca volvulus | 0.0136 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0136 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0136 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0136 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0136 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0136 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.