Detailed information for compound 2073900
Basic information
Technical information
- Name: Unnamed compound
- MW: 280.281 | Formula: C15H12N4O2
-
H donors: 3
H acceptors: 4
LogP: 2.33
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: Oc1ccc(cc1O)/C=N/Nc1nncc2c1cccc2
- InChi: 1S/C15H12N4O2/c20-13-6-5-10(7-14(13)21)8-16-18-15-12-4-2-1-3-11(12)9-17-19-15/h1-9,20-21H,(H,18,19)/b16-8+
- InChiKey: ZTVGLXIASJEACE-LZYBPNLTSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0101 | 0.3401 | 1 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1c, putative | 0.0101 | 0.3401 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0221 | 1 | 1 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0052 | 0.0732 | 0.1901 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0221 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | ubiquitin-activating enzyme E1C | 0.007 | 0.1687 | 0.1536 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Plasmodium falciparum | ubiquitin-activating enzyme E1 | 0.0131 | 0.5036 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0221 | 1 | 1 |
| Leishmania major | ubiquitin-activating enzyme e1, putative | 0.0069 | 0.1661 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0221 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0221 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0221 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0221 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0221 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0221 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0221 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | SUMO activating enzyme subunit 1 | 0.0052 | 0.0704 | 0.0475 |
| Echinococcus granulosus | neuropeptide receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1 X, putative | 0.0045 | 0.0315 | 0.0636 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0221 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0221 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0221 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0221 | 1 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Brugia malayi | Serotonin receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0221 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0221 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0221 | 1 | 1 |
| Trypanosoma brucei | ubiquitin-activating enzyme E1, putative | 0.0049 | 0.0539 | 0.2098 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0221 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | ubiquitin-activating enzyme E1 | 0.0105 | 0.3625 | 0.3509 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | ube1-prov protein | 0.0131 | 0.5036 | 0.4913 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0044 | 0.024 | 0.0411 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0704 | 0.0475 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Plasmodium vivax | ubiquitin activating enzyme, putative | 0.0052 | 0.0704 | 0.5 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Loa Loa (eye worm) | ectopic membrane ruffles in embryo protein 1 | 0.007 | 0.1687 | 0.1482 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0221 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0221 | 1 | 0.5 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Trypanosoma brucei | ubiquitin-activating enzyme E1, putative | 0.0069 | 0.1661 | 1 |
| Schistosoma mansoni | clathrin coat associated protein ap-50 | 0.0081 | 0.2278 | 0.2138 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Entamoeba histolytica | ubiquitin-activating enzyme, putative | 0.007 | 0.1687 | 0.3017 |
| Giardia lamblia | Ubiquitin-conjugating enzyme E1 | 0.0069 | 0.1661 | 0.5 |
| Brugia malayi | Ectopic membrane ruffles in embryo protein 1 | 0.007 | 0.1687 | 0.1482 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Brugia malayi | larval opioid receptor | 0.0221 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0221 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0052 | 0.0704 | 0.3205 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | ubiquitin modifier activating enzyme 1 | 0.0131 | 0.5036 | 0.4913 |
| Schistosoma mansoni | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Trypanosoma cruzi | NEDD8-activating enzyme E1 regulatory subunit, putative | 0.0044 | 0.024 | 0.1447 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0221 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0221 | 1 | 1 |
| Brugia malayi | ThiF family protein | 0.0052 | 0.0704 | 0.0475 |
| Echinococcus multilocularis | serotonin receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0221 | 1 | 1 |
| Trypanosoma cruzi | ubiquitin-activating enzyme E1, putative | 0.0069 | 0.1661 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | ubiquitin modifier activating enzyme 1 | 0.0131 | 0.5036 | 0.4913 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | clathrin coat associated protein ap-50 | 0.0081 | 0.2278 | 0.2138 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0221 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0101 | 0.3401 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | ubiquitin modifier activating enzyme 6 | 0.0131 | 0.5036 | 0.4913 |
| Echinococcus granulosus | g protein coupled receptor | 0.0221 | 1 | 1 |
| Trypanosoma cruzi | ubiquitin-activating enzyme E1, putative | 0.0069 | 0.1661 | 1 |
| Schistosoma mansoni | sumo-1-activating enzyme E1a | 0.0052 | 0.0704 | 0.0535 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0221 | 1 | 1 |
| Toxoplasma gondii | NEDD8-activating enzyme E1 catalytic subunit | 0.007 | 0.1687 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus granulosus | ubiquitin modifier activating enzyme 6 | 0.0131 | 0.5036 | 0.4913 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0221 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0221 | 1 | 1 |
| Brugia malayi | ube1-prov protein | 0.0131 | 0.5036 | 0.4913 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0221 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | app binding protein | 0.0044 | 0.024 | 0.0063 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0221 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0221 | 1 | 1 |
| Leishmania major | ubiquitin-activating enzyme e1, putative | 0.0049 | 0.0539 | 0.2098 |
| Trichomonas vaginalis | ubiquitin-activating enzyme E1, putative | 0.0044 | 0.024 | 0.0411 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0221 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0221 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Schistosoma mansoni | opsin-like receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0221 | 1 | 1 |
| Echinococcus granulosus | NEDD8 activating enzyme E1 catalytic subunit | 0.007 | 0.1687 | 0.1482 |
| Echinococcus multilocularis | NEDD8 activating enzyme E1 catalytic subunit | 0.007 | 0.1687 | 0.1482 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0221 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Echinococcus granulosus | SUMO activating enzyme subunit 1 | 0.0052 | 0.0704 | 0.0475 |
| Schistosoma mansoni | amine GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0221 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Onchocerca volvulus | 0.0221 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0221 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0221 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0221 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0221 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0221 | 1 | 1 |
| Entamoeba histolytica | ubiquitin-activating enzyme E1 1, putative | 0.0101 | 0.3401 | 0.6591 |
| Entamoeba histolytica | ubiquitin-activating enzyme, putative | 0.0131 | 0.5036 | 1 |
| Brugia malayi | RE15519p | 0.0221 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0221 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0221 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0221 | 1 | 1 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL3545484
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.