Detailed information for compound 835814
Basic information
Technical information
- TDR Targets ID: 835814
- Name: 2-(5-chlorothiophen-2-yl)-N-(1,3-thiazol-2-yl )quinoline-4-carboxamide
- MW: 371.864 | Formula: C17H10ClN3OS2
-
H donors: 1
H acceptors: 3
LogP: 4.73
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: Clc1ccc(s1)c1nc2ccccc2c(c1)C(=O)Nc1nccs1
- InChi: 1S/C17H10ClN3OS2/c18-15-6-5-14(24-15)13-9-11(10-3-1-2-4-12(10)20-13)16(22)21-17-19-7-8-23-17/h1-9H,(H,19,21,22)
- InChiKey: GESQSTWHSDSQPL-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-(5-chloro-2-thienyl)-N-thiazol-2-yl-quinoline-4-carboxamide
- 2-(5-chloro-2-thienyl)-N-(2-thiazolyl)-4-quinolinecarboxamide
- 2-(5-chloro-2-thienyl)-N-thiazol-2-yl-cinchoninamide
- CBMicro_019108
- ZINC02736473
- BIM-0019171.P001
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | g-protein coupled receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Brugia malayi | Serotonin receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Giardia lamblia | GTOR | 0.002 | 0.3978 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | serine protein kinase ATM | 0.0027 | 0.7976 | 0.6639 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | phosphatidylinositol kinase related protein, putative | 0.002 | 0.3998 | 0.0052 |
| Toxoplasma gondii | FATC domain-containing protein | 0.0027 | 0.7976 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Leishmania major | phosphatidylinositol kinase related protein, putative | 0.002 | 0.3998 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0031 | 1 | 1 |
| Trypanosoma brucei | phosphatidylinositol kinase related protein, putative | 0.0027 | 0.7976 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0031 | 1 | 1 |
| Trypanosoma brucei | phosphatidylinositol 3-kinase, putative | 0.002 | 0.3978 | 0.4987 |
| Echinococcus granulosus | serine protein kinase ATM | 0.0027 | 0.7976 | 0.6639 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Trypanosoma brucei | phosphatidylinositol 4-kinase, putative | 0.002 | 0.3978 | 0.4987 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Brugia malayi | AKH receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0031 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0031 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0031 | 1 | 0.5 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | phosphatidylinositol kinase related protein, putative | 0.0027 | 0.7976 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0031 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Brugia malayi | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trypanosoma cruzi | phosphatidylinositol kinase related protein, putative | 0.0023 | 0.5917 | 0.4849 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Toxoplasma gondii | target of rapamycin (TOR), putative | 0.002 | 0.3978 | 0.4987 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.0027 | 0.7976 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0031 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Trypanosoma brucei | phosphatidylinositol 3-related kinase, putative | 0.002 | 0.3978 | 0.4987 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | sex peptide receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | phosphatidylinositol 3 | 0.002 | 0.3978 | 0.3978 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Brugia malayi | RE15519p | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0031 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0031 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0031 | 1 | 1 |
| Trypanosoma brucei | target of rapamycin kinase 3, putative | 0.002 | 0.3978 | 0.4987 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0031 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0031 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | phosphatidylinositol 3 | 0.002 | 0.3978 | 0.3978 |
| Brugia malayi | G protein-coupled receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0031 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | Phosphatidylinositol 3- and 4-kinase family protein | 0.0027 | 0.7976 | 0.6639 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.5917 | 0.5917 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | ataxia telangiectasia mutated (atm) | 0.0027 | 0.7976 | 0.6639 |
| Brugia malayi | sulfakinin receptor protein | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0031 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Onchocerca volvulus | 0.0031 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0031 | 1 | 1 |
| Trypanosoma brucei | Phosphatidylinositol 3-kinase tor1 | 0.002 | 0.3978 | 0.4987 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0031 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0027 | 0.7976 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Schistosoma mansoni | biogenic amine receptor | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0031 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0031 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0031 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0031 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0031 | 1 | 1 |
| Trichomonas vaginalis | PIKK family atypical protein kinase | 0.002 | 0.3978 | 0.4987 |
| Brugia malayi | hypothetical protein | 0.0031 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0031 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0031 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0031 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.