Detailed information for compound 1757270
Basic information
Technical information
- TDR Targets ID: 1757270
- Name: 3-[(5Z)-5-[[5-(2-chlorophenyl)furan-2-yl]meth ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidi n-3-yl]propanoic acid
- MW: 393.864 | Formula: C17H12ClNO4S2
-
H donors: 1
H acceptors: 3
LogP: 3.87
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: OC(=O)CCN1C(=S)S/C(=C\c2ccc(o2)c2ccccc2Cl)/C1=O
- InChi: 1S/C17H12ClNO4S2/c18-12-4-2-1-3-11(12)13-6-5-10(23-13)9-14-16(22)19(17(24)25-14)8-7-15(20)21/h1-6,9H,7-8H2,(H,20,21)/b14-9-
- InChiKey: GOTSHXUIWCSXBV-ZROIWOOFSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 3-[5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid
- 3-[(5Z)-5-[[5-(2-chlorophenyl)-2-furyl]methylene]-4-oxo-2-thioxo-thiazolidin-3-yl]propanoic acid
- 3-[5-[[5-(2-chlorophenyl)-2-furyl]methylene]-4-oxo-2-thioxo-thiazolidin-3-yl]propanoic acid
- 3-[5-[[5-(2-chlorophenyl)-2-furyl]methylene]-4-oxo-2-thioxo-3-thiazolidinyl]propanoic acid
- 3-[(5Z)-5-[[5-(2-chlorophenyl)-2-furyl]methylene]-4-oxo-2-thioxo-3-thiazolidinyl]propanoic acid
- 3-[5-[[5-(2-chlorophenyl)-2-furyl]methylene]-4-keto-2-thioxo-thiazolidin-3-yl]propionic acid
- 3-[(5Z)-5-[[5-(2-chlorophenyl)-2-furyl]methylene]-4-keto-2-thioxo-thiazolidin-3-yl]propionic acid
- IDI1_008307
- IFLab1_000088
- ST5062450
- BAS 00664251
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | mitogen-activated protein kinase kinase kinase 5 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0524 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0524 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0524 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0524 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0524 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0524 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Brugia malayi | ORL1-like opioid receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0524 | 1 | 1 |
| Trypanosoma cruzi | STE/STE11 serine/threonine-protein kinase, putative | 0.0075 | 0 | 0.5 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0524 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0524 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0524 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0524 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0524 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Schistosoma mansoni | hypothetical protein | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Echinococcus granulosus | orexin receptor type 2 | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0524 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0524 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0524 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0524 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0524 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0524 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0524 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0524 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0524 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0524 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0524 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0524 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0524 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0524 | 1 | 1 |
| Trypanosoma cruzi | STE/STE11 serine/threonine-protein kinase, putative | 0.0075 | 0 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0524 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0524 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0524 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0524 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0524 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0249 | 0.3866 | 0.3866 |
| Brugia malayi | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0524 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0524 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0524 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0524 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0524 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0524 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0524 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0524 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0524 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0524 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0524 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0524 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0524 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0524 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0524 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0524 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0524 | 1 | 1 |
| Onchocerca volvulus | 0.0524 | 1 | 0.5 | |
| Echinococcus granulosus | somatostatin receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0524 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0524 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0524 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0524 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0524 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0524 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0524 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0524 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0524 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0524 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 0.75 uM | Inhibition of human ASK1 using MBP as substrate incubated for 10 mins prior to ATP addition measured after 20 mins by liquid scintillation counting analysis | ChEMBL. | 23041041 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2348832
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.