Detailed information for compound 1766769
Basic information
Technical information
- Name: Unnamed compound
- MW: 370.401 | Formula: C23H18N2O3
-
H donors: 3
H acceptors: 3
LogP: 3.77
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: ONC(=O)[C@H](c1ccccc1)NC(=O)c1ccc(cc1)C#Cc1ccccc1
- InChi: 1S/C23H18N2O3/c26-22(24-21(23(27)25-28)19-9-5-2-6-10-19)20-15-13-18(14-16-20)12-11-17-7-3-1-4-8-17/h1-10,13-16,21,28H,(H,24,26)(H,25,27)/t21-/m0/s1
- InChiKey: KHJVWCHVQMYPRJ-NRFANRHFSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Plasmodium vivax | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0241 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, cytosolic | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Mycobacterium tuberculosis | Probable glyceraldehyde 3-phosphate dehydrogenase Gap (GAPDH) | 0.0055 | 0.091 | 0.5 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0178 | 0.6911 | 0.6703 |
| Echinococcus granulosus | neuropeptide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0241 | 1 | 1 |
| Onchocerca volvulus | Tyrosine kinase homolog | 0.0147 | 0.5381 | 0.0968 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0241 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH1 | 0.016 | 0.6036 | 0.5 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3335 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Chlamydia trachomatis | glyceraldehyde-3-phosphate dehydrogenase | 0.016 | 0.6036 | 0.5 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH2 | 0.016 | 0.6036 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.016 | 0.6036 | 1 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | roundabout 2 | 0.0046 | 0.0466 | 0.0466 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.011 | 0.361 | 0.3545 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0241 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Echinococcus multilocularis | serotonin receptor | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Plasmodium falciparum | glyceraldehyde-3-phosphate dehydrogenase | 0.016 | 0.6036 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Schistosoma mansoni | histamine h1 receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.0466 | 0.0369 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0241 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.016 | 0.6036 | 0.5769 |
| Echinococcus granulosus | neuropeptide receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0241 | 1 | 1 |
| Treponema pallidum | glyceraldehyde 3-phosphate dehydrogenase (gap) | 0.016 | 0.6036 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0241 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Brugia malayi | Dopamine receptor protein 1 | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3335 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0241 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.0466 | 0.0369 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0241 | 1 | 1 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0241 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.3335 | 0.3267 |
| Brugia malayi | putative neuropeptide receptor | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.011 | 0.361 | 0.3545 |
| Echinococcus granulosus | serotonin receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0241 | 1 | 1 |
| Mycobacterium ulcerans | glyceraldehyde 3-phosphate dehydrogenase Gap | 0.016 | 0.6036 | 0.5 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0105 | 0.3335 | 0.4737 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3267 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.016 | 0.6036 | 1 |
| Wolbachia endosymbiont of Brugia malayi | glyceraldehyde-3-phosphate dehydrogenase, GapA | 0.016 | 0.6036 | 0.5 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0105 | 0.3331 | 0.4996 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neurotracting:lsamp:neurotrimin:obcam | 0.0039 | 0.0101 | 0.0101 |
| Brugia malayi | AKH receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | 0.016 | 0.6036 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | cell adhesion molecule | 0.0039 | 0.0101 | 0.0101 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3267 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.016 | 0.6036 | 1 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0241 | 1 | 1 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.0055 | 0.0905 | 0.0293 |
| Loa Loa (eye worm) | TK/KIN16 protein kinase | 0.0178 | 0.6911 | 0.688 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0105 | 0.3335 | 0.4737 |
| Mycobacterium leprae | Probable glyceraldehyde 3-phosphate dehydrogenase Gap (GAPDH) | 0.0055 | 0.091 | 0.5 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0105 | 0.3331 | 0.4996 |
| Echinococcus granulosus | g protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | roundabout 2 | 0.0046 | 0.0466 | 0.0466 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| MIC (functional) | = 3.2 uM | Antibacterial activity against wild-type Escherichia coli ARC523 by CLSI method | ChEMBL. | 23499237 |
| MIC (functional) | = 12 uM | Antibacterial activity against wild-type Plasmodium falciparum ARC545 by CLSI method | ChEMBL. | 23499237 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2377704
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.