Detailed information for compound 895043
Basic information
Technical information
- Name: Unnamed compound
- MW: 462.465 | Formula: C23H25F3N4O3
-
H donors: 2
H acceptors: 4
LogP: 3.74
Rotable bonds: 9
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(c1cn(cc(c1=O)C(=O)NC1CC1)C1CCCCC1)NC(C(F)(F)F)c1cccnc1
- InChi: 1S/C23H25F3N4O3/c24-23(25,26)20(14-5-4-10-27-11-14)29-22(33)18-13-30(16-6-2-1-3-7-16)12-17(19(18)31)21(32)28-15-8-9-15/h4-5,10-13,15-16,20H,1-3,6-9H2,(H,28,32)(H,29,33)
- InChiKey: ATJHLNRVDMVKGF-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Plasmodium vivax | SWIB/MDM2 domain-containing protein, putative | 0.0021 | 1 | 1 |
| Entamoeba histolytica | ATP-binding cassette protein, putative | 0.0014 | 0.3035 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0021 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.002 | 0.9379 | 0.9108 |
| Schistosoma mansoni | hypothetical protein | 0.0021 | 1 | 1 |
| Brugia malayi | SWIB/MDM2 domain containing protein | 0.0021 | 1 | 1 |
| Plasmodium falciparum | SWIB/MDM2 domain-containing protein | 0.0021 | 1 | 1 |
| Echinococcus granulosus | SWI:SNF matrix associated | 0.0021 | 1 | 1 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0021 | 1 | 1 |
| Echinococcus multilocularis | SWI:SNF matrix associated | 0.0021 | 1 | 1 |
| Toxoplasma gondii | SWIB/MDM2 domain-containing protein | 0.0021 | 1 | 1 |
| Onchocerca volvulus | 0.0021 | 1 | 1 | |
| Entamoeba histolytica | ATP-binding cassette protein, putative | 0.0014 | 0.3035 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.002 | 0.9379 | 1 |
| Entamoeba histolytica | ABC transporter, putative | 0.0014 | 0.3035 | 0.5 |
| Echinococcus granulosus | multidrug resistance associated protein 7 | 0.0014 | 0.3035 | 0.3035 |
| Brugia malayi | brahma associated protein 60 kDa | 0.0021 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.002 | 0.9379 | 1 |
| Loa Loa (eye worm) | ABC transporter transmembrane region family protein | 0.0014 | 0.3035 | 0.296 |
| Toxoplasma gondii | DNA topoisomerase domain-containing protein | 0.0021 | 1 | 1 |
| Trypanosoma brucei | multidrug resistance-associated protein, putative | 0.0014 | 0.3035 | 0.5 |
| Giardia lamblia | Multidrug resistance-associated protein 1 | 0.0014 | 0.3035 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0014 | 0.3035 | 0.296 |
| Echinococcus multilocularis | Upstream activation factor subunit UAF30 | 0.0021 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0021 | 1 | 1 |
| Schistosoma mansoni | brg-1 associated factor | 0.0021 | 1 | 1 |
| Entamoeba histolytica | ATP-binding cassette protein, putative | 0.0014 | 0.3035 | 0.5 |
| Trypanosoma brucei | multidrug resistance-associated protein, putative | 0.0014 | 0.3035 | 0.5 |
| Giardia lamblia | Multidrug resistance-associated protein 1 | 0.0014 | 0.3035 | 1 |
| Chlamydia trachomatis | DNA topoisomerase I | 0.0021 | 1 | 0.5 |
| Plasmodium falciparum | SWIB/MDM2 domain-containing protein | 0.0021 | 1 | 1 |
| Echinococcus multilocularis | multidrug resistance associated protein 7 | 0.0014 | 0.3035 | 0.3035 |
| Loa Loa (eye worm) | TK/ROR protein kinase | 0.002 | 0.9379 | 0.9372 |
| Schistosoma mansoni | hypothetical protein | 0.0021 | 1 | 1 |
| Loa Loa (eye worm) | SWIB/MDM2 domain-containing protein | 0.0021 | 1 | 1 |
| Echinococcus multilocularis | SWI:SNF matrix associated | 0.0021 | 1 | 1 |
| Giardia lamblia | MRP-like ABC transporter | 0.0014 | 0.3035 | 1 |
| Trypanosoma cruzi | multidrug resistance protein E, putative | 0.0014 | 0.3035 | 0.3236 |
| Echinococcus granulosus | multidrug resistance associated protein 1 | 0.0014 | 0.3035 | 0.3035 |
| Loa Loa (eye worm) | hypothetical protein | 0.0014 | 0.2929 | 0.2853 |
| Echinococcus multilocularis | SWI:SNF matrix associated | 0.0021 | 1 | 1 |
| Echinococcus granulosus | tissue type plasminogen activator | 0.002 | 0.9379 | 0.9379 |
| Giardia lamblia | ABC transporter, putative | 0.0014 | 0.3035 | 1 |
| Trypanosoma brucei | multidrug resistance protein E | 0.0014 | 0.3035 | 0.5 |
| Trypanosoma cruzi | multidrug resistance-associated protein, putative | 0.0014 | 0.3035 | 0.3236 |
| Brugia malayi | Kringle domain containing protein | 0.002 | 0.9379 | 0.9108 |
| Echinococcus granulosus | Upstream activation factor subunit UAF30 | 0.0021 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.002 | 0.9379 | 0.9108 |
| Loa Loa (eye worm) | hypothetical protein | 0.0014 | 0.3035 | 0.296 |
| Entamoeba histolytica | hypothetical protein | 0.0014 | 0.3035 | 0.5 |
| Trypanosoma cruzi | multidrug resistance-associated protein, putative | 0.0014 | 0.3035 | 0.3236 |
| Trypanosoma brucei | p-glycoprotein | 0.0014 | 0.3035 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.002 | 0.9379 | 0.9372 |
| Echinococcus multilocularis | multidrug resistance associated protein 1 | 0.0014 | 0.3035 | 0.3035 |
| Chlamydia trachomatis | SWIB complex protein | 0.0021 | 1 | 0.5 |
| Entamoeba histolytica | multidrug resistance protein, putative | 0.0014 | 0.3035 | 0.5 |
| Toxoplasma gondii | kringle domain-containing protein | 0.002 | 0.9379 | 0.9108 |
| Echinococcus multilocularis | tissue type plasminogen activator | 0.002 | 0.9379 | 0.9379 |
| Loa Loa (eye worm) | brahma associated protein | 0.0021 | 1 | 1 |
| Entamoeba histolytica | ATP-binding cassette protein, putative | 0.0014 | 0.3035 | 0.5 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.