Detailed information for compound 1822889
Basic information
Technical information
- Name: Unnamed compound
- MW: 509.554 | Formula: C26H31N5O6
-
H donors: 2
H acceptors: 5
LogP: 2
Rotable bonds: 13
Rule of 5 violations (Lipinski): 2 - SMILES: CCOC(=O)CCNC(=O)[C@@H]1C[C@H](CN1C(=O)c1coc2c1cccc2)NC(=O)c1cc(nn1C)CC
- InChi: 1S/C26H31N5O6/c1-4-16-12-20(30(3)29-16)25(34)28-17-13-21(24(33)27-11-10-23(32)36-5-2)31(14-17)26(35)19-15-37-22-9-7-6-8-18(19)22/h6-9,12,15,17,21H,4-5,10-11,13-14H2,1-3H3,(H,27,33)(H,28,34)/t17-,21+/m1/s1
- InChiKey: SKGVWBFJRIWADE-UTKZUKDTSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Mycobacterium tuberculosis | NADH-dependent enoyl-[acyl-carrier-protein] reductase InhA (NADH-dependent enoyl-ACP reductase) | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0265 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0265 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0265 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0265 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0265 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0265 | 1 | 1 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0117 | 0.2003 | 0.2003 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0265 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0265 | 1 | 1 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0117 | 0.2003 | 0.2003 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0265 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0265 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Schistosoma mansoni | histamine h1 receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0265 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0265 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0265 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0265 | 1 | 1 |
| Mycobacterium ulcerans | enoyl-(acyl carrier protein) reductase | 0.0223 | 0.7767 | 0.5 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0265 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0265 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0083 | 0.0169 | 0.0169 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0083 | 0.0169 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.0265 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0083 | 0.0169 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0117 | 0.2003 | 0.2003 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0265 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0265 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | enoyl-ACP reductase | 0.0223 | 0.7767 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0265 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Trichomonas vaginalis | hypothetical protein | 0.0223 | 0.7767 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0265 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Plasmodium falciparum | enoyl-acyl carrier reductase | 0.0223 | 0.7767 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0265 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0265 | 1 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0265 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0265 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0265 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0083 | 0.0169 | 0.0169 |
| Echinococcus granulosus | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0265 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0265 | 1 | 1 |
| Toxoplasma gondii | enoyl-acyl carrier reductase ENR | 0.0223 | 0.7767 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0265 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0265 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0265 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0265 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0117 | 0.2003 | 0.2003 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0265 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0265 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0265 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0083 | 0.0169 | 0.0169 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0265 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0265 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0265 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0265 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0265 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0265 | 1 | 1 |
| Chlamydia trachomatis | enoyl-acyl-carrier protein reductase | 0.0223 | 0.7767 | 0.5 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0265 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0265 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0265 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0265 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0265 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0265 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0265 | 1 | 1 |
| Mycobacterium tuberculosis | NADH-dependent enoyl-[acyl-carrier-protein] reductase InhA (NADH-dependent enoyl-ACP reductase) | 0.0223 | 0.7767 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0265 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Brugia malayi | putative neuropeptide receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Mycobacterium leprae | NADH-DEPENDENT ENOYL-[ACYL-CARRIER-PROTEIN] REDUCTASE INHA (NADH-DEPENDENT ENOYL-ACP REDUCTASE) | 0.0223 | 0.7767 | 0.5 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0265 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0265 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0265 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0265 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0265 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0265 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0265 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0265 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0083 | 0.0169 | 0.5 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0265 | 1 | 1 |
| Plasmodium vivax | enoyl-acyl carrier protein reductase | 0.0223 | 0.7767 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0265 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0083 | 0.0169 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0265 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0265 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0265 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0265 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0265 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0265 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0265 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0265 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0265 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0265 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0265 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0265 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0265 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0265 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0265 | 1 | 1 |
| Onchocerca volvulus | 0.0265 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide receptor | 0.0265 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 0.022 uM | Inhibition of Mycobacterium tuberculosis full length biotinylated InhA (270 amino acids) using DDCoA as substrate assessed as NADH oxidation by fluorimetric analysis | ChEMBL. | 24450589 |
| MIC90 (functional) | = 4 uM | Antitubercular activity against wild type Mycobacterium tuberculosis H37Rv ATCC 25618 assessed as growth inhibition after 6 days by resazurin dye-based assay | ChEMBL. | 24450589 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3125285
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.