Detailed information for compound 204236
Basic information
Technical information
- TDR Targets ID: 204236
- Name: 4-phenyl-1-[(2S)-2-[(2S)-2-(thiophene-2-carbo nyl)pyrrolidine-1-carbonyl]pyrrolidin-1-yl]bu tan-1-one
- MW: 424.556 | Formula: C24H28N2O3S
-
H donors: 0
H acceptors: 3
LogP: 3.97
Rotable bonds: 9
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)c1cccs1)CCCc1ccccc1
- InChi: 1S/C24H28N2O3S/c27-22(14-4-10-18-8-2-1-3-9-18)25-15-6-12-20(25)24(29)26-16-5-11-19(26)23(28)21-13-7-17-30-21/h1-3,7-9,13,17,19-20H,4-6,10-12,14-16H2/t19-,20-/m0/s1
- InChiKey: TZZIVXAWTHQIES-PMACEKPBSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 1-[(2S)-2-[oxo-[(2S)-2-[oxo(2-thienyl)methyl]-1-pyrrolidinyl]methyl]-1-pyrrolidinyl]-4-phenyl-1-butanone
- 4-phenyl-1-[(2S)-2-[(2S)-2-thiophen-2-ylcarbonylpyrrolidin-1-yl]carbonylpyrrolidin-1-yl]butan-1-one
- 4-phenyl-1-[(2S)-2-[(2S)-2-(2-thenoyl)pyrrolidine-1-carbonyl]pyrrolidino]butan-1-one
- 1-[(2S)-2-[oxo-[(2S)-2-[oxo-(2-thienyl)methyl]-1-pyrrolidinyl]methyl]-1-pyrrolidinyl]-4-phenylbutan-1-one
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Sus scrofa | Prolyl endopeptidase | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Leishmania mexicana | oligopeptidase b,serine peptidase, clan SC, family S9A-like protein | Prolyl endopeptidase | 710 aa | 720 aa | 24.7 % |
| Trypanosoma cruzi | oligopeptidase b | Prolyl endopeptidase | 710 aa | 719 aa | 25.6 % |
| Onchocerca volvulus | Prolyl endopeptidase | 710 aa | 722 aa | 47.6 % | |
| Trypanosoma cruzi | oligopeptidase b | Prolyl endopeptidase | 710 aa | 719 aa | 25.6 % |
| Trypanosoma brucei | oligopeptidase b | Prolyl endopeptidase | 710 aa | 630 aa | 26.3 % |
| Mycobacterium leprae | PROBABLE PROTEASE II PTRBB (OLIGOPEPTIDASE B) | Prolyl endopeptidase | 710 aa | 741 aa | 25.6 % |
| Leishmania donovani | oligopeptidase b | Prolyl endopeptidase | 710 aa | 743 aa | 24.4 % |
| Trypanosoma brucei gambiense | oligopeptidase B, putative | Prolyl endopeptidase | 710 aa | 629 aa | 26.4 % |
| Leishmania infantum | oligopeptidase b;with=GeneDB:LmjF09.0770 | Prolyl endopeptidase | 710 aa | 743 aa | 24.4 % |
| Trypanosoma congolense | oligopeptidase b | Prolyl endopeptidase | 710 aa | 589 aa | 27.8 % |
| Mycobacterium ulcerans | protease II (oligopeptidase B), PtrB | Prolyl endopeptidase | 710 aa | 714 aa | 26.5 % |
| Leishmania major | oligopeptidase b | Prolyl endopeptidase | 710 aa | 743 aa | 24.9 % |
| Leishmania braziliensis | oligopeptidase b;with=GeneDB:LmjF09.0770 | Prolyl endopeptidase | 710 aa | 608 aa | 26.0 % |
| Dictyostelium discoideum | oligopeptidase B | Prolyl endopeptidase | 710 aa | 735 aa | 23.7 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0163 | 1 | 1 |
| Toxoplasma gondii | prolyl endopeptidase | 0.0158 | 0.7885 | 0.5 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0163 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Brugia malayi | sulfakinin receptor protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0163 | 1 | 1 |
| Trypanosoma cruzi | prolyl endopeptidase | 0.0158 | 0.7885 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0163 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0163 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0163 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0163 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0163 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0163 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0163 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0163 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0163 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0163 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0163 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0163 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0163 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0163 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0163 | 1 | 1 |
| Mycobacterium tuberculosis | Probable protease II PtrBa [first part] (oligopeptidase B) | 0.0142 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0163 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0163 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0163 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0163 | 1 | 1 |
| Leishmania major | prolyl oligopeptidase, putative,serine peptidase clan SC, family S9A, putative | 0.0158 | 0.7885 | 0.5 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0163 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Trypanosoma brucei | prolyl endopeptidase | 0.0158 | 0.7885 | 0.5 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0163 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0163 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0163 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0163 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Brugia malayi | Serotonin receptor | 0.0163 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0163 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0163 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0163 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0163 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0163 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0163 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0163 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0163 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Schistosoma mansoni | amine GPCR | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0163 | 1 | 1 |
| Onchocerca volvulus | 0.0163 | 1 | 1 | |
| Brugia malayi | Dopamine receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0163 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0163 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0163 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0163 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0163 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 1260 nM | In vitro inhibitory activity against prolyl endopeptidase (PEP) | ChEMBL. | 7932578 |
| IC50 (binding) | = 1260 nM | In vitro inhibitory activity against prolyl endopeptidase (PEP) | ChEMBL. | 7932578 |
| IC50 (binding) | = 1910 nM | Compound was evaluated for the inhibition of Prolyl endopeptidase (PEP) from pig kidney using Z-Gly-Pro-p-nitroanilide as substrate | ChEMBL. | No reference |
| IC50 (binding) | = 1910 nM | Compound was evaluated for the inhibition of Prolyl endopeptidase (PEP) from pig kidney using Z-Gly-Pro-p-nitroanilide as substrate | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL326515
- PubChem: 10477458
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.