Detailed information for compound 2073899
Basic information
Technical information
- Name: Unnamed compound
- MW: 294.308 | Formula: C16H14N4O2
-
H donors: 2
H acceptors: 3
LogP: 2.66
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: COc1cc(/C=N/Nc2nncc3c2cccc3)ccc1O
- InChi: 1S/C16H14N4O2/c1-22-15-8-11(6-7-14(15)21)9-17-19-16-13-5-3-2-4-12(13)10-18-20-16/h2-10,21H,1H3,(H,19,20)/b17-9+
- InChiKey: SVSHYXWTWBGQIP-RQZCQDPDSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | myeloperoxidase | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Brugia malayi | Animal haem peroxidase family protein | myeloperoxidase | 745 aa | 717 aa | 37.5 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0221 | 1 | 1 |
| Giardia lamblia | Ubiquitin-conjugating enzyme E1 | 0.0069 | 0.1661 | 0.5 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0221 | 1 | 1 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0044 | 0.024 | 0.0411 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Schistosoma mansoni | peroxidasin | 0.0048 | 0.0463 | 0.029 |
| Schistosoma mansoni | opsin-like receptor | 0.0221 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | ube1-prov protein | 0.0131 | 0.5036 | 0.4913 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus multilocularis | peroxidasin | 0.0048 | 0.0463 | 0.0228 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0704 | 0.0475 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | ThiF family protein | 0.0052 | 0.0704 | 0.0475 |
| Trypanosoma cruzi | ubiquitin-activating enzyme E1, putative | 0.0069 | 0.1661 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | NEDD8 activating enzyme E1 catalytic subunit | 0.007 | 0.1687 | 0.1482 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0221 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | ube1-prov protein | 0.0131 | 0.5036 | 0.4913 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0221 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0221 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | clathrin coat associated protein ap-50 | 0.0081 | 0.2278 | 0.2138 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide receptor | 0.0221 | 1 | 1 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0101 | 0.3401 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | ubiquitin modifier activating enzyme 6 | 0.0131 | 0.5036 | 0.4913 |
| Echinococcus granulosus | peroxidasin | 0.0048 | 0.0463 | 0.0228 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Trypanosoma brucei | ubiquitin-activating enzyme E1, putative | 0.0049 | 0.0539 | 0.2098 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peroxidasin | 0.0048 | 0.0463 | 0.029 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0221 | 1 | 1 |
| Brugia malayi | Animal haem peroxidase family protein | 0.0048 | 0.0463 | 0.0228 |
| Loa Loa (eye worm) | blistered cuticle protein 3 | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | ubiquitin-activating enzyme E1C | 0.007 | 0.1687 | 0.1536 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0221 | 1 | 1 |
| Toxoplasma gondii | NEDD8-activating enzyme E1 catalytic subunit | 0.007 | 0.1687 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | ubiquitin modifier activating enzyme 1 | 0.0131 | 0.5036 | 0.4913 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | animal heme peroxidase | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0221 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | ubiquitin modifier activating enzyme 6 | 0.0131 | 0.5036 | 0.4913 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0044 | 0.024 | 0.0411 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0221 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | animal heme peroxidase | 0.0048 | 0.0463 | 0.0228 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | app binding protein | 0.0044 | 0.024 | 0.0063 |
| Brugia malayi | neuropeptide F receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0221 | 1 | 1 |
| Entamoeba histolytica | ubiquitin-activating enzyme E1 1, putative | 0.0101 | 0.3401 | 0.6591 |
| Plasmodium falciparum | ubiquitin-activating enzyme E1 | 0.0131 | 0.5036 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0221 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0221 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Brugia malayi | Peroxidasin | 0.0048 | 0.0463 | 0.0228 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0221 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0052 | 0.0704 | 0.3205 |
| Schistosoma mansoni | neuropeptide receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Schistosoma mansoni | biogenic amine receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Entamoeba histolytica | ubiquitin-activating enzyme, putative | 0.0131 | 0.5036 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0221 | 1 | 1 |
| Trypanosoma brucei | ubiquitin-activating enzyme E1, putative | 0.0069 | 0.1661 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0221 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0221 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0221 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0221 | 1 | 1 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0101 | 0.3401 | 1 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1c, putative | 0.0101 | 0.3401 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0221 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | sumo-1-activating enzyme E1a | 0.0052 | 0.0704 | 0.0535 |
| Echinococcus multilocularis | serotonin receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | ectopic membrane ruffles in embryo protein 1 | 0.007 | 0.1687 | 0.1482 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0221 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0221 | 1 | 1 |
| Brugia malayi | Animal haem peroxidase family protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0221 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0221 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0221 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Brugia malayi | Blistered cuticle protein 3 | 0.0048 | 0.0463 | 0.0228 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0221 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Brugia malayi | Animal haem peroxidase family protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus granulosus | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0221 | 1 | 1 |
| Echinococcus granulosus | SUMO activating enzyme subunit 1 | 0.0052 | 0.0704 | 0.0475 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1 X, putative | 0.0045 | 0.0315 | 0.0636 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Brugia malayi | putative neuropeptide receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0463 | 0.0228 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0221 | 1 | 1 |
| Plasmodium vivax | ubiquitin activating enzyme, putative | 0.0052 | 0.0704 | 0.5 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | SUMO activating enzyme subunit 1 | 0.0052 | 0.0704 | 0.0475 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0221 | 1 | 1 |
| Brugia malayi | Ectopic membrane ruffles in embryo protein 1 | 0.007 | 0.1687 | 0.1482 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0221 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0221 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0221 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Brugia malayi | Animal haem peroxidase family protein | 0.0048 | 0.0463 | 0.0228 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0221 | 1 | 1 |
| Leishmania major | ubiquitin-activating enzyme e1, putative | 0.0049 | 0.0539 | 0.2098 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | ubiquitin-activating enzyme E1 | 0.0105 | 0.3625 | 0.3509 |
| Brugia malayi | G-protein coupled receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | animal heme peroxidase | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Echinococcus multilocularis | ubiquitin modifier activating enzyme 1 | 0.0131 | 0.5036 | 0.4913 |
| Echinococcus granulosus | neuropeptide receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | clathrin coat associated protein ap-50 | 0.0081 | 0.2278 | 0.2138 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Leishmania major | ubiquitin-activating enzyme e1, putative | 0.0069 | 0.1661 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | animal heme peroxidase | 0.0048 | 0.0463 | 0.0228 |
| Entamoeba histolytica | ubiquitin-activating enzyme, putative | 0.007 | 0.1687 | 0.3017 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0221 | 1 | 1 |
| Trypanosoma cruzi | ubiquitin-activating enzyme E1, putative | 0.0069 | 0.1661 | 1 |
| Echinococcus multilocularis | NEDD8 activating enzyme E1 catalytic subunit | 0.007 | 0.1687 | 0.1482 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0221 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0221 | 1 | 1 |
| Brugia malayi | Animal haem peroxidase family protein | 0.0048 | 0.0463 | 0.0228 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0052 | 0.0732 | 0.1901 |
| Brugia malayi | Dopamine receptor | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 1 | |
| Echinococcus multilocularis | fmrfamide receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Trypanosoma cruzi | NEDD8-activating enzyme E1 regulatory subunit, putative | 0.0044 | 0.024 | 0.1447 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0221 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (binding) | = 22 % | Inhibition of human MPO assessed as residual activity in absence of H2O | LITERATURE. | 28197313 |
| Activity (binding) | = 87 % | Inhibition of human MPO assessed as residual activity in presence of H2O2 | LITERATURE. | 28197313 |
| IC50 (binding) | = 0.34 uM | Inhibition of human MPO | LITERATURE. | 28197313 |
| Inhibition (binding) | Irreversible inhibition of human MPO in presence of H2O2 by stopped-flow method | LITERATURE. | 28197313 | |
| Inhibition (binding) | = 82 % | Inhibition of human MPO | LITERATURE. | 28197313 |
| K (binding) | = 2.8 10'5/M/s | Inhibition of human MPO assessed as rate constant for reduction of PorFe(4)=O to PorFe(4)-OH in presence of H2O2 by stopped-flow method | LITERATURE. | 28197313 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3545483
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.