Detailed information for compound 1770647
Basic information
Technical information
- Name: Unnamed compound
- MW: 615.717 | Formula: C38H37N3O5
-
H donors: 1
H acceptors: 2
LogP: 7.36
Rotable bonds: 13
Rule of 5 violations (Lipinski): 2 - SMILES: COc1cc(CCNC(=O)c2ccc3c(c2)nc(n3CCc2ccc(c(c2)OC)OC)c2cccc3c2cccc3)cc(c1)OC
- InChi: 1S/C38H37N3O5/c1-43-29-20-26(21-30(24-29)44-2)16-18-39-38(42)28-13-14-34-33(23-28)40-37(32-11-7-9-27-8-5-6-10-31(27)32)41(34)19-17-25-12-15-35(45-3)36(22-25)46-4/h5-15,20-24H,16-19H2,1-4H3,(H,39,42)
- InChiKey: QRSYDAOKNXFSHU-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | ectonucleotide pyrophosphatase/phosphodiesterase 2 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0139 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0139 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0139 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0139 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0139 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Schistosoma mansoni | histamine h1 receptor | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0139 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0139 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide s receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0139 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0139 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0139 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0139 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0139 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0139 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0139 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0139 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0139 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0139 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0139 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0139 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Brugia malayi | Thrombospondin type 1 domain containing protein | 0.0087 | 0.4741 | 0.4741 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Schistosoma mansoni | amine GPCR | 0.0139 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0139 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0139 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | thrombospondin type 1 domain-containing protein | 0.0087 | 0.4741 | 0.4741 |
| Schistosoma mansoni | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0139 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0139 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0139 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0139 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0139 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0139 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0139 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0139 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0139 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0139 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0139 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0139 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0139 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0139 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Echinococcus granulosus | somatostatin receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0139 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0139 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0139 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0087 | 0.4741 | 0.4741 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Echinococcus multilocularis | serotonin receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0139 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0139 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0139 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0139 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0139 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0139 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0139 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0139 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0139 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0087 | 0.4741 | 0.4741 | |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0139 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0139 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0139 | 1 | 1 |
| Onchocerca volvulus | 0.0139 | 1 | 1 | |
| Brugia malayi | sulfakinin receptor protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0139 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0139 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0139 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0139 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0139 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0139 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 1.1 uM | Inhibition of C-terminal FLAG-tagged human recombinant autotaxin using synthetic substrate FS-3 measured every 2 mins by FRET assay | ChEMBL. | 23816044 |
| Inhibition (binding) | = 63.8 % | Inhibition of C-terminal FLAG-tagged human recombinant autotaxin using synthetic substrate FS-3 at 10 uM measured every 2 mins by FRET assay relative to control | ChEMBL. | 23816044 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2418940
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.