Detailed information for compound 1735836
Basic information
Technical information
- Name: Unnamed compound
- MW: 432.436 | Formula: C23H23F3N2O3
-
H donors: 1
H acceptors: 2
LogP: 5.02
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: CCOC(=O)C1=C(C)N/C(=C/c2cc(n(c2C)Cc2ccc(cc2)C(F)(F)F)C)/C1=O
- InChi: 1S/C23H23F3N2O3/c1-5-31-22(30)20-14(3)27-19(21(20)29)11-17-10-13(2)28(15(17)4)12-16-6-8-18(9-7-16)23(24,25)26/h6-11,27H,5,12H2,1-4H3/b19-11+
- InChiKey: DNMUNAVAHAXIHZ-YBFXNURJSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | serine/threonine protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | protein KINase family member (kin 25) | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine-protein kinase fps85d | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | epidermal growth factor receptor | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | melanoma receptor tyrosine protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase with ankyrin repeats, putative | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Brugia malayi | SH2 domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TKL/MLK/TAK1 protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | dual specificity testis specific protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FAK protein kinase | 0.006 | 1 | 1 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0021 | 0 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase lyn tyrosine protein kinase blk | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fps85D | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Btk29A | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | Probable tyrosine-protein kinase kin-31 | 0.006 | 1 | 1 |
| Brugia malayi | Tyrosine-protein kinase PR2 | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.006 | 1 | 1 |
| Echinococcus granulosus | activin receptor type | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Brugia malayi | Guanylyl cyclase protein 23 | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine kinase | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Echinococcus granulosus | kinase suppressor of Ras 1 | 0.006 | 1 | 1 |
| Echinococcus granulosus | 3'partial|tyrosine protein kinase Fgr | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | ankyrin repeat protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase ABL1 | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | protein kinase domain-containing protein | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | insulin receptor | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Trichomonas vaginalis | protein tyrosine kinase, putative | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Src42A | 0.006 | 1 | 1 |
| Leishmania major | protein kinase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | retinal guanylyl cyclase 2 | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | ephrin receptor | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Blk | 0.006 | 1 | 1 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Src64B | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase lyn lyn a protein tyrosine kinase lymphocyte specific protein tyrosine kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Echinococcus granulosus | fibroblast growth factor receptor 4 | 0.006 | 1 | 1 |
| Toxoplasma gondii | Tyrosine kinase-like (TKL) protein | 0.006 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Echinococcus granulosus | receptor type guanylyl cyclase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | atrial natriuretic peptide receptor 1 | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | cysteine surface protein, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TKL/MLK/ILK protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine protein kinase fes (fps) (ptk group IV) | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Plasmodium falciparum | tyrosine kinase-like protein | 0.006 | 1 | 0.5 |
| Echinococcus granulosus | tyrosine protein kinase csk | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase pr2 | 0.006 | 1 | 1 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0021 | 0 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | protein kinase atn1, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/INSR protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein tyrosine kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TKL/MLK/HH498 protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase ABL1 | 0.006 | 1 | 1 |
| Echinococcus multilocularis | integrin linked protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TKL/RAF/RAF protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Schistosoma mansoni | proto-oncogene tyrosine-protein kinase src | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/ROR protein kinase | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Echinococcus multilocularis | tyrosine protein kinase transmembrane receptor | 0.006 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Trypanosoma cruzi | protein kinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Brugia malayi | Tyrosine-protein kinase F09A5.2 in chromosome X, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Echinococcus granulosus | 3'partial|retinal guanylyl cyclase 2 | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | ephrin type A receptor 4 A | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Srms | 0.006 | 1 | 1 |
| Brugia malayi | SH2 domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | retinal guanylyl cyclase 2 | 0.006 | 1 | 1 |
| Echinococcus granulosus | retinal guanylyl cyclase 2 | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | receptor protein kinase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | heat shock protein 70 | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Trypanosoma brucei | protein kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | SRC-1 | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | insulin receptor | 0.006 | 1 | 1 |
| Echinococcus multilocularis | transfer RNA-Thr | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/EGFR protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | kinase suppressor of Ras 1 | 0.006 | 1 | 1 |
| Echinococcus multilocularis | protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Plasmodium vivax | tyrosine kinase-like protein, putative | 0.006 | 1 | 0.5 |
| Echinococcus granulosus | activated cdc42 kinase 1 | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | activin receptor type | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.006 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase kinase kinase | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Brugia malayi | ephrin receptor 1 precursor | 0.006 | 1 | 1 |
| Echinococcus granulosus | protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Brugia malayi | protein-tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | natriuretic peptide receptor 1 | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | insulin growth factor 1 receptor beta | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fgr | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Toxoplasma gondii | protein kinase domain-containing protein | 0.006 | 1 | 0.5 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Toxoplasma gondii | calcium dependent protein kinase CDPK8 | 0.006 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | epidermal growth factor receptor | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Trypanosoma brucei | Pseudokinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine protein kinase fes (fps) (ptk group IV) | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Brugia malayi | Adenylate and Guanylate cyclase catalytic domain containing protein | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Toxoplasma gondii | STE kinase | 0.006 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | macrophage colony stimulating factor 1 receptor | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase shark | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | SH2-protein kinase domain containing protein | 0.006 | 1 | 1 |
| Plasmodium falciparum | protein kinase, putative | 0.006 | 1 | 0.5 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase HCK | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Giardia lamblia | Kinase, NEK | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | serine/threonine protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | receptor type guanylyl cyclase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase kinase kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase shark | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | ephrin receptor | 0.006 | 1 | 1 |
| Echinococcus multilocularis | c src tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Src42A | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine-protein kinase fps85d | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | proto-oncogene tyrosine-protein kinase src | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | c src tyrosine kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | basic fibroblast growth factor receptor 1 A | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | FL cytokine receptor | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase HCK | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/ACK protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | bone morphogenetic protein type 1 receptor | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.006 | 1 | 1 |
| Brugia malayi | Furin-like cysteine rich region family protein | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/EPH protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | serine/threonine RGC | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase csk | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Onchocerca volvulus | Tyrosine kinase receptor Cad96Ca homolog | 0.006 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase pr2 | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Echinococcus granulosus | tyrosine protein kinase transmembrane receptor | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TKL/STKR/TYPE1 protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Toxoplasma gondii | Tyrosine kinase-like (TKL) protein | 0.006 | 1 | 0.5 |
| Echinococcus granulosus | tyrosine protein kinase Btk29A | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | protein tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | epidermal growth factor receptor | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Trypanosoma brucei | AGC/RSK family serine/threonine kinase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | atrial natriuretic peptide receptor 1 | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/ALK protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | mitogen-activated protein kinase kinase kinase 9 | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | AGC family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | retinal guanylyl cyclase 2 | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/ABL protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trypanosoma cruzi | protein kinase, putative | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Toxoplasma gondii | protein kinase | 0.006 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | Raf kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase transmembrane receptor | 0.006 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/KIN16 protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | STE family protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/CSK protein kinase | 0.006 | 1 | 1 |
| Plasmodium falciparum | protein kinase, putative | 0.006 | 1 | 0.5 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Plasmodium vivax | protein kinase, putative | 0.006 | 1 | 0.5 |
| Echinococcus granulosus | macrophage colony stimulating factor 1 receptor | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/DDR protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine- protein kinase 2, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TK family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase|tyrosine protein kinase Fyn | 0.006 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/Met protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Brugia malayi | Receptor family ligand binding region containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | natriuretic peptide receptor 1 | 0.006 | 1 | 1 |
| Brugia malayi | integrin-linked kinase | 0.006 | 1 | 1 |
| Brugia malayi | Tyrosine-protein kinase abl-1 | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | proto oncogene tyrosine protein kinase LCK | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | mitogen activated protein kinase kinase kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/RYK protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | basic fibroblast growth factor receptor 1 A | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase csk | 0.006 | 1 | 1 |
| Brugia malayi | SRC-1 | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Plasmodium falciparum | tyrosine kinase-like protein | 0.006 | 1 | 0.5 |
| Brugia malayi | C-terminal src kinase protein 1 | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | ephrin type A receptor 4 A | 0.006 | 1 | 1 |
| Trypanosoma brucei | Flagellum attachment zone protein 20 | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Plasmodium vivax | tyrosine kinase-like protein, putative | 0.006 | 1 | 0.5 |
| Giardia lamblia | Kinase, NEK | 0.006 | 1 | 1 |
| Schistosoma mansoni | src-type protein tyrosine kinase-related | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | raf serine:threonine protein kinase | 0.006 | 1 | 1 |
| Plasmodium falciparum | protein kinase, putative | 0.006 | 1 | 0.5 |
| Brugia malayi | Adenylate and Guanylate cyclase catalytic domain containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Src64B | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | br serine/threonine-protein kinase, putative | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Trypanosoma brucei | STE/STE11 serine/threonine-protein kinase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Srms | 0.006 | 1 | 1 |
| Trichomonas vaginalis | serine-threonine protein kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | ankyrin repeat protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.006 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Echinococcus multilocularis | activated cdc42 kinase 1 | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | protein tyrosine kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/KIN6 protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.006 | 1 | 1 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0021 | 0 | 0.5 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Lyn | 0.006 | 1 | 1 |
| Echinococcus granulosus | dual specificity testis-specific protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fes:Fps | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Blk | 0.006 | 1 | 1 |
| Echinococcus multilocularis | proto oncogene tyrosine protein kinase LCK | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Onchocerca volvulus | Atrial natriuretic peptide receptor 3 homolog | 0.006 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | insulin growth factor 1 receptor beta | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fes:Fps | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TKL/RAF/KSR protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Onchocerca volvulus | Tyrosine kinase homolog | 0.006 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Mycobacterium tuberculosis | Possible DNA-damage-inducible protein P DinP (DNA polymerase V) (pol IV 2) (DNA nucleotidyltransferase (DNA-directed)) | 0.0021 | 0 | 0.5 |
| Trichomonas vaginalis | ankyrin repeat-containing protein, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | receptor protein kinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | leucine-rich repeat domain-containing protein | 0.006 | 1 | 1 |
| Trypanosoma cruzi | STE/STE11 serine/threonine-protein kinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Echinococcus multilocularis | raf serine:threonine protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 1 | 1 |
| Giardia lamblia | Protein 21.1 | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Trypanosoma cruzi | STE/STE11 serine/threonine-protein kinase, putative | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Abl | 0.006 | 1 | 1 |
| Giardia lamblia | Kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | retinal guanylyl cyclase 2 | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Btk29A | 0.006 | 1 | 1 |
| Echinococcus granulosus | integrin linked protein kinase | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Onchocerca volvulus | 0.006 | 1 | 0.5 | |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.006 | 1 | 1 |
| Brugia malayi | Probable tyrosine-protein kinase kin-31 | 0.006 | 1 | 1 |
| Echinococcus granulosus | epidermal growth factor receptor | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.006 | 1 | 1 |
| Leishmania major | protein kinase, putative | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fps85D | 0.006 | 1 | 1 |
| Schistosoma mansoni | tyrosine protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase transmembrane receptor | 0.006 | 1 | 1 |
| Echinococcus granulosus | activated cdc42 kinase 1 | 0.006 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.006 | 1 | 1 |
| Trichomonas vaginalis | serine/threonine-protein kinase wnk, putative | 0.006 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.006 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.006 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.006 | 1 | 1 |
| Brugia malayi | proto-oncogene tyrosine-protein kinase FER | 0.006 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.006 | 1 | 1 |
| Echinococcus multilocularis | fibroblast growth factor receptor 4 | 0.006 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.006 | 1 | 1 |
| Echinococcus granulosus | retinal guanylyl cyclase 2 | 0.006 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| CL (ADMET) | = 100 microL/min/mg | Intrinsic clearance in mouse liver microsomes at 1 uM by LC/MS analysis | ChEMBL. | 23517371 |
| EC50 (functional) | = 0.12 uM | Antimalarial activity against erythrocytic stage of chloroquine and pyrimethamine-resistant Plasmodium falciparum K1 assessed as inhibition of [3H]-hypoxanthine incorporation incubated for 48 hrs prior to [3H]-hypoxanthine addition measured after 24 hrs by liquid scintillation counting | ChEMBL. | 23517371 |
| PB (ADMET) | = 93.7 % | Binding affinity to human albumin by HPLC analysis relative to control | ChEMBL. | 23517371 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | 23517371 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2335604
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.