Detailed information for compound 1775342
Basic information
Technical information
- Name: Unnamed compound
- MW: 492.732 | Formula: C33H48O3
-
H donors: 0
H acceptors: 2
LogP: 7.47
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: C#CCOC(=O)[C@@]12CC[C@H]([C@@H]([C@H]2C2=CC[C@H]3[C@@]([C@@]2(CC1)C)(C)CC[C@@H]1[C@]3(C)CCC(=O)C1(C)C)C)C
- InChi: 1S/C33H48O3/c1-9-20-36-28(35)33-17-12-21(2)22(3)27(33)23-10-11-25-30(6)15-14-26(34)29(4,5)24(30)13-16-32(25,8)31(23,7)18-19-33/h1,10,21-22,24-25,27H,11-20H2,2-8H3/t21-,22+,24+,25-,27+,30+,31-,32-,33+/m1/s1
- InChiKey: SJDABQHRPJESCI-VLHJQKRRSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase pr2 | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | carbonic anhydrase | 0.0166 | 0.2939 | 0.2796 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/RYK protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | carbonic anhydrase | 0.0166 | 0.2939 | 0.2796 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Brugia malayi | C-terminal src kinase protein 1 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | lipoxygenase | 0.0132 | 0.2012 | 0.185 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | receptor protein kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase with ankyrin repeats, putative | 0.0425 | 1 | 0.5 |
| Onchocerca volvulus | Atrial natriuretic peptide receptor 3 homolog | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TKL/STKR/TYPE1 protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/KIN16 protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Srms | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | mitogen-activated protein kinase kinase kinase 9 | 0.0425 | 1 | 1 |
| Echinococcus granulosus | mitogen activated protein kinase kinase kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TKL/MLK/ILK protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Giardia lamblia | Kinase, NEK | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0425 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Brugia malayi | Carbonic anhydrase like protein 2 precursor | 0.0166 | 0.2939 | 0.2939 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | natriuretic peptide receptor 1 | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | kinase suppressor of Ras 1 | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Src64B | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | insulin growth factor 1 receptor beta | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | epidermal growth factor receptor | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase HCK | 0.0425 | 1 | 1 |
| Schistosoma mansoni | ephrin receptor | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.0425 | 1 | 1 |
| Echinococcus granulosus | carbonic anhydrase | 0.0166 | 0.2939 | 0.2796 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine-protein kinase fps85d | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | insulin growth factor 1 receptor beta | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Leishmania major | protein kinase, putative | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/Met protein kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | receptor type guanylyl cyclase | 0.0425 | 1 | 1 |
| Plasmodium vivax | tyrosine kinase-like protein, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine kinase|tyrosine protein kinase Fyn | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | ephrin type A receptor 4 A | 0.0425 | 1 | 1 |
| Brugia malayi | Eukaryotic-type carbonic anhydrase family protein | 0.0166 | 0.2939 | 0.2939 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.0425 | 1 | 1 |
| Echinococcus granulosus | basic fibroblast growth factor receptor 1 A | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.0425 | 1 | 0.5 |
| Plasmodium falciparum | tyrosine kinase-like protein | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/CSK protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | lipoxygenase | 0.0093 | 0.0924 | 0.0739 |
| Echinococcus multilocularis | ephrin type A receptor 4 A | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Brugia malayi | integrin-linked kinase | 0.0425 | 1 | 1 |
| Brugia malayi | SH2 domain containing protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/EGFR protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Giardia lamblia | Kinase, NEK | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | heat shock protein 70 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Toxoplasma gondii | Tyrosine kinase-like (TKL) protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Brugia malayi | SH2 domain containing protein | 0.0425 | 1 | 1 |
| Schistosoma mansoni | carbonic anhydrase II (carbonate dehydratase II) | 0.0354 | 0.8068 | 0.8029 |
| Onchocerca volvulus | Tyrosine kinase homolog | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK/ACK protein kinase | 0.0425 | 1 | 1 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Schistosoma mansoni | tyrosine protein kinase fes (fps) (ptk group IV) | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase kinase kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | proto-oncogene tyrosine-protein kinase src | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Leishmania major | protein kinase, putative | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | melanoma receptor tyrosine protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Plasmodium falciparum | protein kinase, putative | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Brugia malayi | Adenylate and Guanylate cyclase catalytic domain containing protein | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | serine/threonine protein kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Eukaryotic-type carbonic anhydrase family protein | 0.0166 | 0.2939 | 0.2939 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fps85D | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | integrin linked protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | protein tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0166 | 0.2939 | 0.2939 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TK family protein kinase | 0.0425 | 1 | 0.5 |
| Brugia malayi | Raf kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Srms | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Trypanosoma brucei | Pseudokinase, putative | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | arachidonate 5 lipoxygenase | 0.0132 | 0.2012 | 0.185 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Trypanosoma brucei | STE/STE11 serine/threonine-protein kinase, putative | 0.0425 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase csk | 0.0425 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0425 | 1 | 0.5 |
| Plasmodium vivax | tyrosine kinase-like protein, putative | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine protein kinase fes (fps) (ptk group IV) | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | carbonic anhydrase-related | 0.0166 | 0.2939 | 0.2796 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Echinococcus multilocularis | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | carbonic anhydrase | 0.0166 | 0.2939 | 0.2796 |
| Echinococcus multilocularis | atrial natriuretic peptide receptor 1 | 0.0425 | 1 | 1 |
| Brugia malayi | Putative carbonic anhydrase 5 precursor | 0.0354 | 0.8068 | 0.8068 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TKL/MLK/TAK1 protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0166 | 0.2939 | 0.2796 |
| Brugia malayi | Adenylate and Guanylate cyclase catalytic domain containing protein | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | epidermal growth factor receptor | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Brugia malayi | protein-tyrosine kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Eukaryotic-type carbonic anhydrase family protein | 0.0166 | 0.2939 | 0.2939 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Btk29A | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase pr2 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | ankyrin repeat protein | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | 3'partial|retinal guanylyl cyclase 2 | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Brugia malayi | Tyrosine-protein kinase abl-1 | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Toxoplasma gondii | STE kinase | 0.0425 | 1 | 1 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | insulin receptor | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Src42A | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | 3'partial|tyrosine protein kinase Fgr | 0.0425 | 1 | 1 |
| Echinococcus granulosus | epidermal growth factor receptor | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase transmembrane receptor | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | macrophage colony stimulating factor 1 receptor | 0.0425 | 1 | 1 |
| Echinococcus granulosus | carbonic anhydrase II | 0.0354 | 0.8068 | 0.8029 |
| Echinococcus multilocularis | mitogen activated protein kinase kinase kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | retinal guanylyl cyclase 2 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | src-type protein tyrosine kinase-related | 0.0425 | 1 | 1 |
| Echinococcus granulosus | activated cdc42 kinase 1 | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | activin receptor type | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/EPH protein kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | retinal guanylyl cyclase 2 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Trypanosoma cruzi | protein kinase, putative | 0.0425 | 1 | 1 |
| Echinococcus granulosus | proto oncogene tyrosine protein kinase LCK | 0.0425 | 1 | 1 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK/DDR protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | tyrosine protein kinase csk | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/ROR protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Btk29A | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | carbonic anhydrase-related | 0.0166 | 0.2939 | 0.2796 |
| Trypanosoma cruzi | STE/STE11 serine/threonine-protein kinase, putative | 0.0425 | 1 | 1 |
| Plasmodium falciparum | protein kinase, putative | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.0425 | 1 | 1 |
| Echinococcus granulosus | activin receptor type | 0.0425 | 1 | 1 |
| Echinococcus granulosus | integrin linked protein kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | raf serine:threonine protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | arachidonate 5 lipoxygenase | 0.0132 | 0.2012 | 0.185 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | proto oncogene tyrosine protein kinase LCK | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | carbonic anhydrase | 0.0166 | 0.2939 | 0.2796 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Src42A | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TKL/RAF/RAF protein kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase ABL1 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Tyrosine-protein kinase PR2 | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/ABL protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Trypanosoma brucei | protein kinase, putative | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Fyn | 0.0425 | 1 | 1 |
| Echinococcus granulosus | natriuretic peptide receptor 1 | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Toxoplasma gondii | protein kinase domain-containing protein | 0.0425 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | serine/threonine RGC | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Plasmodium falciparum | tyrosine kinase-like protein | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/INSR protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | SRC-1 | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase HCK | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | carbonic anhydrase II | 0.0354 | 0.8068 | 0.8029 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase transmembrane receptor | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | activated cdc42 kinase 1 | 0.0425 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Echinococcus granulosus | fibroblast growth factor receptor 4 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase lyn tyrosine protein kinase blk | 0.0425 | 1 | 1 |
| Brugia malayi | Probable tyrosine-protein kinase kin-31 | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Brugia malayi | SRC-1 | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | tyrosine protein kinase shark | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine-protein kinase fps85d | 0.0425 | 1 | 1 |
| Echinococcus granulosus | activated cdc42 kinase 1 | 0.0425 | 1 | 1 |
| Brugia malayi | Tyrosine-protein kinase F09A5.2 in chromosome X, putative | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | transfer RNA-Thr | 0.0425 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Fps85D | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0066 | 0.0199 | 0.0199 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | ankyrin repeat protein | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | protein kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | FL cytokine receptor | 0.0425 | 1 | 1 |
| Brugia malayi | Furin-like cysteine rich region family protein | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | STE family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Brugia malayi | Eukaryotic-type carbonic anhydrase family protein | 0.0354 | 0.8068 | 0.8068 |
| Schistosoma mansoni | ephrin receptor | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase shark | 0.0425 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | receptor protein kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | br serine/threonine-protein kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/KIN6 protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Brugia malayi | proto-oncogene tyrosine-protein kinase FER | 0.0425 | 1 | 1 |
| Giardia lamblia | Protein 21.1 | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | tyrosine protein kinase csk | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Blk | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase Src64B | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fes:Fps | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | tyrosine protein kinase Btk29A | 0.0425 | 1 | 1 |
| Echinococcus granulosus | retinal guanylyl cyclase 2 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase transmembrane receptor | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | receptor type guanylyl cyclase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | RGC/RGC protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | serine-threonine protein kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | fibroblast growth factor receptor 4 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | protein tyrosine kinase | 0.0425 | 1 | 1 |
| Plasmodium vivax | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Giardia lamblia | Kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | carbonic anhydrase 3 | 0.0354 | 0.8068 | 0.8068 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | protein tyrosine kinase | 0.0425 | 1 | 1 |
| Trypanosoma cruzi | protein kinase, putative | 0.0425 | 1 | 1 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/ALK protein kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | eukaryotic-type carbonic anhydrase | 0.0166 | 0.2939 | 0.2939 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Fgr | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK/FAK protein kinase | 0.0425 | 1 | 1 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Entamoeba histolytica | tyrosine- protein kinase 2, putative | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | raf serine:threonine protein kinase | 0.0425 | 1 | 1 |
| Toxoplasma gondii | calcium dependent protein kinase CDPK8 | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase transmembrane receptor | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | eukaryotic-type carbonic anhydrase | 0.0354 | 0.8068 | 0.8068 |
| Loa Loa (eye worm) | hypothetical protein | 0.0166 | 0.2939 | 0.2939 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | carbonic anhydrase | 0.0166 | 0.2939 | 0.2796 |
| Brugia malayi | jmjC domain containing protein | 0.0066 | 0.0199 | 0.0199 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Brugia malayi | Probable tyrosine-protein kinase kin-31 | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosin kinase, putative | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | leucine-rich repeat domain-containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Abl | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase csk | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | protein KINase family member (kin 25) | 0.0425 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TKL/MLK/HH498 protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Fes:Fps | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | protein kinase atn1, putative | 0.0425 | 1 | 0.5 |
| Trypanosoma brucei | AGC/RSK family serine/threonine kinase, putative | 0.0425 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | cysteine surface protein, putative | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | ankyrin repeat-containing protein, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | tyrosine protein kinase Fyn | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | AGC family protein kinase | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | TK/FER protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0425 | 1 | 0.5 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | carbonic anhydrase II (carbonate dehydratase II) | 0.0354 | 0.8068 | 0.8029 |
| Brugia malayi | jmjC domain containing protein | 0.0066 | 0.0199 | 0.0199 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | c src tyrosine kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0425 | 1 | 1 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | proto-oncogene tyrosine-protein kinase src | 0.0425 | 1 | 1 |
| Echinococcus granulosus | dual specificity testis-specific protein kinase | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | protein tyrosine kinase | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TK protein kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Carbonic anhydrase like protein 2 precursor | 0.0166 | 0.2939 | 0.2939 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | c src tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | basic fibroblast growth factor receptor 1 A | 0.0425 | 1 | 1 |
| Echinococcus granulosus | retinal guanylyl cyclase 2 | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | dual specificity testis specific protein kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0425 | 1 | 0.5 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Onchocerca volvulus | 0.0425 | 1 | 0.5 | |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Onchocerca volvulus | Tyrosine kinase receptor Cad96Ca homolog | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein tyrosine kinase domain-containing protein | 0.0425 | 1 | 0.5 |
| Echinococcus granulosus | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus granulosus | atrial natriuretic peptide receptor 1 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | carbonic anhydrase-related | 0.0166 | 0.2939 | 0.2796 |
| Brugia malayi | bone morphogenetic protein type 1 receptor | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | serine/threonine-protein kinase wnk, putative | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0425 | 1 | 0.5 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Trypanosoma cruzi | STE/STE11 serine/threonine-protein kinase, putative | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | retinal guanylyl cyclase 2 | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | TKL/RAF/KSR protein kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase Lyn | 0.0425 | 1 | 1 |
| Trypanosoma brucei | Flagellum attachment zone protein 20 | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Brugia malayi | Guanylyl cyclase protein 23 | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | retinal guanylyl cyclase 2 | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | carbonic anhydrase | 0.0166 | 0.2939 | 0.2796 |
| Echinococcus granulosus | tyrosine kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | tyrosine protein kinase | 0.0425 | 1 | 1 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Loa Loa (eye worm) | protein kinase domain-containing protein | 0.0425 | 1 | 1 |
| Echinococcus granulosus | macrophage colony stimulating factor 1 receptor | 0.0425 | 1 | 1 |
| Echinococcus granulosus | epidermal growth factor receptor | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Brugia malayi | Protein kinase domain containing protein | 0.0425 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein kinase ABL1 | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0425 | 1 | 0.5 |
| Plasmodium falciparum | protein kinase, putative | 0.0425 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0425 | 1 | 0.5 |
| Brugia malayi | Receptor family ligand binding region containing protein | 0.0425 | 1 | 1 |
| Schistosoma mansoni | tyrosine kinase | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | tyrosine kinase, putative | 0.0425 | 1 | 0.5 |
| Entamoeba histolytica | SH2-protein kinase domain containing protein | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase Blk | 0.0425 | 1 | 1 |
| Toxoplasma gondii | protein kinase | 0.0425 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0425 | 1 | 1 |
| Trichomonas vaginalis | TKL family protein kinase | 0.0425 | 1 | 0.5 |
| Brugia malayi | ephrin receptor 1 precursor | 0.0425 | 1 | 1 |
| Entamoeba histolytica | serine/threonine kinase, putative | 0.0425 | 1 | 0.5 |
| Echinococcus multilocularis | tyrosine protein kinase lyn lyn a protein tyrosine kinase lymphocyte specific protein tyrosine kinase | 0.0425 | 1 | 1 |
| Toxoplasma gondii | Tyrosine kinase-like (TKL) protein | 0.0425 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0166 | 0.2939 | 0.2939 |
| Schistosoma mansoni | protein kinase | 0.0425 | 1 | 1 |
| Echinococcus multilocularis | insulin receptor | 0.0425 | 1 | 1 |
| Echinococcus granulosus | kinase suppressor of Ras 1 | 0.0425 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 15 uM | Growth inhibition of human A549 cells after 48 hrs by sulforhodamine-B assay | ChEMBL. | 23811086 |
| IC50 (functional) | = 56 uM | Growth inhibition of human MCF7 cells after 48 hrs by sulforhodamine-B assay | ChEMBL. | 23811086 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 23811086 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2414954
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.